aboutsummaryrefslogtreecommitdiffstatshomepage
path: root/lib/scripts/jquery/jquery-ui.js
diff options
context:
space:
mode:
authorAndreas Gohr <andi@splitbrain.org>2013-02-03 22:57:45 +0100
committerAndreas Gohr <andi@splitbrain.org>2013-02-03 22:57:45 +0100
commit3da7921f08ecdda929466921ecc50698f1adf99e (patch)
tree0e179e504399e874bfd785d0a95eec44b76d5952 /lib/scripts/jquery/jquery-ui.js
parent6cf2bbfa12b776cf47cb69ae40fb8862f715ad01 (diff)
parentcc4bb766fdac23358d7b586aa3830b9650eed7a8 (diff)
downloaddokuwiki-3da7921f08ecdda929466921ecc50698f1adf99e.tar.gz
dokuwiki-3da7921f08ecdda929466921ecc50698f1adf99e.zip
Merge branch 'master' into future
* master: (162 commits) fixed revision JS for images upgraded SimplePie to 1.3.1 FS#2708 removed obsolete browser plugin (migrate does it) adjust spacing to match standard 1.4em grid added comment on use of whitelist vs blacklist Updated idfilter() function for IIS use var and remove suggestions when needed Use variable for maximum number of suggestions for quicksearch. And hide suggestions when search field is emptied, or when no suggestion are found. added 'home' class to first link in hierarchical breadcrumbs reduced required max width to go into tablet mode re-added linear gradients for firefox added missing styling for disabled form elements (FS#2705) fixed acronyms in italics (FS#2684) improved print styles (includes fixes for FS#2645 and FS#2707) basic styles improvements Greek language update Use list in acl help text, for more structure Galician language update touch the config on save, even if no changes were made unwind the width narrowing commit put some whitespace between form submit button and fieldset bottom border ... Conflicts: lib/plugins/config/admin.php lib/plugins/config/settings/config.class.php
Diffstat (limited to 'lib/scripts/jquery/jquery-ui.js')
-rwxr-xr-x[-rw-r--r--]lib/scripts/jquery/jquery-ui.js11873
1 files changed, 7509 insertions, 4364 deletions
diff --git a/lib/scripts/jquery/jquery-ui.js b/lib/scripts/jquery/jquery-ui.js
index cd515f361..2f83e5a2a 100644..100755
--- a/lib/scripts/jquery/jquery-ui.js
+++ b/lib/scripts/jquery/jquery-ui.js
@@ -1,14 +1,13 @@
-/*!
- * jQuery UI 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI
- */
+/*! jQuery UI - v1.9.2 - 2012-11-23
+* http://jqueryui.com
+* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.effect.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js, jquery.ui.menu.js, jquery.ui.position.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js
+* Copyright 2012 jQuery Foundation and other contributors; Licensed MIT */
+
(function( $, undefined ) {
+var uuid = 0,
+ runiqueId = /^ui-id-\d+$/;
+
// prevent duplicate loading
// this is only a problem because we proxy existing functions
// and we don't want to double proxy them
@@ -18,26 +17,18 @@ if ( $.ui.version ) {
}
$.extend( $.ui, {
- version: "1.8.16",
+ version: "1.9.2",
keyCode: {
- ALT: 18,
BACKSPACE: 8,
- CAPS_LOCK: 20,
COMMA: 188,
- COMMAND: 91,
- COMMAND_LEFT: 91, // COMMAND
- COMMAND_RIGHT: 93,
- CONTROL: 17,
DELETE: 46,
DOWN: 40,
END: 35,
ENTER: 13,
ESCAPE: 27,
HOME: 36,
- INSERT: 45,
LEFT: 37,
- MENU: 93, // COMMAND_RIGHT
NUMPAD_ADD: 107,
NUMPAD_DECIMAL: 110,
NUMPAD_DIVIDE: 111,
@@ -48,18 +39,14 @@ $.extend( $.ui, {
PAGE_UP: 33,
PERIOD: 190,
RIGHT: 39,
- SHIFT: 16,
SPACE: 32,
TAB: 9,
- UP: 38,
- WINDOWS: 91 // COMMAND
+ UP: 38
}
});
// plugins
$.fn.extend({
- propAttr: $.fn.prop || $.fn.attr,
-
_focus: $.fn.focus,
focus: function( delay, fn ) {
return typeof delay === "number" ?
@@ -77,13 +64,13 @@ $.fn.extend({
scrollParent: function() {
var scrollParent;
- if (($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ if (($.ui.ie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
scrollParent = this.parents().filter(function() {
- return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ return (/(relative|absolute|fixed)/).test($.css(this,'position')) && (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x'));
}).eq(0);
} else {
scrollParent = this.parents().filter(function() {
- return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ return (/(auto|scroll)/).test($.css(this,'overflow')+$.css(this,'overflow-y')+$.css(this,'overflow-x'));
}).eq(0);
}
@@ -119,95 +106,63 @@ $.fn.extend({
return 0;
},
- disableSelection: function() {
- return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
- ".ui-disableSelection", function( event ) {
- event.preventDefault();
- });
- },
-
- enableSelection: function() {
- return this.unbind( ".ui-disableSelection" );
- }
-});
-
-$.each( [ "Width", "Height" ], function( i, name ) {
- var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
- type = name.toLowerCase(),
- orig = {
- innerWidth: $.fn.innerWidth,
- innerHeight: $.fn.innerHeight,
- outerWidth: $.fn.outerWidth,
- outerHeight: $.fn.outerHeight
- };
-
- function reduce( elem, size, border, margin ) {
- $.each( side, function() {
- size -= parseFloat( $.curCSS( elem, "padding" + this, true) ) || 0;
- if ( border ) {
- size -= parseFloat( $.curCSS( elem, "border" + this + "Width", true) ) || 0;
- }
- if ( margin ) {
- size -= parseFloat( $.curCSS( elem, "margin" + this, true) ) || 0;
- }
- });
- return size;
- }
-
- $.fn[ "inner" + name ] = function( size ) {
- if ( size === undefined ) {
- return orig[ "inner" + name ].call( this );
- }
-
+ uniqueId: function() {
return this.each(function() {
- $( this ).css( type, reduce( this, size ) + "px" );
+ if ( !this.id ) {
+ this.id = "ui-id-" + (++uuid);
+ }
});
- };
-
- $.fn[ "outer" + name] = function( size, margin ) {
- if ( typeof size !== "number" ) {
- return orig[ "outer" + name ].call( this, size );
- }
+ },
+ removeUniqueId: function() {
return this.each(function() {
- $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ if ( runiqueId.test( this.id ) ) {
+ $( this ).removeAttr( "id" );
+ }
});
- };
+ }
});
// selectors
function focusable( element, isTabIndexNotNaN ) {
- var nodeName = element.nodeName.toLowerCase();
+ var map, mapName, img,
+ nodeName = element.nodeName.toLowerCase();
if ( "area" === nodeName ) {
- var map = element.parentNode,
- mapName = map.name,
- img;
+ map = element.parentNode;
+ mapName = map.name;
if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
return false;
}
img = $( "img[usemap=#" + mapName + "]" )[0];
return !!img && visible( img );
}
- return ( /input|select|textarea|button|object/.test( nodeName )
- ? !element.disabled
- : "a" == nodeName
- ? element.href || isTabIndexNotNaN
- : isTabIndexNotNaN)
+ return ( /input|select|textarea|button|object/.test( nodeName ) ?
+ !element.disabled :
+ "a" === nodeName ?
+ element.href || isTabIndexNotNaN :
+ isTabIndexNotNaN) &&
// the element and all of its ancestors must be visible
- && visible( element );
+ visible( element );
}
function visible( element ) {
- return !$( element ).parents().andSelf().filter(function() {
- return $.curCSS( this, "visibility" ) === "hidden" ||
- $.expr.filters.hidden( this );
- }).length;
+ return $.expr.filters.visible( element ) &&
+ !$( element ).parents().andSelf().filter(function() {
+ return $.css( this, "visibility" ) === "hidden";
+ }).length;
}
$.extend( $.expr[ ":" ], {
- data: function( elem, i, match ) {
- return !!$.data( elem, match[ 3 ] );
- },
+ data: $.expr.createPseudo ?
+ $.expr.createPseudo(function( dataName ) {
+ return function( elem ) {
+ return !!$.data( elem, dataName );
+ };
+ }) :
+ // support: jQuery <1.8
+ function( elem, i, match ) {
+ return !!$.data( elem, match[ 3 ] );
+ },
focusable: function( element ) {
return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) );
@@ -225,6 +180,11 @@ $(function() {
var body = document.body,
div = body.appendChild( div = document.createElement( "div" ) );
+ // access offsetHeight before setting the style to prevent a layout bug
+ // in IE 9 which causes the element to continue to take up space even
+ // after it is removed from the DOM (#8026)
+ div.offsetHeight;
+
$.extend( div.style, {
minHeight: "100px",
height: "auto",
@@ -240,57 +200,134 @@ $(function() {
body.removeChild( div ).style.display = "none";
});
+// support: jQuery <1.8
+if ( !$( "<a>" ).outerWidth( 1 ).jquery ) {
+ $.each( [ "Width", "Height" ], function( i, name ) {
+ var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+ type = name.toLowerCase(),
+ orig = {
+ innerWidth: $.fn.innerWidth,
+ innerHeight: $.fn.innerHeight,
+ outerWidth: $.fn.outerWidth,
+ outerHeight: $.fn.outerHeight
+ };
+
+ function reduce( elem, size, border, margin ) {
+ $.each( side, function() {
+ size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
+ if ( border ) {
+ size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
+ }
+ if ( margin ) {
+ size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
+ }
+ });
+ return size;
+ }
+
+ $.fn[ "inner" + name ] = function( size ) {
+ if ( size === undefined ) {
+ return orig[ "inner" + name ].call( this );
+ }
+
+ return this.each(function() {
+ $( this ).css( type, reduce( this, size ) + "px" );
+ });
+ };
+
+ $.fn[ "outer" + name] = function( size, margin ) {
+ if ( typeof size !== "number" ) {
+ return orig[ "outer" + name ].call( this, size );
+ }
+
+ return this.each(function() {
+ $( this).css( type, reduce( this, size, true, margin ) + "px" );
+ });
+ };
+ });
+}
+
+// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413)
+if ( $( "<a>" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) {
+ $.fn.removeData = (function( removeData ) {
+ return function( key ) {
+ if ( arguments.length ) {
+ return removeData.call( this, $.camelCase( key ) );
+ } else {
+ return removeData.call( this );
+ }
+ };
+ })( $.fn.removeData );
+}
+
// deprecated
+
+(function() {
+ var uaMatch = /msie ([\w.]+)/.exec( navigator.userAgent.toLowerCase() ) || [];
+ $.ui.ie = uaMatch.length ? true : false;
+ $.ui.ie6 = parseFloat( uaMatch[ 1 ], 10 ) === 6;
+})();
+
+$.fn.extend({
+ disableSelection: function() {
+ return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) +
+ ".ui-disableSelection", function( event ) {
+ event.preventDefault();
+ });
+ },
+
+ enableSelection: function() {
+ return this.unbind( ".ui-disableSelection" );
+ }
+});
+
$.extend( $.ui, {
// $.ui.plugin is deprecated. Use the proxy pattern instead.
plugin: {
add: function( module, option, set ) {
- var proto = $.ui[ module ].prototype;
- for ( var i in set ) {
+ var i,
+ proto = $.ui[ module ].prototype;
+ for ( i in set ) {
proto.plugins[ i ] = proto.plugins[ i ] || [];
proto.plugins[ i ].push( [ option, set[ i ] ] );
}
},
call: function( instance, name, args ) {
- var set = instance.plugins[ name ];
- if ( !set || !instance.element[ 0 ].parentNode ) {
+ var i,
+ set = instance.plugins[ name ];
+ if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) {
return;
}
-
- for ( var i = 0; i < set.length; i++ ) {
+
+ for ( i = 0; i < set.length; i++ ) {
if ( instance.options[ set[ i ][ 0 ] ] ) {
set[ i ][ 1 ].apply( instance.element, args );
}
}
}
},
-
- // will be deprecated when we switch to jQuery 1.4 - use jQuery.contains()
- contains: function( a, b ) {
- return document.compareDocumentPosition ?
- a.compareDocumentPosition( b ) & 16 :
- a !== b && a.contains( b );
- },
-
+
+ contains: $.contains,
+
// only used by resizable
hasScroll: function( el, a ) {
-
+
//If overflow is hidden, the element might have extra content, but the user wants to hide it
if ( $( el ).css( "overflow" ) === "hidden") {
return false;
}
-
+
var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
has = false;
-
+
if ( el[ scroll ] > 0 ) {
return true;
}
-
+
// TODO: determine which cases actually cause this to happen
// if the element doesn't have the scroll set, see if it's possible to
// set the scroll
@@ -299,7 +336,7 @@ $.extend( $.ui, {
el[ scroll ] = 0;
return has;
},
-
+
// these are odd functions, fix the API or move into individual plugins
isOverAxis: function( x, reference, size ) {
//Determines when x coordinate is over "b" element axis
@@ -312,51 +349,26 @@ $.extend( $.ui, {
});
})( jQuery );
-/*!
- * jQuery UI Widget 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Widget
- */
+
(function( $, undefined ) {
-// jQuery 1.4+
-if ( $.cleanData ) {
- var _cleanData = $.cleanData;
- $.cleanData = function( elems ) {
- for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
- try {
- $( elem ).triggerHandler( "remove" );
- // http://bugs.jquery.com/ticket/8235
- } catch( e ) {}
- }
- _cleanData( elems );
- };
-} else {
- var _remove = $.fn.remove;
- $.fn.remove = function( selector, keepData ) {
- return this.each(function() {
- if ( !keepData ) {
- if ( !selector || $.filter( selector, [ this ] ).length ) {
- $( "*", this ).add( [ this ] ).each(function() {
- try {
- $( this ).triggerHandler( "remove" );
- // http://bugs.jquery.com/ticket/8235
- } catch( e ) {}
- });
- }
- }
- return _remove.call( $(this), selector, keepData );
- });
- };
-}
+var uuid = 0,
+ slice = Array.prototype.slice,
+ _cleanData = $.cleanData;
+$.cleanData = function( elems ) {
+ for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) {
+ try {
+ $( elem ).triggerHandler( "remove" );
+ // http://bugs.jquery.com/ticket/8235
+ } catch( e ) {}
+ }
+ _cleanData( elems );
+};
$.widget = function( name, base, prototype ) {
- var namespace = name.split( "." )[ 0 ],
- fullName;
+ var fullName, existingConstructor, constructor, basePrototype,
+ namespace = name.split( "." )[ 0 ];
+
name = name.split( "." )[ 1 ];
fullName = namespace + "-" + name;
@@ -366,81 +378,167 @@ $.widget = function( name, base, prototype ) {
}
// create selector for plugin
- $.expr[ ":" ][ fullName ] = function( elem ) {
- return !!$.data( elem, name );
+ $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+ return !!$.data( elem, fullName );
};
$[ namespace ] = $[ namespace ] || {};
- $[ namespace ][ name ] = function( options, element ) {
+ existingConstructor = $[ namespace ][ name ];
+ constructor = $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without "new" keyword
+ if ( !this._createWidget ) {
+ return new constructor( options, element );
+ }
+
// allow instantiation without initializing for simple inheritance
+ // must use "new" keyword (the code above always passes args)
if ( arguments.length ) {
this._createWidget( options, element );
}
};
+ // extend with the existing constructor to carry over any static properties
+ $.extend( constructor, existingConstructor, {
+ version: prototype.version,
+ // copy the object used to create the prototype in case we need to
+ // redefine the widget later
+ _proto: $.extend( {}, prototype ),
+ // track widgets that inherit from this widget in case this widget is
+ // redefined after a widget inherits from it
+ _childConstructors: []
+ });
- var basePrototype = new base();
+ basePrototype = new base();
// we need to make the options hash a property directly on the new instance
// otherwise we'll modify the options hash on the prototype that we're
// inheriting from
-// $.each( basePrototype, function( key, val ) {
-// if ( $.isPlainObject(val) ) {
-// basePrototype[ key ] = $.extend( {}, val );
-// }
-// });
- basePrototype.options = $.extend( true, {}, basePrototype.options );
- $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ basePrototype.options = $.widget.extend( {}, basePrototype.options );
+ $.each( prototype, function( prop, value ) {
+ if ( $.isFunction( value ) ) {
+ prototype[ prop ] = (function() {
+ var _super = function() {
+ return base.prototype[ prop ].apply( this, arguments );
+ },
+ _superApply = function( args ) {
+ return base.prototype[ prop ].apply( this, args );
+ };
+ return function() {
+ var __super = this._super,
+ __superApply = this._superApply,
+ returnValue;
+
+ this._super = _super;
+ this._superApply = _superApply;
+
+ returnValue = value.apply( this, arguments );
+
+ this._super = __super;
+ this._superApply = __superApply;
+
+ return returnValue;
+ };
+ })();
+ }
+ });
+ constructor.prototype = $.widget.extend( basePrototype, {
+ // TODO: remove support for widgetEventPrefix
+ // always use the name + a colon as the prefix, e.g., draggable:start
+ // don't prefix for widgets that aren't DOM-based
+ widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name
+ }, prototype, {
+ constructor: constructor,
namespace: namespace,
widgetName: name,
- widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
- widgetBaseClass: fullName
- }, prototype );
+ // TODO remove widgetBaseClass, see #8155
+ widgetBaseClass: fullName,
+ widgetFullName: fullName
+ });
+
+ // If this widget is being redefined then we need to find all widgets that
+ // are inheriting from it and redefine all of them so that they inherit from
+ // the new version of this widget. We're essentially trying to replace one
+ // level in the prototype chain.
+ if ( existingConstructor ) {
+ $.each( existingConstructor._childConstructors, function( i, child ) {
+ var childPrototype = child.prototype;
+
+ // redefine the child widget using the same prototype that was
+ // originally used, but inherit from the new version of the base
+ $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto );
+ });
+ // remove the list of existing child constructors from the old constructor
+ // so the old child constructors can be garbage collected
+ delete existingConstructor._childConstructors;
+ } else {
+ base._childConstructors.push( constructor );
+ }
- $.widget.bridge( name, $[ namespace ][ name ] );
+ $.widget.bridge( name, constructor );
+};
+
+$.widget.extend = function( target ) {
+ var input = slice.call( arguments, 1 ),
+ inputIndex = 0,
+ inputLength = input.length,
+ key,
+ value;
+ for ( ; inputIndex < inputLength; inputIndex++ ) {
+ for ( key in input[ inputIndex ] ) {
+ value = input[ inputIndex ][ key ];
+ if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+ // Clone objects
+ if ( $.isPlainObject( value ) ) {
+ target[ key ] = $.isPlainObject( target[ key ] ) ?
+ $.widget.extend( {}, target[ key ], value ) :
+ // Don't extend strings, arrays, etc. with objects
+ $.widget.extend( {}, value );
+ // Copy everything else by reference
+ } else {
+ target[ key ] = value;
+ }
+ }
+ }
+ }
+ return target;
};
$.widget.bridge = function( name, object ) {
+ var fullName = object.prototype.widgetFullName || name;
$.fn[ name ] = function( options ) {
var isMethodCall = typeof options === "string",
- args = Array.prototype.slice.call( arguments, 1 ),
+ args = slice.call( arguments, 1 ),
returnValue = this;
// allow multiple hashes to be passed on init
options = !isMethodCall && args.length ?
- $.extend.apply( null, [ true, options ].concat(args) ) :
+ $.widget.extend.apply( null, [ options ].concat(args) ) :
options;
- // prevent calls to internal methods
- if ( isMethodCall && options.charAt( 0 ) === "_" ) {
- return returnValue;
- }
-
if ( isMethodCall ) {
this.each(function() {
- var instance = $.data( this, name ),
- methodValue = instance && $.isFunction( instance[options] ) ?
- instance[ options ].apply( instance, args ) :
- instance;
- // TODO: add this back in 1.9 and use $.error() (see #5972)
-// if ( !instance ) {
-// throw "cannot call methods on " + name + " prior to initialization; " +
-// "attempted to call method '" + options + "'";
-// }
-// if ( !$.isFunction( instance[options] ) ) {
-// throw "no such method '" + options + "' for " + name + " widget instance";
-// }
-// var methodValue = instance[ options ].apply( instance, args );
+ var methodValue,
+ instance = $.data( this, fullName );
+ if ( !instance ) {
+ return $.error( "cannot call methods on " + name + " prior to initialization; " +
+ "attempted to call method '" + options + "'" );
+ }
+ if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) {
+ return $.error( "no such method '" + options + "' for " + name + " widget instance" );
+ }
+ methodValue = instance[ options ].apply( instance, args );
if ( methodValue !== instance && methodValue !== undefined ) {
- returnValue = methodValue;
+ returnValue = methodValue && methodValue.jquery ?
+ returnValue.pushStack( methodValue.get() ) :
+ methodValue;
return false;
}
});
} else {
this.each(function() {
- var instance = $.data( this, name );
+ var instance = $.data( this, fullName );
if ( instance ) {
instance.option( options || {} )._init();
} else {
- $.data( this, name, new object( options, this ) );
+ $.data( this, fullName, new object( options, this ) );
}
});
}
@@ -449,74 +547,126 @@ $.widget.bridge = function( name, object ) {
};
};
-$.Widget = function( options, element ) {
- // allow instantiation without initializing for simple inheritance
- if ( arguments.length ) {
- this._createWidget( options, element );
- }
-};
+$.Widget = function( /* options, element */ ) {};
+$.Widget._childConstructors = [];
$.Widget.prototype = {
widgetName: "widget",
widgetEventPrefix: "",
+ defaultElement: "<div>",
options: {
- disabled: false
+ disabled: false,
+
+ // callbacks
+ create: null
},
_createWidget: function( options, element ) {
- // $.widget.bridge stores the plugin instance, but we do it anyway
- // so that it's stored even before the _create function runs
- $.data( element, this.widgetName, this );
+ element = $( element || this.defaultElement || this )[ 0 ];
this.element = $( element );
- this.options = $.extend( true, {},
+ this.uuid = uuid++;
+ this.eventNamespace = "." + this.widgetName + this.uuid;
+ this.options = $.widget.extend( {},
this.options,
this._getCreateOptions(),
options );
- var self = this;
- this.element.bind( "remove." + this.widgetName, function() {
- self.destroy();
- });
+ this.bindings = $();
+ this.hoverable = $();
+ this.focusable = $();
+
+ if ( element !== this ) {
+ // 1.9 BC for #7810
+ // TODO remove dual storage
+ $.data( element, this.widgetName, this );
+ $.data( element, this.widgetFullName, this );
+ this._on( true, this.element, {
+ remove: function( event ) {
+ if ( event.target === element ) {
+ this.destroy();
+ }
+ }
+ });
+ this.document = $( element.style ?
+ // element within the document
+ element.ownerDocument :
+ // element is window or document
+ element.document || element );
+ this.window = $( this.document[0].defaultView || this.document[0].parentWindow );
+ }
this._create();
- this._trigger( "create" );
+ this._trigger( "create", null, this._getCreateEventData() );
this._init();
},
- _getCreateOptions: function() {
- return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
- },
- _create: function() {},
- _init: function() {},
+ _getCreateOptions: $.noop,
+ _getCreateEventData: $.noop,
+ _create: $.noop,
+ _init: $.noop,
destroy: function() {
+ this._destroy();
+ // we can probably remove the unbind calls in 2.0
+ // all event bindings should go through this._on()
this.element
- .unbind( "." + this.widgetName )
- .removeData( this.widgetName );
+ .unbind( this.eventNamespace )
+ // 1.9 BC for #7810
+ // TODO remove dual storage
+ .removeData( this.widgetName )
+ .removeData( this.widgetFullName )
+ // support: jquery <1.6.3
+ // http://bugs.jquery.com/ticket/9413
+ .removeData( $.camelCase( this.widgetFullName ) );
this.widget()
- .unbind( "." + this.widgetName )
+ .unbind( this.eventNamespace )
.removeAttr( "aria-disabled" )
.removeClass(
- this.widgetBaseClass + "-disabled " +
+ this.widgetFullName + "-disabled " +
"ui-state-disabled" );
+
+ // clean up events and states
+ this.bindings.unbind( this.eventNamespace );
+ this.hoverable.removeClass( "ui-state-hover" );
+ this.focusable.removeClass( "ui-state-focus" );
},
+ _destroy: $.noop,
widget: function() {
return this.element;
},
option: function( key, value ) {
- var options = key;
+ var options = key,
+ parts,
+ curOption,
+ i;
if ( arguments.length === 0 ) {
// don't return a reference to the internal hash
- return $.extend( {}, this.options );
+ return $.widget.extend( {}, this.options );
}
- if (typeof key === "string" ) {
- if ( value === undefined ) {
- return this.options[ key ];
- }
+ if ( typeof key === "string" ) {
+ // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
options = {};
- options[ key ] = value;
+ parts = key.split( "." );
+ key = parts.shift();
+ if ( parts.length ) {
+ curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+ for ( i = 0; i < parts.length - 1; i++ ) {
+ curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+ curOption = curOption[ parts[ i ] ];
+ }
+ key = parts.pop();
+ if ( value === undefined ) {
+ return curOption[ key ] === undefined ? null : curOption[ key ];
+ }
+ curOption[ key ] = value;
+ } else {
+ if ( value === undefined ) {
+ return this.options[ key ] === undefined ? null : this.options[ key ];
+ }
+ options[ key ] = value;
+ }
}
this._setOptions( options );
@@ -524,10 +674,11 @@ $.Widget.prototype = {
return this;
},
_setOptions: function( options ) {
- var self = this;
- $.each( options, function( key, value ) {
- self._setOption( key, value );
- });
+ var key;
+
+ for ( key in options ) {
+ this._setOption( key, options[ key ] );
+ }
return this;
},
@@ -536,10 +687,10 @@ $.Widget.prototype = {
if ( key === "disabled" ) {
this.widget()
- [ value ? "addClass" : "removeClass"](
- this.widgetBaseClass + "-disabled" + " " +
- "ui-state-disabled" )
+ .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value )
.attr( "aria-disabled", value );
+ this.hoverable.removeClass( "ui-state-hover" );
+ this.focusable.removeClass( "ui-state-focus" );
}
return this;
@@ -552,46 +703,172 @@ $.Widget.prototype = {
return this._setOption( "disabled", true );
},
+ _on: function( suppressDisabledCheck, element, handlers ) {
+ var delegateElement,
+ instance = this;
+
+ // no suppressDisabledCheck flag, shuffle arguments
+ if ( typeof suppressDisabledCheck !== "boolean" ) {
+ handlers = element;
+ element = suppressDisabledCheck;
+ suppressDisabledCheck = false;
+ }
+
+ // no element argument, shuffle and use this.element
+ if ( !handlers ) {
+ handlers = element;
+ element = this.element;
+ delegateElement = this.widget();
+ } else {
+ // accept selectors, DOM elements
+ element = delegateElement = $( element );
+ this.bindings = this.bindings.add( element );
+ }
+
+ $.each( handlers, function( event, handler ) {
+ function handlerProxy() {
+ // allow widgets to customize the disabled handling
+ // - disabled as an array instead of boolean
+ // - disabled class as method for disabling individual parts
+ if ( !suppressDisabledCheck &&
+ ( instance.options.disabled === true ||
+ $( this ).hasClass( "ui-state-disabled" ) ) ) {
+ return;
+ }
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
+ }
+
+ // copy the guid so direct unbinding works
+ if ( typeof handler !== "string" ) {
+ handlerProxy.guid = handler.guid =
+ handler.guid || handlerProxy.guid || $.guid++;
+ }
+
+ var match = event.match( /^(\w+)\s*(.*)$/ ),
+ eventName = match[1] + instance.eventNamespace,
+ selector = match[2];
+ if ( selector ) {
+ delegateElement.delegate( selector, eventName, handlerProxy );
+ } else {
+ element.bind( eventName, handlerProxy );
+ }
+ });
+ },
+
+ _off: function( element, eventName ) {
+ eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace;
+ element.unbind( eventName ).undelegate( eventName );
+ },
+
+ _delay: function( handler, delay ) {
+ function handlerProxy() {
+ return ( typeof handler === "string" ? instance[ handler ] : handler )
+ .apply( instance, arguments );
+ }
+ var instance = this;
+ return setTimeout( handlerProxy, delay || 0 );
+ },
+
+ _hoverable: function( element ) {
+ this.hoverable = this.hoverable.add( element );
+ this._on( element, {
+ mouseenter: function( event ) {
+ $( event.currentTarget ).addClass( "ui-state-hover" );
+ },
+ mouseleave: function( event ) {
+ $( event.currentTarget ).removeClass( "ui-state-hover" );
+ }
+ });
+ },
+
+ _focusable: function( element ) {
+ this.focusable = this.focusable.add( element );
+ this._on( element, {
+ focusin: function( event ) {
+ $( event.currentTarget ).addClass( "ui-state-focus" );
+ },
+ focusout: function( event ) {
+ $( event.currentTarget ).removeClass( "ui-state-focus" );
+ }
+ });
+ },
+
_trigger: function( type, event, data ) {
- var callback = this.options[ type ];
+ var prop, orig,
+ callback = this.options[ type ];
+ data = data || {};
event = $.Event( event );
event.type = ( type === this.widgetEventPrefix ?
type :
this.widgetEventPrefix + type ).toLowerCase();
- data = data || {};
+ // the original event may come from any element
+ // so we need to reset the target on the new event
+ event.target = this.element[ 0 ];
// copy original event properties over to the new event
- // this would happen if we could call $.event.fix instead of $.Event
- // but we don't have a way to force an event to be fixed multiple times
- if ( event.originalEvent ) {
- for ( var i = $.event.props.length, prop; i; ) {
- prop = $.event.props[ --i ];
- event[ prop ] = event.originalEvent[ prop ];
+ orig = event.originalEvent;
+ if ( orig ) {
+ for ( prop in orig ) {
+ if ( !( prop in event ) ) {
+ event[ prop ] = orig[ prop ];
+ }
}
}
this.element.trigger( event, data );
-
- return !( $.isFunction(callback) &&
- callback.call( this.element[0], event, data ) === false ||
+ return !( $.isFunction( callback ) &&
+ callback.apply( this.element[0], [ event ].concat( data ) ) === false ||
event.isDefaultPrevented() );
}
};
+$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+ $.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+ if ( typeof options === "string" ) {
+ options = { effect: options };
+ }
+ var hasOptions,
+ effectName = !options ?
+ method :
+ options === true || typeof options === "number" ?
+ defaultEffect :
+ options.effect || defaultEffect;
+ options = options || {};
+ if ( typeof options === "number" ) {
+ options = { duration: options };
+ }
+ hasOptions = !$.isEmptyObject( options );
+ options.complete = callback;
+ if ( options.delay ) {
+ element.delay( options.delay );
+ }
+ if ( hasOptions && $.effects && ( $.effects.effect[ effectName ] || $.uiBackCompat !== false && $.effects[ effectName ] ) ) {
+ element[ method ]( options );
+ } else if ( effectName !== method && element[ effectName ] ) {
+ element[ effectName ]( options.duration, options.easing, callback );
+ } else {
+ element.queue(function( next ) {
+ $( this )[ method ]();
+ if ( callback ) {
+ callback.call( element[ 0 ] );
+ }
+ next();
+ });
+ }
+ };
+});
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+ $.Widget.prototype._getCreateOptions = function() {
+ return $.metadata && $.metadata.get( this.element[0] )[ this.widgetName ];
+ };
+}
+
})( jQuery );
-/*!
- * jQuery UI Mouse 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Mouse
- *
- * Depends:
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
var mouseHandled = false;
@@ -600,21 +877,22 @@ $( document ).mouseup( function( e ) {
});
$.widget("ui.mouse", {
+ version: "1.9.2",
options: {
- cancel: ':input,option',
+ cancel: 'input,textarea,button,select,option',
distance: 1,
delay: 0
},
_mouseInit: function() {
- var self = this;
+ var that = this;
this.element
.bind('mousedown.'+this.widgetName, function(event) {
- return self._mouseDown(event);
+ return that._mouseDown(event);
})
.bind('click.'+this.widgetName, function(event) {
- if (true === $.data(event.target, self.widgetName + '.preventClickEvent')) {
- $.removeData(event.target, self.widgetName + '.preventClickEvent');
+ if (true === $.data(event.target, that.widgetName + '.preventClickEvent')) {
+ $.removeData(event.target, that.widgetName + '.preventClickEvent');
event.stopImmediatePropagation();
return false;
}
@@ -627,22 +905,27 @@ $.widget("ui.mouse", {
// other instances of mouse
_mouseDestroy: function() {
this.element.unbind('.'+this.widgetName);
+ if ( this._mouseMoveDelegate ) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+ }
},
_mouseDown: function(event) {
// don't let more than one widget handle mouseStart
- if( mouseHandled ) { return };
+ if( mouseHandled ) { return; }
// we may have missed mouseup (out of window)
(this._mouseStarted && this._mouseUp(event));
this._mouseDownEvent = event;
- var self = this,
- btnIsLeft = (event.which == 1),
+ var that = this,
+ btnIsLeft = (event.which === 1),
// event.target.nodeName works around a bug in IE 8 with
// disabled inputs (#7620)
- elIsCancel = (typeof this.options.cancel == "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
+ elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false);
if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
return true;
}
@@ -650,7 +933,7 @@ $.widget("ui.mouse", {
this.mouseDelayMet = !this.options.delay;
if (!this.mouseDelayMet) {
this._mouseDelayTimer = setTimeout(function() {
- self.mouseDelayMet = true;
+ that.mouseDelayMet = true;
}, this.options.delay);
}
@@ -669,24 +952,24 @@ $.widget("ui.mouse", {
// these delegates are required to keep context
this._mouseMoveDelegate = function(event) {
- return self._mouseMove(event);
+ return that._mouseMove(event);
};
this._mouseUpDelegate = function(event) {
- return self._mouseUp(event);
+ return that._mouseUp(event);
};
$(document)
.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
event.preventDefault();
-
+
mouseHandled = true;
return true;
},
_mouseMove: function(event) {
// IE mouseup check - mouseup happened when mouse was out of window
- if ($.browser.msie && !(document.documentMode >= 9) && !event.button) {
+ if ($.ui.ie && !(document.documentMode >= 9) && !event.button) {
return this._mouseUp(event);
}
@@ -712,8 +995,8 @@ $.widget("ui.mouse", {
if (this._mouseStarted) {
this._mouseStarted = false;
- if (event.target == this._mouseDownEvent.target) {
- $.data(event.target, this.widgetName + '.preventClickEvent', true);
+ if (event.target === this._mouseDownEvent.target) {
+ $.data(event.target, this.widgetName + '.preventClickEvent', true);
}
this._mouseStop(event);
@@ -742,23 +1025,11 @@ $.widget("ui.mouse", {
});
})(jQuery);
-/*
- * jQuery UI Draggable 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
$.widget("ui.draggable", $.ui.mouse, {
+ version: "1.9.2",
widgetEventPrefix: "drag",
options: {
addClasses: true,
@@ -798,17 +1069,9 @@ $.widget("ui.draggable", $.ui.mouse, {
},
- destroy: function() {
- if(!this.element.data('draggable')) return;
- this.element
- .removeData("draggable")
- .unbind(".draggable")
- .removeClass("ui-draggable"
- + " ui-draggable-dragging"
- + " ui-draggable-disabled");
+ _destroy: function() {
+ this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" );
this._mouseDestroy();
-
- return this;
},
_mouseCapture: function(event) {
@@ -823,18 +1086,16 @@ $.widget("ui.draggable", $.ui.mouse, {
this.handle = this._getHandle(event);
if (!this.handle)
return false;
-
- if ( o.iframeFix ) {
- $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
- $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
- .css({
- width: this.offsetWidth+"px", height: this.offsetHeight+"px",
- position: "absolute", opacity: "0.001", zIndex: 1000
- })
- .css($(this).offset())
- .appendTo("body");
- });
- }
+
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
return true;
@@ -847,6 +1108,8 @@ $.widget("ui.draggable", $.ui.mouse, {
//Create and append the visible helper
this.helper = this._createHelper(event);
+ this.helper.addClass("ui-draggable-dragging");
+
//Cache the helper size
this._cacheHelperProportions();
@@ -907,12 +1170,12 @@ $.widget("ui.draggable", $.ui.mouse, {
if ($.ui.ddmanager && !o.dropBehaviour)
$.ui.ddmanager.prepareOffsets(this, event);
- this.helper.addClass("ui-draggable-dragging");
+
this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
-
+
//If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003)
if ( $.ui.ddmanager ) $.ui.ddmanager.dragStart(this, event);
-
+
return true;
},
@@ -951,16 +1214,22 @@ $.widget("ui.draggable", $.ui.mouse, {
dropped = this.dropped;
this.dropped = false;
}
-
- //if the original element is removed, don't bother to continue if helper is set to "original"
- if((!this.element[0] || !this.element[0].parentNode) && this.options.helper == "original")
+
+ //if the original element is no longer in the DOM don't bother to continue (see #8269)
+ var element = this.element[0], elementInDom = false;
+ while ( element && (element = element.parentNode) ) {
+ if (element == document ) {
+ elementInDom = true;
+ }
+ }
+ if ( !elementInDom && this.options.helper === "original" )
return false;
if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
- var self = this;
+ var that = this;
$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
- if(self._trigger("stop", event) !== false) {
- self._clear();
+ if(that._trigger("stop", event) !== false) {
+ that._clear();
}
});
} else {
@@ -971,30 +1240,29 @@ $.widget("ui.draggable", $.ui.mouse, {
return false;
},
-
+
_mouseUp: function(event) {
- if (this.options.iframeFix === true) {
- $("div.ui-draggable-iframeFix").each(function() {
- this.parentNode.removeChild(this);
- }); //Remove frame helpers
- }
-
+ //Remove frame helpers
+ $("div.ui-draggable-iframeFix").each(function() {
+ this.parentNode.removeChild(this);
+ });
+
//If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003)
if( $.ui.ddmanager ) $.ui.ddmanager.dragStop(this, event);
-
+
return $.ui.mouse.prototype._mouseUp.call(this, event);
},
-
+
cancel: function() {
-
+
if(this.helper.is(".ui-draggable-dragging")) {
this._mouseUp({});
} else {
this._clear();
}
-
+
return this;
-
+
},
_getHandle: function(event) {
@@ -1057,13 +1325,13 @@ $.widget("ui.draggable", $.ui.mouse, {
// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
po.left += this.scrollParent.scrollLeft();
po.top += this.scrollParent.scrollTop();
}
if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix
po = { top: 0, left: 0 };
return {
@@ -1115,7 +1383,7 @@ $.widget("ui.draggable", $.ui.mouse, {
];
if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
- var c = $(o.containment);
+ var c = $(o.containment);
var ce = c[0]; if(!ce) return;
var co = c.offset();
var over = ($(ce).css("overflow") != 'hidden');
@@ -1138,20 +1406,20 @@ $.widget("ui.draggable", $.ui.mouse, {
if(!pos) pos = this.position;
var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
return {
top: (
pos.top // The absolute mouse position
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
),
left: (
pos.left // The absolute mouse position
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
)
};
@@ -1159,7 +1427,7 @@ $.widget("ui.draggable", $.ui.mouse, {
_generatePosition: function(event) {
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
var pageX = event.pageX;
var pageY = event.pageY;
@@ -1169,18 +1437,18 @@ $.widget("ui.draggable", $.ui.mouse, {
*/
if(this.originalPosition) { //If we are not dragging yet, we won't check for options
- var containment;
- if(this.containment) {
- if (this.relative_container){
- var co = this.relative_container.offset();
- containment = [ this.containment[0] + co.left,
- this.containment[1] + co.top,
- this.containment[2] + co.left,
- this.containment[3] + co.top ];
- }
- else {
- containment = this.containment;
- }
+ var containment;
+ if(this.containment) {
+ if (this.relative_container){
+ var co = this.relative_container.offset();
+ containment = [ this.containment[0] + co.left,
+ this.containment[1] + co.top,
+ this.containment[2] + co.left,
+ this.containment[3] + co.top ];
+ }
+ else {
+ containment = this.containment;
+ }
if(event.pageX - this.offset.click.left < containment[0]) pageX = containment[0] + this.offset.click.left;
if(event.pageY - this.offset.click.top < containment[1]) pageY = containment[1] + this.offset.click.top;
@@ -1205,14 +1473,14 @@ $.widget("ui.draggable", $.ui.mouse, {
- this.offset.click.top // Click offset (relative to the element)
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
),
left: (
pageX // The absolute mouse position
- this.offset.click.left // Click offset (relative to the element)
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
)
};
@@ -1248,10 +1516,6 @@ $.widget("ui.draggable", $.ui.mouse, {
});
-$.extend($.ui.draggable, {
- version: "1.8.16"
-});
-
$.ui.plugin.add("draggable", "connectToSortable", {
start: function(event, ui) {
@@ -1307,7 +1571,7 @@ $.ui.plugin.add("draggable", "connectToSortable", {
},
drag: function(event, ui) {
- var inst = $(this).data("draggable"), self = this;
+ var inst = $(this).data("draggable"), that = this;
var checkPos = function(o) {
var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
@@ -1319,14 +1583,30 @@ $.ui.plugin.add("draggable", "connectToSortable", {
};
$.each(inst.sortables, function(i) {
-
+
+ var innermostIntersecting = false;
+ var thisSortable = this;
//Copy over some variables to allow calling the sortable's native _intersectsWith
this.instance.positionAbs = inst.positionAbs;
this.instance.helperProportions = inst.helperProportions;
this.instance.offset.click = inst.offset.click;
-
+
if(this.instance._intersectsWith(this.instance.containerCache)) {
+ innermostIntersecting = true;
+ $.each(inst.sortables, function () {
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+ if (this != thisSortable
+ && this.instance._intersectsWith(this.instance.containerCache)
+ && $.ui.contains(thisSortable.instance.element[0], this.instance.element[0]))
+ innermostIntersecting = false;
+ return innermostIntersecting;
+ });
+ }
+
+ if(innermostIntersecting) {
//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
if(!this.instance.isOver) {
@@ -1334,7 +1614,7 @@ $.ui.plugin.add("draggable", "connectToSortable", {
//Now we fake the start of dragging for the sortable instance,
//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
- this.instance.currentItem = $(self).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.currentItem = $(that).clone().removeAttr('id').appendTo(this.instance.element).data("sortable-item", true);
this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
this.instance.options.helper = function() { return ui.helper[0]; };
@@ -1367,13 +1647,13 @@ $.ui.plugin.add("draggable", "connectToSortable", {
this.instance.isOver = 0;
this.instance.cancelHelperRemoval = true;
-
+
//Prevent reverting on this forced stop
this.instance.options.revert = false;
-
+
// The out event needs to be triggered independently
this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-
+
this.instance._mouseStop(event, true);
this.instance.options.helper = this.instance.options._helper;
@@ -1543,7 +1823,7 @@ $.ui.plugin.add("draggable", "stack", {
return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
});
if (!group.length) { return; }
-
+
var min = parseInt(group[0].style.zIndex) || 0;
$(group).each(function(i) {
this.style.zIndex = min + i;
@@ -1567,24 +1847,11 @@ $.ui.plugin.add("draggable", "zIndex", {
});
})(jQuery);
-/*
- * jQuery UI Droppable 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.mouse.js
- * jquery.ui.draggable.js
- */
+
(function( $, undefined ) {
$.widget("ui.droppable", {
+ version: "1.9.2",
widgetEventPrefix: "drop",
options: {
accept: '*',
@@ -1615,18 +1882,13 @@ $.widget("ui.droppable", {
},
- destroy: function() {
+ _destroy: function() {
var drop = $.ui.ddmanager.droppables[this.options.scope];
for ( var i = 0; i < drop.length; i++ )
if ( drop[i] == this )
drop.splice(i, 1);
- this.element
- .removeClass("ui-droppable ui-droppable-disabled")
- .removeData("droppable")
- .unbind(".droppable");
-
- return this;
+ this.element.removeClass("ui-droppable ui-droppable-disabled");
},
_setOption: function(key, value) {
@@ -1715,10 +1977,6 @@ $.widget("ui.droppable", {
});
-$.extend($.ui.droppable, {
- version: "1.8.16"
-});
-
$.ui.intersect = function(draggable, droppable, toleranceMode) {
if (!droppable.offset) return false;
@@ -1796,7 +2054,7 @@ $.ui.ddmanager = {
if(!this.options) return;
if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
- dropped = dropped || this._drop.call(this, event);
+ dropped = this._drop.call(this, event) || dropped;
if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
this.isout = 1; this.isover = 0;
@@ -1809,7 +2067,7 @@ $.ui.ddmanager = {
},
dragStart: function( draggable, event ) {
//Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003)
- draggable.element.parents( ":not(body,html)" ).bind( "scroll.droppable", function() {
+ draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() {
if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
});
},
@@ -1829,7 +2087,12 @@ $.ui.ddmanager = {
var parentInstance;
if (this.options.greedy) {
- var parent = this.element.parents(':data(droppable):eq(0)');
+ // find droppable parents with same scope
+ var scope = this.options.scope;
+ var parent = this.element.parents(':data(droppable)').filter(function () {
+ return $.data(this, 'droppable').options.scope === scope;
+ });
+
if (parent.length) {
parentInstance = $.data(parent[0], 'droppable');
parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
@@ -1856,30 +2119,18 @@ $.ui.ddmanager = {
},
dragStop: function( draggable, event ) {
- draggable.element.parents( ":not(body,html)" ).unbind( "scroll.droppable" );
+ draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" );
//Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003)
if( !draggable.options.refreshPositions ) $.ui.ddmanager.prepareOffsets( draggable, event );
}
};
})(jQuery);
-/*
- * jQuery UI Resizable 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
$.widget("ui.resizable", $.ui.mouse, {
+ version: "1.9.2",
widgetEventPrefix: "resize",
options: {
alsoResize: false,
@@ -1901,7 +2152,7 @@ $.widget("ui.resizable", $.ui.mouse, {
},
_create: function() {
- var self = this, o = this.options;
+ var that = this, o = this.options;
this.element.addClass("ui-resizable");
$.extend(this, {
@@ -1915,10 +2166,6 @@ $.widget("ui.resizable", $.ui.mouse, {
//Wrap the element if it cannot hold child nodes
if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
- //Opera fix for relative positioning
- if (/relative/.test(this.element.css('position')) && $.browser.opera)
- this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
-
//Create a wrapper element and set the wrapper to the new current internal element
this.element.wrap(
$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
@@ -1967,9 +2214,8 @@ $.widget("ui.resizable", $.ui.mouse, {
var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
- // increase zIndex of sw, se, ne, nw axis
- //TODO : this modifies original option
- if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+ // Apply zIndex to all handles - see #7960
+ axis.css({ zIndex: o.zIndex });
//TODO : What's going on here?
if ('se' == handle) {
@@ -2027,11 +2273,11 @@ $.widget("ui.resizable", $.ui.mouse, {
//Matching axis name
this._handles.mouseover(function() {
- if (!self.resizing) {
+ if (!that.resizing) {
if (this.className)
var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
//Axis, default = se
- self.axis = axis && axis[1] ? axis[1] : 'se';
+ that.axis = axis && axis[1] ? axis[1] : 'se';
}
});
@@ -2040,16 +2286,16 @@ $.widget("ui.resizable", $.ui.mouse, {
this._handles.hide();
$(this.element)
.addClass("ui-resizable-autohide")
- .hover(function() {
+ .mouseenter(function() {
if (o.disabled) return;
$(this).removeClass("ui-resizable-autohide");
- self._handles.show();
- },
- function(){
+ that._handles.show();
+ })
+ .mouseleave(function(){
if (o.disabled) return;
- if (!self.resizing) {
+ if (!that.resizing) {
$(this).addClass("ui-resizable-autohide");
- self._handles.hide();
+ that._handles.hide();
}
});
}
@@ -2059,28 +2305,27 @@ $.widget("ui.resizable", $.ui.mouse, {
},
- destroy: function() {
+ _destroy: function() {
this._mouseDestroy();
var _destroy = function(exp) {
$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
- .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
};
//TODO: Unwrap at same DOM position
if (this.elementIsWrapper) {
_destroy(this.element);
var wrapper = this.element;
- wrapper.after(
- this.originalElement.css({
- position: wrapper.css('position'),
- width: wrapper.outerWidth(),
- height: wrapper.outerHeight(),
- top: wrapper.css('top'),
- left: wrapper.css('left')
- })
- ).remove();
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ }).insertAfter( wrapper );
+ wrapper.remove();
}
this.originalElement.css('resize', this.originalResizeStyle);
@@ -2112,10 +2357,6 @@ $.widget("ui.resizable", $.ui.mouse, {
el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
}
- //Opera fixing relative position
- if ($.browser.opera && (/relative/).test(el.css('position')))
- el.css({ position: 'relative', top: 'auto', left: 'auto' });
-
this._renderProxy();
var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
@@ -2137,8 +2378,8 @@ $.widget("ui.resizable", $.ui.mouse, {
//Aspect Ratio
this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
- var cursor = $('.ui-resizable-' + this.axis).css('cursor');
- $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
el.addClass("ui-resizable-resizing");
this._propagate("start", event);
@@ -2149,14 +2390,14 @@ $.widget("ui.resizable", $.ui.mouse, {
//Increase performance, avoid regex
var el = this.helper, o = this.options, props = {},
- self = this, smp = this.originalMousePosition, a = this.axis;
+ that = this, smp = this.originalMousePosition, a = this.axis;
var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
var trigger = this._change[a];
if (!trigger) return false;
// Calculate the attrs that will be change
- var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+ var data = trigger.apply(this, [event, dx, dy]);
// Put this in the mouseDrag handler since the user can start pressing shift while resizing
this._updateVirtualBoundaries(event.shiftKey);
@@ -2187,22 +2428,22 @@ $.widget("ui.resizable", $.ui.mouse, {
_mouseStop: function(event) {
this.resizing = false;
- var o = this.options, self = this;
+ var o = this.options, that = this;
if(this._helper) {
var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : that.sizeDiff.height,
+ soffsetw = ista ? 0 : that.sizeDiff.width;
- var s = { width: (self.helper.width() - soffsetw), height: (self.helper.height() - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+ var s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) },
+ left = (parseInt(that.element.css('left'), 10) + (that.position.left - that.originalPosition.left)) || null,
+ top = (parseInt(that.element.css('top'), 10) + (that.position.top - that.originalPosition.top)) || null;
if (!o.animate)
this.element.css($.extend(s, { top: top, left: left }));
- self.helper.height(self.size.height);
- self.helper.width(self.size.width);
+ that.helper.height(that.size.height);
+ that.helper.width(that.size.width);
if (this._helper && !o.animate) this._proportionallyResize();
}
@@ -2218,31 +2459,31 @@ $.widget("ui.resizable", $.ui.mouse, {
},
- _updateVirtualBoundaries: function(forceAspectRatio) {
- var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
+ _updateVirtualBoundaries: function(forceAspectRatio) {
+ var o = this.options, pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b;
- b = {
- minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
- maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
- minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
- maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
- };
+ b = {
+ minWidth: isNumber(o.minWidth) ? o.minWidth : 0,
+ maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity,
+ minHeight: isNumber(o.minHeight) ? o.minHeight : 0,
+ maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity
+ };
- if(this._aspectRatio || forceAspectRatio) {
- // We want to create an enclosing box whose aspect ration is the requested one
- // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
- pMinWidth = b.minHeight * this.aspectRatio;
- pMinHeight = b.minWidth / this.aspectRatio;
- pMaxWidth = b.maxHeight * this.aspectRatio;
- pMaxHeight = b.maxWidth / this.aspectRatio;
+ if(this._aspectRatio || forceAspectRatio) {
+ // We want to create an enclosing box whose aspect ration is the requested one
+ // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension
+ pMinWidth = b.minHeight * this.aspectRatio;
+ pMinHeight = b.minWidth / this.aspectRatio;
+ pMaxWidth = b.maxHeight * this.aspectRatio;
+ pMaxHeight = b.maxWidth / this.aspectRatio;
- if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
- if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
- if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
- if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
- }
- this._vBoundaries = b;
- },
+ if(pMinWidth > b.minWidth) b.minWidth = pMinWidth;
+ if(pMinHeight > b.minHeight) b.minHeight = pMinHeight;
+ if(pMaxWidth < b.maxWidth) b.maxWidth = pMaxWidth;
+ if(pMaxHeight < b.maxHeight) b.maxHeight = pMaxHeight;
+ }
+ this._vBoundaries = b;
+ },
_updateCache: function(data) {
var o = this.options;
@@ -2319,9 +2560,6 @@ $.widget("ui.resizable", $.ui.mouse, {
});
}
- if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
- continue;
-
prel.css({
height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
@@ -2341,8 +2579,8 @@ $.widget("ui.resizable", $.ui.mouse, {
this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
// fix ie6 offset TODO: This seems broken
- var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
- pxyoffset = ( ie6 ? 2 : -1 );
+ var ie6offset = ($.ui.ie6 ? 1 : 0),
+ pxyoffset = ( $.ui.ie6 ? 2 : -1 );
this.helper.addClass(this._helper).css({
width: this.element.outerWidth() + pxyoffset,
@@ -2413,10 +2651,6 @@ $.widget("ui.resizable", $.ui.mouse, {
});
-$.extend($.ui.resizable, {
- version: "1.8.16"
-});
-
/*
* Resizable Extensions
*/
@@ -2424,15 +2658,14 @@ $.extend($.ui.resizable, {
$.ui.plugin.add("resizable", "alsoResize", {
start: function (event, ui) {
- var self = $(this).data("resizable"), o = self.options;
+ var that = $(this).data("resizable"), o = that.options;
var _store = function (exp) {
$(exp).each(function() {
var el = $(this);
el.data("resizable-alsoresize", {
width: parseInt(el.width(), 10), height: parseInt(el.height(), 10),
- left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10),
- position: el.css('position') // to reset Opera on stop()
+ left: parseInt(el.css('left'), 10), top: parseInt(el.css('top'), 10)
});
});
};
@@ -2446,16 +2679,16 @@ $.ui.plugin.add("resizable", "alsoResize", {
},
resize: function (event, ui) {
- var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+ var that = $(this).data("resizable"), o = that.options, os = that.originalSize, op = that.originalPosition;
var delta = {
- height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
- top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0,
+ top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0
},
_alsoResize = function (exp, c) {
$(exp).each(function() {
- var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {},
css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ['width', 'height'] : ['width', 'height', 'top', 'left'];
$.each(css, function (i, prop) {
@@ -2464,12 +2697,6 @@ $.ui.plugin.add("resizable", "alsoResize", {
style[prop] = sum || null;
});
- // Opera fixing relative position
- if ($.browser.opera && /relative/.test(el.css('position'))) {
- self._revertToRelativePosition = true;
- el.css({ position: 'absolute', top: 'auto', left: 'auto' });
- }
-
el.css(style);
});
};
@@ -2482,25 +2709,6 @@ $.ui.plugin.add("resizable", "alsoResize", {
},
stop: function (event, ui) {
- var self = $(this).data("resizable"), o = self.options;
-
- var _reset = function (exp) {
- $(exp).each(function() {
- var el = $(this);
- // reset position for Opera - no need to verify it was changed
- el.css({ position: el.data("resizable-alsoresize").position });
- });
- };
-
- if (self._revertToRelativePosition) {
- self._revertToRelativePosition = false;
- if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
- $.each(o.alsoResize, function (exp) { _reset(exp); });
- }else{
- _reset(o.alsoResize);
- }
- }
-
$(this).removeData("resizable-alsoresize");
}
});
@@ -2508,34 +2716,34 @@ $.ui.plugin.add("resizable", "alsoResize", {
$.ui.plugin.add("resizable", "animate", {
stop: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options;
+ var that = $(this).data("resizable"), o = that.options;
- var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
- soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
- soffsetw = ista ? 0 : self.sizeDiff.width;
+ var pr = that._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : that.sizeDiff.height,
+ soffsetw = ista ? 0 : that.sizeDiff.width;
- var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
- left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
- top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+ var style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) },
+ left = (parseInt(that.element.css('left'), 10) + (that.position.left - that.originalPosition.left)) || null,
+ top = (parseInt(that.element.css('top'), 10) + (that.position.top - that.originalPosition.top)) || null;
- self.element.animate(
+ that.element.animate(
$.extend(style, top && left ? { top: top, left: left } : {}), {
duration: o.animateDuration,
easing: o.animateEasing,
step: function() {
var data = {
- width: parseInt(self.element.css('width'), 10),
- height: parseInt(self.element.css('height'), 10),
- top: parseInt(self.element.css('top'), 10),
- left: parseInt(self.element.css('left'), 10)
+ width: parseInt(that.element.css('width'), 10),
+ height: parseInt(that.element.css('height'), 10),
+ top: parseInt(that.element.css('top'), 10),
+ left: parseInt(that.element.css('left'), 10)
};
if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
// propagating resize, and updating values for each animation step
- self._updateCache(data);
- self._propagate("resize", event);
+ that._updateCache(data);
+ that._propagate("resize", event);
}
}
@@ -2547,17 +2755,17 @@ $.ui.plugin.add("resizable", "animate", {
$.ui.plugin.add("resizable", "containment", {
start: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var that = $(this).data("resizable"), o = that.options, el = that.element;
var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
if (!ce) return;
- self.containerElement = $(ce);
+ that.containerElement = $(ce);
if (/document/.test(oc) || oc == document) {
- self.containerOffset = { left: 0, top: 0 };
- self.containerPosition = { left: 0, top: 0 };
+ that.containerOffset = { left: 0, top: 0 };
+ that.containerPosition = { left: 0, top: 0 };
- self.parentData = {
+ that.parentData = {
element: $(document), left: 0, top: 0,
width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
};
@@ -2568,70 +2776,70 @@ $.ui.plugin.add("resizable", "containment", {
var element = $(ce), p = [];
$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
- self.containerOffset = element.offset();
- self.containerPosition = element.position();
- self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+ that.containerOffset = element.offset();
+ that.containerPosition = element.position();
+ that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
- var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ var co = that.containerOffset, ch = that.containerSize.height, cw = that.containerSize.width,
width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
- self.parentData = {
+ that.parentData = {
element: ce, left: co.left, top: co.top, width: width, height: height
};
}
},
resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options,
- ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
- pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+ var that = $(this).data("resizable"), o = that.options,
+ ps = that.containerSize, co = that.containerOffset, cs = that.size, cp = that.position,
+ pRatio = that._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = that.containerElement;
if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
- if (cp.left < (self._helper ? co.left : 0)) {
- self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
- if (pRatio) self.size.height = self.size.width / o.aspectRatio;
- self.position.left = o.helper ? co.left : 0;
+ if (cp.left < (that._helper ? co.left : 0)) {
+ that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left));
+ if (pRatio) that.size.height = that.size.width / that.aspectRatio;
+ that.position.left = o.helper ? co.left : 0;
}
- if (cp.top < (self._helper ? co.top : 0)) {
- self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
- if (pRatio) self.size.width = self.size.height * o.aspectRatio;
- self.position.top = self._helper ? co.top : 0;
+ if (cp.top < (that._helper ? co.top : 0)) {
+ that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top);
+ if (pRatio) that.size.width = that.size.height * that.aspectRatio;
+ that.position.top = that._helper ? co.top : 0;
}
- self.offset.left = self.parentData.left+self.position.left;
- self.offset.top = self.parentData.top+self.position.top;
+ that.offset.left = that.parentData.left+that.position.left;
+ that.offset.top = that.parentData.top+that.position.top;
- var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
- hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+ var woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width ),
+ hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height );
- var isParent = self.containerElement.get(0) == self.element.parent().get(0),
- isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+ var isParent = that.containerElement.get(0) == that.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(that.containerElement.css('position'));
- if(isParent && isOffsetRelative) woset -= self.parentData.left;
+ if(isParent && isOffsetRelative) woset -= that.parentData.left;
- if (woset + self.size.width >= self.parentData.width) {
- self.size.width = self.parentData.width - woset;
- if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ if (woset + that.size.width >= that.parentData.width) {
+ that.size.width = that.parentData.width - woset;
+ if (pRatio) that.size.height = that.size.width / that.aspectRatio;
}
- if (hoset + self.size.height >= self.parentData.height) {
- self.size.height = self.parentData.height - hoset;
- if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ if (hoset + that.size.height >= that.parentData.height) {
+ that.size.height = that.parentData.height - hoset;
+ if (pRatio) that.size.width = that.size.height * that.aspectRatio;
}
},
stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options, cp = self.position,
- co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+ var that = $(this).data("resizable"), o = that.options, cp = that.position,
+ co = that.containerOffset, cop = that.containerPosition, ce = that.containerElement;
- var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+ var helper = $(that.helper), ho = helper.offset(), w = helper.outerWidth() - that.sizeDiff.width, h = helper.outerHeight() - that.sizeDiff.height;
- if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ if (that._helper && !o.animate && (/relative/).test(ce.css('position')))
$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
- if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ if (that._helper && !o.animate && (/static/).test(ce.css('position')))
$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
}
@@ -2641,26 +2849,26 @@ $.ui.plugin.add("resizable", "ghost", {
start: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, cs = self.size;
+ var that = $(this).data("resizable"), o = that.options, cs = that.size;
- self.ghost = self.originalElement.clone();
- self.ghost
+ that.ghost = that.originalElement.clone();
+ that.ghost
.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
.addClass('ui-resizable-ghost')
.addClass(typeof o.ghost == 'string' ? o.ghost : '');
- self.ghost.appendTo(self.helper);
+ that.ghost.appendTo(that.helper);
},
resize: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ var that = $(this).data("resizable"), o = that.options;
+ if (that.ghost) that.ghost.css({ position: 'relative', height: that.size.height, width: that.size.width });
},
stop: function(event, ui){
- var self = $(this).data("resizable"), o = self.options;
- if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ var that = $(this).data("resizable"), o = that.options;
+ if (that.ghost && that.helper) that.helper.get(0).removeChild(that.ghost.get(0));
}
});
@@ -2668,29 +2876,29 @@ $.ui.plugin.add("resizable", "ghost", {
$.ui.plugin.add("resizable", "grid", {
resize: function(event, ui) {
- var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ var that = $(this).data("resizable"), o = that.options, cs = that.size, os = that.originalSize, op = that.originalPosition, a = that.axis, ratio = o._aspectRatio || event.shiftKey;
o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
if (/^(se|s|e)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
+ that.size.width = os.width + ox;
+ that.size.height = os.height + oy;
}
else if (/^(ne)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
+ that.size.width = os.width + ox;
+ that.size.height = os.height + oy;
+ that.position.top = op.top - oy;
}
else if (/^(sw)$/.test(a)) {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.left = op.left - ox;
+ that.size.width = os.width + ox;
+ that.size.height = os.height + oy;
+ that.position.left = op.left - ox;
}
else {
- self.size.width = os.width + ox;
- self.size.height = os.height + oy;
- self.position.top = op.top - oy;
- self.position.left = op.left - ox;
+ that.size.width = os.width + ox;
+ that.size.height = os.height + oy;
+ that.position.top = op.top - oy;
+ that.position.left = op.left - ox;
}
}
@@ -2705,23 +2913,11 @@ var isNumber = function(value) {
};
})(jQuery);
-/*
- * jQuery UI Selectable 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
$.widget("ui.selectable", $.ui.mouse, {
+ version: "1.9.2",
options: {
appendTo: 'body',
autoRefresh: true,
@@ -2730,7 +2926,7 @@ $.widget("ui.selectable", $.ui.mouse, {
tolerance: 'touch'
},
_create: function() {
- var self = this;
+ var that = this;
this.element.addClass("ui-selectable");
@@ -2739,7 +2935,8 @@ $.widget("ui.selectable", $.ui.mouse, {
// cache selectee children based on filter
var selectees;
this.refresh = function() {
- selectees = $(self.options.filter, self.element[0]);
+ selectees = $(that.options.filter, that.element[0]);
+ selectees.addClass("ui-selectee");
selectees.each(function() {
var $this = $(this);
var pos = $this.offset();
@@ -2766,21 +2963,17 @@ $.widget("ui.selectable", $.ui.mouse, {
this.helper = $("<div class='ui-selectable-helper'></div>");
},
- destroy: function() {
+ _destroy: function() {
this.selectees
.removeClass("ui-selectee")
.removeData("selectable-item");
this.element
- .removeClass("ui-selectable ui-selectable-disabled")
- .removeData("selectable")
- .unbind(".selectable");
+ .removeClass("ui-selectable ui-selectable-disabled");
this._mouseDestroy();
-
- return this;
},
_mouseStart: function(event) {
- var self = this;
+ var that = this;
this.opos = [event.pageX, event.pageY];
@@ -2809,13 +3002,13 @@ $.widget("ui.selectable", $.ui.mouse, {
this.selectees.filter('.ui-selected').each(function() {
var selectee = $.data(this, "selectable-item");
selectee.startselected = true;
- if (!event.metaKey) {
+ if (!event.metaKey && !event.ctrlKey) {
selectee.$element.removeClass('ui-selected');
selectee.selected = false;
selectee.$element.addClass('ui-unselecting');
selectee.unselecting = true;
// selectable UNSELECTING callback
- self._trigger("unselecting", event, {
+ that._trigger("unselecting", event, {
unselecting: selectee.element
});
}
@@ -2824,7 +3017,7 @@ $.widget("ui.selectable", $.ui.mouse, {
$(event.target).parents().andSelf().each(function() {
var selectee = $.data(this, "selectable-item");
if (selectee) {
- var doSelect = !event.metaKey || !selectee.$element.hasClass('ui-selected');
+ var doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected');
selectee.$element
.removeClass(doSelect ? "ui-unselecting" : "ui-selected")
.addClass(doSelect ? "ui-selecting" : "ui-unselecting");
@@ -2833,11 +3026,11 @@ $.widget("ui.selectable", $.ui.mouse, {
selectee.selected = doSelect;
// selectable (UN)SELECTING callback
if (doSelect) {
- self._trigger("selecting", event, {
+ that._trigger("selecting", event, {
selecting: selectee.element
});
} else {
- self._trigger("unselecting", event, {
+ that._trigger("unselecting", event, {
unselecting: selectee.element
});
}
@@ -2848,7 +3041,7 @@ $.widget("ui.selectable", $.ui.mouse, {
},
_mouseDrag: function(event) {
- var self = this;
+ var that = this;
this.dragged = true;
if (this.options.disabled)
@@ -2864,7 +3057,7 @@ $.widget("ui.selectable", $.ui.mouse, {
this.selectees.each(function() {
var selectee = $.data(this, "selectable-item");
//prevent helper from being selected if appendTo: selectable
- if (!selectee || selectee.element == self.element[0])
+ if (!selectee || selectee.element == that.element[0])
return;
var hit = false;
if (options.tolerance == 'touch') {
@@ -2887,14 +3080,14 @@ $.widget("ui.selectable", $.ui.mouse, {
selectee.$element.addClass('ui-selecting');
selectee.selecting = true;
// selectable SELECTING callback
- self._trigger("selecting", event, {
+ that._trigger("selecting", event, {
selecting: selectee.element
});
}
} else {
// UNSELECT
if (selectee.selecting) {
- if (event.metaKey && selectee.startselected) {
+ if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
selectee.$element.removeClass('ui-selecting');
selectee.selecting = false;
selectee.$element.addClass('ui-selected');
@@ -2907,20 +3100,20 @@ $.widget("ui.selectable", $.ui.mouse, {
selectee.unselecting = true;
}
// selectable UNSELECTING callback
- self._trigger("unselecting", event, {
+ that._trigger("unselecting", event, {
unselecting: selectee.element
});
}
}
if (selectee.selected) {
- if (!event.metaKey && !selectee.startselected) {
+ if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
selectee.$element.removeClass('ui-selected');
selectee.selected = false;
selectee.$element.addClass('ui-unselecting');
selectee.unselecting = true;
// selectable UNSELECTING callback
- self._trigger("unselecting", event, {
+ that._trigger("unselecting", event, {
unselecting: selectee.element
});
}
@@ -2932,7 +3125,7 @@ $.widget("ui.selectable", $.ui.mouse, {
},
_mouseStop: function(event) {
- var self = this;
+ var that = this;
this.dragged = false;
@@ -2943,7 +3136,7 @@ $.widget("ui.selectable", $.ui.mouse, {
selectee.$element.removeClass('ui-unselecting');
selectee.unselecting = false;
selectee.startselected = false;
- self._trigger("unselected", event, {
+ that._trigger("unselected", event, {
unselected: selectee.element
});
});
@@ -2953,7 +3146,7 @@ $.widget("ui.selectable", $.ui.mouse, {
selectee.selecting = false;
selectee.selected = true;
selectee.startselected = true;
- self._trigger("selected", event, {
+ that._trigger("selected", event, {
selected: selectee.element
});
});
@@ -2966,29 +3159,14 @@ $.widget("ui.selectable", $.ui.mouse, {
});
-$.extend($.ui.selectable, {
- version: "1.8.16"
-});
-
})(jQuery);
-/*
- * jQuery UI Sortable 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
$.widget("ui.sortable", $.ui.mouse, {
+ version: "1.9.2",
widgetEventPrefix: "sort",
+ ready: false,
options: {
appendTo: "parent",
axis: false,
@@ -3031,17 +3209,18 @@ $.widget("ui.sortable", $.ui.mouse, {
//Initialize mouse events for interaction
this._mouseInit();
+ //We're ready to go
+ this.ready = true
+
},
- destroy: function() {
+ _destroy: function() {
this.element
- .removeClass("ui-sortable ui-sortable-disabled")
- .removeData("sortable")
- .unbind(".sortable");
+ .removeClass("ui-sortable ui-sortable-disabled");
this._mouseDestroy();
for ( var i = this.items.length - 1; i >= 0; i-- )
- this.items[i].item.removeData("sortable-item");
+ this.items[i].item.removeData(this.widgetName + "-item");
return this;
},
@@ -3049,9 +3228,8 @@ $.widget("ui.sortable", $.ui.mouse, {
_setOption: function(key, value){
if ( key === "disabled" ) {
this.options[ key ] = value;
-
- this.widget()
- [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+
+ this.widget().toggleClass( "ui-sortable-disabled", !!value );
} else {
// Don't call widget base _setOption for disable as it adds ui-state-disabled class
$.Widget.prototype._setOption.apply(this, arguments);
@@ -3059,6 +3237,7 @@ $.widget("ui.sortable", $.ui.mouse, {
},
_mouseCapture: function(event, overrideHandle) {
+ var that = this;
if (this.reverting) {
return false;
@@ -3070,13 +3249,13 @@ $.widget("ui.sortable", $.ui.mouse, {
this._refreshItems(event);
//Find out if the clicked node (or one of its parents) is a actual item in this.items
- var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
- if($.data(this, 'sortable-item') == self) {
+ var currentItem = null, nodes = $(event.target).parents().each(function() {
+ if($.data(this, that.widgetName + '-item') == that) {
currentItem = $(this);
return false;
}
});
- if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+ if($.data(event.target, that.widgetName + '-item') == that) currentItem = $(event.target);
if(!currentItem) return false;
if(this.options.handle && !overrideHandle) {
@@ -3094,7 +3273,7 @@ $.widget("ui.sortable", $.ui.mouse, {
_mouseStart: function(event, overrideHandle, noActivation) {
- var o = this.options, self = this;
+ var o = this.options;
this.currentContainer = this;
//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
@@ -3124,11 +3303,6 @@ $.widget("ui.sortable", $.ui.mouse, {
left: this.offset.left - this.margins.left
};
- // Only after we got the offset, we can change the helper's position to absolute
- // TODO: Still need to figure out a way to make relative sorting possible
- this.helper.css("position", "absolute");
- this.cssPosition = this.helper.css("position");
-
$.extend(this.offset, {
click: { //Where the click happened, relative to the element
left: event.pageX - this.offset.left,
@@ -3138,6 +3312,11 @@ $.widget("ui.sortable", $.ui.mouse, {
relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
});
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
//Generate the original position
this.originalPosition = this._generatePosition(event);
this.originalPageX = event.pageX;
@@ -3190,7 +3369,7 @@ $.widget("ui.sortable", $.ui.mouse, {
//Post 'activate' events to possible containers
if(!noActivation) {
- for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, this._uiHash(this)); }
}
//Prepare possible droppables
@@ -3265,10 +3444,19 @@ $.widget("ui.sortable", $.ui.mouse, {
var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
if (!intersection) continue;
- if(itemElement != this.currentItem[0] //cannot intersect with itself
+ // Only put the placeholder inside the current Container, skip all
+ // items form other containers. This works because when moving
+ // an item from one container to another the
+ // currentContainer is switched before the placeholder is moved.
+ //
+ // Without this moving items in "sub-sortables" can cause the placeholder to jitter
+ // beetween the outer and inner container.
+ if (item.instance !== this.currentContainer) continue;
+
+ if (itemElement != this.currentItem[0] //cannot intersect with itself
&& this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
- && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
- && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ && !$.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.contains(this.element[0], itemElement) : true)
//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
) {
@@ -3308,16 +3496,16 @@ $.widget("ui.sortable", $.ui.mouse, {
$.ui.ddmanager.drop(this, event);
if(this.options.revert) {
- var self = this;
- var cur = self.placeholder.offset();
+ var that = this;
+ var cur = this.placeholder.offset();
- self.reverting = true;
+ this.reverting = true;
$(this.helper).animate({
- left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
- top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ left: cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
}, parseInt(this.options.revert, 10) || 500, function() {
- self._clear(event);
+ that._clear(event);
});
} else {
this._clear(event, noPropagation);
@@ -3329,8 +3517,6 @@ $.widget("ui.sortable", $.ui.mouse, {
cancel: function() {
- var self = this;
-
if(this.dragging) {
this._mouseUp({ target: null });
@@ -3342,9 +3528,9 @@ $.widget("ui.sortable", $.ui.mouse, {
//Post deactivating events to containers
for (var i = this.containers.length - 1; i >= 0; i--){
- this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ this.containers[i]._trigger("deactivate", null, this._uiHash(this));
if(this.containers[i].containerCache.over) {
- this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i]._trigger("out", null, this._uiHash(this));
this.containers[i].containerCache.over = 0;
}
}
@@ -3437,8 +3623,8 @@ $.widget("ui.sortable", $.ui.mouse, {
_intersectsWithPointer: function(item) {
- var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
- isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ var isOverElementHeight = (this.options.axis === 'x') || $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = (this.options.axis === 'y') || $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
isOverElement = isOverElementHeight && isOverElementWidth,
verticalDirection = this._getDragVerticalDirection(),
horizontalDirection = this._getDragHorizontalDirection();
@@ -3489,10 +3675,9 @@ $.widget("ui.sortable", $.ui.mouse, {
? [options.connectWith]
: options.connectWith;
},
-
+
_getItemsAsjQuery: function(connected) {
- var self = this;
var items = [];
var queries = [];
var connectWith = this._connectWith();
@@ -3501,7 +3686,7 @@ $.widget("ui.sortable", $.ui.mouse, {
for (var i = connectWith.length - 1; i >= 0; i--){
var cur = $(connectWith[i]);
for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
+ var inst = $.data(cur[j], this.widgetName);
if(inst && inst != this && !inst.options.disabled) {
queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
}
@@ -3523,16 +3708,15 @@ $.widget("ui.sortable", $.ui.mouse, {
_removeCurrentsFromItems: function() {
- var list = this.currentItem.find(":data(sortable-item)");
-
- for (var i=0; i < this.items.length; i++) {
+ var list = this.currentItem.find(":data(" + this.widgetName + "-item)");
+ this.items = $.grep(this.items, function (item) {
for (var j=0; j < list.length; j++) {
- if(list[j] == this.items[i].item[0])
- this.items.splice(i,1);
+ if(list[j] == item.item[0])
+ return false;
};
-
- };
+ return true;
+ });
},
@@ -3541,15 +3725,14 @@ $.widget("ui.sortable", $.ui.mouse, {
this.items = [];
this.containers = [this];
var items = this.items;
- var self = this;
var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
var connectWith = this._connectWith();
- if(connectWith) {
+ if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down
for (var i = connectWith.length - 1; i >= 0; i--){
var cur = $(connectWith[i]);
for (var j = cur.length - 1; j >= 0; j--){
- var inst = $.data(cur[j], 'sortable');
+ var inst = $.data(cur[j], this.widgetName);
if(inst && inst != this && !inst.options.disabled) {
queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
this.containers.push(inst);
@@ -3565,7 +3748,7 @@ $.widget("ui.sortable", $.ui.mouse, {
for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
var item = $(_queries[j]);
- item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+ item.data(this.widgetName + '-item', targetData); // Data for target checking (mouse manager)
items.push({
item: item,
@@ -3620,16 +3803,16 @@ $.widget("ui.sortable", $.ui.mouse, {
},
_createPlaceholder: function(that) {
-
- var self = that || this, o = self.options;
+ that = that || this;
+ var o = that.options;
if(!o.placeholder || o.placeholder.constructor == String) {
var className = o.placeholder;
o.placeholder = {
element: function() {
- var el = $(document.createElement(self.currentItem[0].nodeName))
- .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ var el = $(document.createElement(that.currentItem[0].nodeName))
+ .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder")
.removeClass("ui-sortable-helper")[0];
if(!className)
@@ -3644,46 +3827,46 @@ $.widget("ui.sortable", $.ui.mouse, {
if(className && !o.forcePlaceholderSize) return;
//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
- if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
- if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css('paddingTop')||0, 10) - parseInt(that.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css('paddingLeft')||0, 10) - parseInt(that.currentItem.css('paddingRight')||0, 10)); };
}
};
}
//Create the placeholder
- self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+ that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem));
//Append it after the actual current item
- self.currentItem.after(self.placeholder);
+ that.currentItem.after(that.placeholder);
//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
- o.placeholder.update(self, self.placeholder);
+ o.placeholder.update(that, that.placeholder);
},
_contactContainers: function(event) {
-
- // get innermost container that intersects with item
- var innermostContainer = null, innermostIndex = null;
-
-
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
for (var i = this.containers.length - 1; i >= 0; i--){
- // never consider a container that's located within the item itself
- if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ // never consider a container that's located within the item itself
+ if($.contains(this.currentItem[0], this.containers[i].element[0]))
continue;
if(this._intersectsWith(this.containers[i].containerCache)) {
- // if we've already found a container and it's more "inner" than this, then continue
- if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0]))
continue;
- innermostContainer = this.containers[i];
+ innermostContainer = this.containers[i];
innermostIndex = i;
-
+
} else {
- // container doesn't intersect. trigger "out" event if necessary
+ // container doesn't intersect. trigger "out" event if necessary
if(this.containers[i].containerCache.over) {
this.containers[i]._trigger("out", event, this._uiHash(this));
this.containers[i].containerCache.over = 0;
@@ -3691,42 +3874,53 @@ $.widget("ui.sortable", $.ui.mouse, {
}
}
-
- // if no intersecting containers found, return
- if(!innermostContainer) return;
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
// move the item into the container if it's not there already
if(this.containers.length === 1) {
this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
this.containers[innermostIndex].containerCache.over = 1;
- } else if(this.currentContainer != this.containers[innermostIndex]) {
-
- //When entering a new container, we will find the item with the least distance and append our item near it
- var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
- for (var j = this.items.length - 1; j >= 0; j--) {
- if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
- var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
- if(Math.abs(cur - base) < dist) {
- dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
- }
- }
-
- if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
- return;
-
- this.currentContainer = this.containers[innermostIndex];
- itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
- this._trigger("change", event, this._uiHash());
- this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
-
- //Update the placeholder
- this.options.placeholder.update(this.currentContainer, this.placeholder);
-
- this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ } else {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null;
+ var posProperty = this.containers[innermostIndex].floating ? 'left' : 'top';
+ var sizeProperty = this.containers[innermostIndex].floating ? 'width' : 'height';
+ var base = this.positionAbs[posProperty] + this.offset.click[posProperty];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ if(this.items[j].item[0] == this.currentItem[0]) continue;
+ var cur = this.items[j].item.offset()[posProperty];
+ var nearBottom = false;
+ if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){
+ nearBottom = true;
+ cur += this.items[j][sizeProperty];
+ }
+
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ this.direction = nearBottom ? "up": "down";
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
this.containers[innermostIndex].containerCache.over = 1;
- }
-
-
+ }
+
+
},
_createHelper: function(event) {
@@ -3779,13 +3973,13 @@ $.widget("ui.sortable", $.ui.mouse, {
// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
// the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
- if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) {
po.left += this.scrollParent.scrollLeft();
po.top += this.scrollParent.scrollTop();
}
if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
- || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.ui.ie)) //Ugly IE fix
po = { top: 0, left: 0 };
return {
@@ -3853,20 +4047,20 @@ $.widget("ui.sortable", $.ui.mouse, {
if(!pos) pos = this.position;
var mod = d == "absolute" ? 1 : -1;
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
return {
top: (
pos.top // The absolute mouse position
+ this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
),
left: (
pos.left // The absolute mouse position
+ this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
- - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ - ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
)
};
@@ -3874,7 +4068,7 @@ $.widget("ui.sortable", $.ui.mouse, {
_generatePosition: function(event) {
- var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
// This is another very weird special case that only happens for relative elements:
// 1. If the css position is relative
@@ -3917,14 +4111,14 @@ $.widget("ui.sortable", $.ui.mouse, {
- this.offset.click.top // Click offset (relative to the element)
- this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.top // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
),
left: (
pageX // The absolute mouse position
- this.offset.click.left // Click offset (relative to the element)
- this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
- this.offset.parent.left // The offsetParent's offset without borders (offset + border)
- + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ + ( ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
)
};
@@ -3940,11 +4134,11 @@ $.widget("ui.sortable", $.ui.mouse, {
// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
// 4. this lets only the last addition to the timeout stack through
this.counter = this.counter ? ++this.counter : 1;
- var self = this, counter = this.counter;
+ var counter = this.counter;
- window.setTimeout(function() {
- if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
- },0);
+ this._delay(function() {
+ if(counter == this.counter) this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ });
},
@@ -3953,7 +4147,7 @@ $.widget("ui.sortable", $.ui.mouse, {
this.reverting = false;
// We delay all events that have to be triggered to after the point where the placeholder has been removed and
// everything else normalized again
- var delayedTriggers = [], self = this;
+ var delayedTriggers = [];
// We first have to update the dom position of the actual currentItem
// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
@@ -3971,15 +4165,17 @@ $.widget("ui.sortable", $.ui.mouse, {
if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
- if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
- if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
- for (var i = this.containers.length - 1; i >= 0; i--){
- if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
- delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
- }
- };
- };
+
+ // Check if the items Container has Changed and trigger appropriate
+ // events.
+ if (this !== this.currentContainer) {
+ if(!noPropagation) {
+ delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer));
+ }
+ }
+
//Post events to containers
for (var i = this.containers.length - 1; i >= 0; i--){
@@ -4002,6 +4198,8 @@ $.widget("ui.sortable", $.ui.mouse, {
for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
this._trigger("stop", event, this._uiHash());
}
+
+ this.fromOutside = false;
return false;
}
@@ -4028,173 +4226,696 @@ $.widget("ui.sortable", $.ui.mouse, {
}
},
- _uiHash: function(inst) {
- var self = inst || this;
+ _uiHash: function(_inst) {
+ var inst = _inst || this;
return {
- helper: self.helper,
- placeholder: self.placeholder || $([]),
- position: self.position,
- originalPosition: self.originalPosition,
- offset: self.positionAbs,
- item: self.currentItem,
- sender: inst ? inst.element : null
+ helper: inst.helper,
+ placeholder: inst.placeholder || $([]),
+ position: inst.position,
+ originalPosition: inst.originalPosition,
+ offset: inst.positionAbs,
+ item: inst.currentItem,
+ sender: _inst ? _inst.element : null
};
}
});
-$.extend($.ui.sortable, {
- version: "1.8.16"
-});
-
})(jQuery);
-/*
- * jQuery UI Effects 1.8.16
+
+;(jQuery.effects || (function($, undefined) {
+
+var backCompat = $.uiBackCompat !== false,
+ // prefix used for storing data on .data()
+ dataSpace = "ui-effects-";
+
+$.effects = {
+ effect: {}
+};
+
+/*!
+ * jQuery Color Animations v2.0.0
+ * http://jquery.com/
*
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
+ * Copyright 2012 jQuery Foundation and other contributors
+ * Released under the MIT license.
* http://jquery.org/license
*
- * http://docs.jquery.com/UI/Effects/
+ * Date: Mon Aug 13 13:41:02 2012 -0500
*/
-;jQuery.effects || (function($, undefined) {
+(function( jQuery, undefined ) {
+
+ var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor".split(" "),
+
+ // plusequals test for += 100 -= 100
+ rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+ // a set of RE's that can match strings and generate color tuples.
+ stringParsers = [{
+ re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ],
+ execResult[ 3 ],
+ execResult[ 4 ]
+ ];
+ }
+ }, {
+ re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ] * 2.55,
+ execResult[ 2 ] * 2.55,
+ execResult[ 3 ] * 2.55,
+ execResult[ 4 ]
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+ // this regex ignores A-F because it's compared against an already lowercased string
+ re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+ parse: function( execResult ) {
+ return [
+ parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
+ parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
+ parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
+ ];
+ }
+ }, {
+ re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d+(?:\.\d+)?)\s*)?\)/,
+ space: "hsla",
+ parse: function( execResult ) {
+ return [
+ execResult[ 1 ],
+ execResult[ 2 ] / 100,
+ execResult[ 3 ] / 100,
+ execResult[ 4 ]
+ ];
+ }
+ }],
+
+ // jQuery.Color( )
+ color = jQuery.Color = function( color, green, blue, alpha ) {
+ return new jQuery.Color.fn.parse( color, green, blue, alpha );
+ },
+ spaces = {
+ rgba: {
+ props: {
+ red: {
+ idx: 0,
+ type: "byte"
+ },
+ green: {
+ idx: 1,
+ type: "byte"
+ },
+ blue: {
+ idx: 2,
+ type: "byte"
+ }
+ }
+ },
-$.effects = {};
+ hsla: {
+ props: {
+ hue: {
+ idx: 0,
+ type: "degrees"
+ },
+ saturation: {
+ idx: 1,
+ type: "percent"
+ },
+ lightness: {
+ idx: 2,
+ type: "percent"
+ }
+ }
+ }
+ },
+ propTypes = {
+ "byte": {
+ floor: true,
+ max: 255
+ },
+ "percent": {
+ max: 1
+ },
+ "degrees": {
+ mod: 360,
+ floor: true
+ }
+ },
+ support = color.support = {},
+ // element for support tests
+ supportElem = jQuery( "<p>" )[ 0 ],
+ // colors = jQuery.Color.names
+ colors,
-/******************************************************************************/
-/****************************** COLOR ANIMATIONS ******************************/
-/******************************************************************************/
+ // local aliases of functions called often
+ each = jQuery.each;
-// override the animation for color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
- 'borderRightColor', 'borderTopColor', 'borderColor', 'color', 'outlineColor'],
-function(i, attr) {
- $.fx.step[attr] = function(fx) {
- if (!fx.colorInit) {
- fx.start = getColor(fx.elem, attr);
- fx.end = getRGB(fx.end);
- fx.colorInit = true;
- }
+// determine rgba support immediately
+supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
- fx.elem.style[attr] = 'rgb(' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
- Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+// define cache name and alpha properties
+// for rgba and hsla spaces
+each( spaces, function( spaceName, space ) {
+ space.cache = "_" + spaceName;
+ space.props.alpha = {
+ idx: 3,
+ type: "percent",
+ def: 1
};
});
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
+function clamp( value, prop, allowEmpty ) {
+ var type = propTypes[ prop.type ] || {};
+
+ if ( value == null ) {
+ return (allowEmpty || !prop.def) ? null : prop.def;
+ }
+
+ // ~~ is an short way of doing floor for positive numbers
+ value = type.floor ? ~~value : parseFloat( value );
+
+ // IE will pass in empty strings as value for alpha,
+ // which will hit this case
+ if ( isNaN( value ) ) {
+ return prop.def;
+ }
+
+ if ( type.mod ) {
+ // we add mod before modding to make sure that negatives values
+ // get converted properly: -10 -> 350
+ return (value + type.mod) % type.mod;
+ }
+
+ // for now all property types without mod have min and max
+ return 0 > value ? 0 : type.max < value ? type.max : value;
+}
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
- var result;
+function stringParse( string ) {
+ var inst = color(),
+ rgba = inst._rgba = [];
- // Check if we're already dealing with an array of colors
- if ( color && color.constructor == Array && color.length == 3 )
- return color;
+ string = string.toLowerCase();
- // Look for rgb(num,num,num)
- if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
- return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+ each( stringParsers, function( i, parser ) {
+ var parsed,
+ match = parser.re.exec( string ),
+ values = match && parser.parse( match ),
+ spaceName = parser.space || "rgba";
- // Look for rgb(num%,num%,num%)
- if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
- return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+ if ( values ) {
+ parsed = inst[ spaceName ]( values );
- // Look for #a0b1c2
- if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
- return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+ // if this was an rgba parse the assignment might happen twice
+ // oh well....
+ inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
+ rgba = inst._rgba = parsed._rgba;
+
+ // exit each( stringParsers ) here because we matched
+ return false;
+ }
+ });
- // Look for #fff
- if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
- return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+ // Found a stringParser that handled it
+ if ( rgba.length ) {
- // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
- if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
- return colors['transparent'];
+ // if this came from a parsed string, force "transparent" when alpha is 0
+ // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+ if ( rgba.join() === "0,0,0,0" ) {
+ jQuery.extend( rgba, colors.transparent );
+ }
+ return inst;
+ }
- // Otherwise, we're most likely dealing with a named color
- return colors[$.trim(color).toLowerCase()];
+ // named colors
+ return colors[ string ];
}
-function getColor(elem, attr) {
- var color;
+color.fn = jQuery.extend( color.prototype, {
+ parse: function( red, green, blue, alpha ) {
+ if ( red === undefined ) {
+ this._rgba = [ null, null, null, null ];
+ return this;
+ }
+ if ( red.jquery || red.nodeType ) {
+ red = jQuery( red ).css( green );
+ green = undefined;
+ }
- do {
- color = $.curCSS(elem, attr);
+ var inst = this,
+ type = jQuery.type( red ),
+ rgba = this._rgba = [];
- // Keep going until we find an element that has color, or we hit the body
- if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
- break;
+ // more than 1 argument specified - assume ( red, green, blue, alpha )
+ if ( green !== undefined ) {
+ red = [ red, green, blue, alpha ];
+ type = "array";
+ }
+
+ if ( type === "string" ) {
+ return this.parse( stringParse( red ) || colors._default );
+ }
+
+ if ( type === "array" ) {
+ each( spaces.rgba.props, function( key, prop ) {
+ rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );
+ });
+ return this;
+ }
+
+ if ( type === "object" ) {
+ if ( red instanceof color ) {
+ each( spaces, function( spaceName, space ) {
+ if ( red[ space.cache ] ) {
+ inst[ space.cache ] = red[ space.cache ].slice();
+ }
+ });
+ } else {
+ each( spaces, function( spaceName, space ) {
+ var cache = space.cache;
+ each( space.props, function( key, prop ) {
+
+ // if the cache doesn't exist, and we know how to convert
+ if ( !inst[ cache ] && space.to ) {
+
+ // if the value was null, we don't need to copy it
+ // if the key was alpha, we don't need to copy it either
+ if ( key === "alpha" || red[ key ] == null ) {
+ return;
+ }
+ inst[ cache ] = space.to( inst._rgba );
+ }
+
+ // this is the only case where we allow nulls for ALL properties.
+ // call clamp with alwaysAllowEmpty
+ inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
+ });
+
+ // everything defined but alpha?
+ if ( inst[ cache ] && $.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
+ // use the default of 1
+ inst[ cache ][ 3 ] = 1;
+ if ( space.from ) {
+ inst._rgba = space.from( inst[ cache ] );
+ }
+ }
+ });
+ }
+ return this;
+ }
+ },
+ is: function( compare ) {
+ var is = color( compare ),
+ same = true,
+ inst = this;
+
+ each( spaces, function( _, space ) {
+ var localCache,
+ isCache = is[ space.cache ];
+ if (isCache) {
+ localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || [];
+ each( space.props, function( _, prop ) {
+ if ( isCache[ prop.idx ] != null ) {
+ same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
+ return same;
+ }
+ });
+ }
+ return same;
+ });
+ return same;
+ },
+ _space: function() {
+ var used = [],
+ inst = this;
+ each( spaces, function( spaceName, space ) {
+ if ( inst[ space.cache ] ) {
+ used.push( spaceName );
+ }
+ });
+ return used.pop();
+ },
+ transition: function( other, distance ) {
+ var end = color( other ),
+ spaceName = end._space(),
+ space = spaces[ spaceName ],
+ startColor = this.alpha() === 0 ? color( "transparent" ) : this,
+ start = startColor[ space.cache ] || space.to( startColor._rgba ),
+ result = start.slice();
+
+ end = end[ space.cache ];
+ each( space.props, function( key, prop ) {
+ var index = prop.idx,
+ startValue = start[ index ],
+ endValue = end[ index ],
+ type = propTypes[ prop.type ] || {};
+
+ // if null, don't override start value
+ if ( endValue === null ) {
+ return;
+ }
+ // if null - use end
+ if ( startValue === null ) {
+ result[ index ] = endValue;
+ } else {
+ if ( type.mod ) {
+ if ( endValue - startValue > type.mod / 2 ) {
+ startValue += type.mod;
+ } else if ( startValue - endValue > type.mod / 2 ) {
+ startValue -= type.mod;
+ }
+ }
+ result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
+ }
+ });
+ return this[ spaceName ]( result );
+ },
+ blend: function( opaque ) {
+ // if we are already opaque - return ourself
+ if ( this._rgba[ 3 ] === 1 ) {
+ return this;
+ }
+
+ var rgb = this._rgba.slice(),
+ a = rgb.pop(),
+ blend = color( opaque )._rgba;
+
+ return color( jQuery.map( rgb, function( v, i ) {
+ return ( 1 - a ) * blend[ i ] + a * v;
+ }));
+ },
+ toRgbaString: function() {
+ var prefix = "rgba(",
+ rgba = jQuery.map( this._rgba, function( v, i ) {
+ return v == null ? ( i > 2 ? 1 : 0 ) : v;
+ });
+
+ if ( rgba[ 3 ] === 1 ) {
+ rgba.pop();
+ prefix = "rgb(";
+ }
+
+ return prefix + rgba.join() + ")";
+ },
+ toHslaString: function() {
+ var prefix = "hsla(",
+ hsla = jQuery.map( this.hsla(), function( v, i ) {
+ if ( v == null ) {
+ v = i > 2 ? 1 : 0;
+ }
- attr = "backgroundColor";
- } while ( elem = elem.parentNode );
+ // catch 1 and 2
+ if ( i && i < 3 ) {
+ v = Math.round( v * 100 ) + "%";
+ }
+ return v;
+ });
+
+ if ( hsla[ 3 ] === 1 ) {
+ hsla.pop();
+ prefix = "hsl(";
+ }
+ return prefix + hsla.join() + ")";
+ },
+ toHexString: function( includeAlpha ) {
+ var rgba = this._rgba.slice(),
+ alpha = rgba.pop();
- return getRGB(color);
+ if ( includeAlpha ) {
+ rgba.push( ~~( alpha * 255 ) );
+ }
+
+ return "#" + jQuery.map( rgba, function( v ) {
+
+ // default to 0 when nulls exist
+ v = ( v || 0 ).toString( 16 );
+ return v.length === 1 ? "0" + v : v;
+ }).join("");
+ },
+ toString: function() {
+ return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
+ }
+});
+color.fn.parse.prototype = color.fn;
+
+// hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
+
+function hue2rgb( p, q, h ) {
+ h = ( h + 1 ) % 1;
+ if ( h * 6 < 1 ) {
+ return p + (q - p) * h * 6;
+ }
+ if ( h * 2 < 1) {
+ return q;
+ }
+ if ( h * 3 < 2 ) {
+ return p + (q - p) * ((2/3) - h) * 6;
+ }
+ return p;
+}
+
+spaces.hsla.to = function ( rgba ) {
+ if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) {
+ return [ null, null, null, rgba[ 3 ] ];
+ }
+ var r = rgba[ 0 ] / 255,
+ g = rgba[ 1 ] / 255,
+ b = rgba[ 2 ] / 255,
+ a = rgba[ 3 ],
+ max = Math.max( r, g, b ),
+ min = Math.min( r, g, b ),
+ diff = max - min,
+ add = max + min,
+ l = add * 0.5,
+ h, s;
+
+ if ( min === max ) {
+ h = 0;
+ } else if ( r === max ) {
+ h = ( 60 * ( g - b ) / diff ) + 360;
+ } else if ( g === max ) {
+ h = ( 60 * ( b - r ) / diff ) + 120;
+ } else {
+ h = ( 60 * ( r - g ) / diff ) + 240;
+ }
+
+ if ( l === 0 || l === 1 ) {
+ s = l;
+ } else if ( l <= 0.5 ) {
+ s = diff / add;
+ } else {
+ s = diff / ( 2 - add );
+ }
+ return [ Math.round(h) % 360, s, l, a == null ? 1 : a ];
};
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
- aqua:[0,255,255],
- azure:[240,255,255],
- beige:[245,245,220],
- black:[0,0,0],
- blue:[0,0,255],
- brown:[165,42,42],
- cyan:[0,255,255],
- darkblue:[0,0,139],
- darkcyan:[0,139,139],
- darkgrey:[169,169,169],
- darkgreen:[0,100,0],
- darkkhaki:[189,183,107],
- darkmagenta:[139,0,139],
- darkolivegreen:[85,107,47],
- darkorange:[255,140,0],
- darkorchid:[153,50,204],
- darkred:[139,0,0],
- darksalmon:[233,150,122],
- darkviolet:[148,0,211],
- fuchsia:[255,0,255],
- gold:[255,215,0],
- green:[0,128,0],
- indigo:[75,0,130],
- khaki:[240,230,140],
- lightblue:[173,216,230],
- lightcyan:[224,255,255],
- lightgreen:[144,238,144],
- lightgrey:[211,211,211],
- lightpink:[255,182,193],
- lightyellow:[255,255,224],
- lime:[0,255,0],
- magenta:[255,0,255],
- maroon:[128,0,0],
- navy:[0,0,128],
- olive:[128,128,0],
- orange:[255,165,0],
- pink:[255,192,203],
- purple:[128,0,128],
- violet:[128,0,128],
- red:[255,0,0],
- silver:[192,192,192],
- white:[255,255,255],
- yellow:[255,255,0],
- transparent: [255,255,255]
+spaces.hsla.from = function ( hsla ) {
+ if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) {
+ return [ null, null, null, hsla[ 3 ] ];
+ }
+ var h = hsla[ 0 ] / 360,
+ s = hsla[ 1 ],
+ l = hsla[ 2 ],
+ a = hsla[ 3 ],
+ q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+ p = 2 * l - q;
+
+ return [
+ Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
+ Math.round( hue2rgb( p, q, h ) * 255 ),
+ Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
+ a
+ ];
};
+each( spaces, function( spaceName, space ) {
+ var props = space.props,
+ cache = space.cache,
+ to = space.to,
+ from = space.from;
+
+ // makes rgba() and hsla()
+ color.fn[ spaceName ] = function( value ) {
+
+ // generate a cache for this space if it doesn't exist
+ if ( to && !this[ cache ] ) {
+ this[ cache ] = to( this._rgba );
+ }
+ if ( value === undefined ) {
+ return this[ cache ].slice();
+ }
+
+ var ret,
+ type = jQuery.type( value ),
+ arr = ( type === "array" || type === "object" ) ? value : arguments,
+ local = this[ cache ].slice();
+
+ each( props, function( key, prop ) {
+ var val = arr[ type === "object" ? key : prop.idx ];
+ if ( val == null ) {
+ val = local[ prop.idx ];
+ }
+ local[ prop.idx ] = clamp( val, prop );
+ });
+
+ if ( from ) {
+ ret = color( from( local ) );
+ ret[ cache ] = local;
+ return ret;
+ } else {
+ return color( local );
+ }
+ };
+
+ // makes red() green() blue() alpha() hue() saturation() lightness()
+ each( props, function( key, prop ) {
+ // alpha is included in more than one space
+ if ( color.fn[ key ] ) {
+ return;
+ }
+ color.fn[ key ] = function( value ) {
+ var vtype = jQuery.type( value ),
+ fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+ local = this[ fn ](),
+ cur = local[ prop.idx ],
+ match;
+
+ if ( vtype === "undefined" ) {
+ return cur;
+ }
+
+ if ( vtype === "function" ) {
+ value = value.call( this, cur );
+ vtype = jQuery.type( value );
+ }
+ if ( value == null && prop.empty ) {
+ return this;
+ }
+ if ( vtype === "string" ) {
+ match = rplusequals.exec( value );
+ if ( match ) {
+ value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
+ }
+ }
+ local[ prop.idx ] = value;
+ return this[ fn ]( local );
+ };
+ });
+});
+
+// add .fx.step functions
+each( stepHooks, function( i, hook ) {
+ jQuery.cssHooks[ hook ] = {
+ set: function( elem, value ) {
+ var parsed, curElem,
+ backgroundColor = "";
+
+ if ( jQuery.type( value ) !== "string" || ( parsed = stringParse( value ) ) ) {
+ value = color( parsed || value );
+ if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
+ curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+ while (
+ (backgroundColor === "" || backgroundColor === "transparent") &&
+ curElem && curElem.style
+ ) {
+ try {
+ backgroundColor = jQuery.css( curElem, "backgroundColor" );
+ curElem = curElem.parentNode;
+ } catch ( e ) {
+ }
+ }
+
+ value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
+ backgroundColor :
+ "_default" );
+ }
+
+ value = value.toRgbaString();
+ }
+ try {
+ elem.style[ hook ] = value;
+ } catch( error ) {
+ // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit'
+ }
+ }
+ };
+ jQuery.fx.step[ hook ] = function( fx ) {
+ if ( !fx.colorInit ) {
+ fx.start = color( fx.elem, hook );
+ fx.end = color( fx.end );
+ fx.colorInit = true;
+ }
+ jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
+ };
+});
+
+jQuery.cssHooks.borderColor = {
+ expand: function( value ) {
+ var expanded = {};
+
+ each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
+ expanded[ "border" + part + "Color" ] = value;
+ });
+ return expanded;
+ }
+};
+
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+colors = jQuery.Color.names = {
+ // 4.1. Basic color keywords
+ aqua: "#00ffff",
+ black: "#000000",
+ blue: "#0000ff",
+ fuchsia: "#ff00ff",
+ gray: "#808080",
+ green: "#008000",
+ lime: "#00ff00",
+ maroon: "#800000",
+ navy: "#000080",
+ olive: "#808000",
+ purple: "#800080",
+ red: "#ff0000",
+ silver: "#c0c0c0",
+ teal: "#008080",
+ white: "#ffffff",
+ yellow: "#ffff00",
+
+ // 4.2.3. "transparent" color keyword
+ transparent: [ null, null, null, 0 ],
+
+ _default: "#ffffff"
+};
+
+})( jQuery );
+
+
/******************************************************************************/
/****************************** CLASS ANIMATIONS ******************************/
/******************************************************************************/
+(function() {
-var classAnimationActions = ['add', 'remove', 'toggle'],
+var classAnimationActions = [ "add", "remove", "toggle" ],
shorthandStyles = {
border: 1,
borderBottom: 1,
@@ -4207,199 +4928,253 @@ var classAnimationActions = ['add', 'remove', 'toggle'],
padding: 1
};
+$.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) {
+ $.fx.step[ prop ] = function( fx ) {
+ if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) {
+ jQuery.style( fx.elem, prop, fx.end );
+ fx.setAttr = true;
+ }
+ };
+});
+
function getElementStyles() {
- var style = document.defaultView
- ? document.defaultView.getComputedStyle(this, null)
- : this.currentStyle,
+ var style = this.ownerDocument.defaultView ?
+ this.ownerDocument.defaultView.getComputedStyle( this, null ) :
+ this.currentStyle,
newStyle = {},
key,
- camelCase;
+ len;
// webkit enumerates style porperties
- if (style && style.length && style[0] && style[style[0]]) {
- var len = style.length;
- while (len--) {
- key = style[len];
- if (typeof style[key] == 'string') {
- camelCase = key.replace(/\-(\w)/g, function(all, letter){
- return letter.toUpperCase();
- });
- newStyle[camelCase] = style[key];
+ if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
+ len = style.length;
+ while ( len-- ) {
+ key = style[ len ];
+ if ( typeof style[ key ] === "string" ) {
+ newStyle[ $.camelCase( key ) ] = style[ key ];
}
}
} else {
- for (key in style) {
- if (typeof style[key] === 'string') {
- newStyle[key] = style[key];
+ for ( key in style ) {
+ if ( typeof style[ key ] === "string" ) {
+ newStyle[ key ] = style[ key ];
}
}
}
-
+
return newStyle;
}
-function filterStyles(styles) {
- var name, value;
- for (name in styles) {
- value = styles[name];
- if (
- // ignore null and undefined values
- value == null ||
- // ignore functions (when does this occur?)
- $.isFunction(value) ||
- // shorthand styles that need to be expanded
- name in shorthandStyles ||
- // ignore scrollbars (break in IE)
- (/scrollbar/).test(name) ||
-
- // only colors or values that can be converted to numbers
- (!(/color/i).test(name) && isNaN(parseFloat(value)))
- ) {
- delete styles[name];
- }
- }
-
- return styles;
-}
-function styleDifference(oldStyle, newStyle) {
- var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
- name;
+function styleDifference( oldStyle, newStyle ) {
+ var diff = {},
+ name, value;
- for (name in newStyle) {
- if (oldStyle[name] != newStyle[name]) {
- diff[name] = newStyle[name];
+ for ( name in newStyle ) {
+ value = newStyle[ name ];
+ if ( oldStyle[ name ] !== value ) {
+ if ( !shorthandStyles[ name ] ) {
+ if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) {
+ diff[ name ] = value;
+ }
+ }
}
}
return diff;
}
-$.effects.animateClass = function(value, duration, easing, callback) {
- if ($.isFunction(easing)) {
- callback = easing;
- easing = null;
- }
+$.effects.animateClass = function( value, duration, easing, callback ) {
+ var o = $.speed( duration, easing, callback );
- return this.queue(function() {
- var that = $(this),
- originalStyleAttr = that.attr('style') || ' ',
- originalStyle = filterStyles(getElementStyles.call(this)),
- newStyle,
- className = that.attr('class');
+ return this.queue( function() {
+ var animated = $( this ),
+ baseClass = animated.attr( "class" ) || "",
+ applyClassChange,
+ allAnimations = o.children ? animated.find( "*" ).andSelf() : animated;
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) {
- that[action + 'Class'](value[action]);
- }
+ // map the animated objects to store the original styles.
+ allAnimations = allAnimations.map(function() {
+ var el = $( this );
+ return {
+ el: el,
+ start: getElementStyles.call( this )
+ };
});
- newStyle = filterStyles(getElementStyles.call(this));
- that.attr('class', className);
- that.animate(styleDifference(originalStyle, newStyle), {
- queue: false,
- duration: duration,
- easing: easing,
- complete: function() {
- $.each(classAnimationActions, function(i, action) {
- if (value[action]) { that[action + 'Class'](value[action]); }
- });
- // work around bug in IE by clearing the cssText before setting it
- if (typeof that.attr('style') == 'object') {
- that.attr('style').cssText = '';
- that.attr('style').cssText = originalStyleAttr;
- } else {
- that.attr('style', originalStyleAttr);
+ // apply class change
+ applyClassChange = function() {
+ $.each( classAnimationActions, function(i, action) {
+ if ( value[ action ] ) {
+ animated[ action + "Class" ]( value[ action ] );
}
- if (callback) { callback.apply(this, arguments); }
- $.dequeue( this );
- }
+ });
+ };
+ applyClassChange();
+
+ // map all animated objects again - calculate new styles and diff
+ allAnimations = allAnimations.map(function() {
+ this.end = getElementStyles.call( this.el[ 0 ] );
+ this.diff = styleDifference( this.start, this.end );
+ return this;
+ });
+
+ // apply original class
+ animated.attr( "class", baseClass );
+
+ // map all animated objects again - this time collecting a promise
+ allAnimations = allAnimations.map(function() {
+ var styleInfo = this,
+ dfd = $.Deferred(),
+ opts = jQuery.extend({}, o, {
+ queue: false,
+ complete: function() {
+ dfd.resolve( styleInfo );
+ }
+ });
+
+ this.el.animate( this.diff, opts );
+ return dfd.promise();
+ });
+
+ // once all animations have completed:
+ $.when.apply( $, allAnimations.get() ).done(function() {
+
+ // set the final class
+ applyClassChange();
+
+ // for each animated element,
+ // clear all css properties that were animated
+ $.each( arguments, function() {
+ var el = this.el;
+ $.each( this.diff, function(key) {
+ el.css( key, '' );
+ });
+ });
+
+ // this is guarnteed to be there if you use jQuery.speed()
+ // it also handles dequeuing the next anim...
+ o.complete.call( animated[ 0 ] );
});
});
};
$.fn.extend({
_addClass: $.fn.addClass,
- addClass: function(classNames, speed, easing, callback) {
- return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ addClass: function( classNames, speed, easing, callback ) {
+ return speed ?
+ $.effects.animateClass.call( this,
+ { add: classNames }, speed, easing, callback ) :
+ this._addClass( classNames );
},
_removeClass: $.fn.removeClass,
- removeClass: function(classNames,speed,easing,callback) {
- return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ removeClass: function( classNames, speed, easing, callback ) {
+ return speed ?
+ $.effects.animateClass.call( this,
+ { remove: classNames }, speed, easing, callback ) :
+ this._removeClass( classNames );
},
_toggleClass: $.fn.toggleClass,
- toggleClass: function(classNames, force, speed, easing, callback) {
- if ( typeof force == "boolean" || force === undefined ) {
+ toggleClass: function( classNames, force, speed, easing, callback ) {
+ if ( typeof force === "boolean" || force === undefined ) {
if ( !speed ) {
- // without speed parameter;
- return this._toggleClass(classNames, force);
+ // without speed parameter
+ return this._toggleClass( classNames, force );
} else {
- return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ return $.effects.animateClass.call( this,
+ (force ? { add: classNames } : { remove: classNames }),
+ speed, easing, callback );
}
} else {
- // without switch parameter;
- return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ // without force parameter
+ return $.effects.animateClass.call( this,
+ { toggle: classNames }, force, speed, easing );
}
},
- switchClass: function(remove,add,speed,easing,callback) {
- return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ switchClass: function( remove, add, speed, easing, callback) {
+ return $.effects.animateClass.call( this, {
+ add: add,
+ remove: remove
+ }, speed, easing, callback );
}
});
-
+})();
/******************************************************************************/
/*********************************** EFFECTS **********************************/
/******************************************************************************/
-$.extend($.effects, {
- version: "1.8.16",
+(function() {
+
+$.extend( $.effects, {
+ version: "1.9.2",
// Saves a set of properties in a data storage
- save: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ save: function( element, set ) {
+ for( var i=0; i < set.length; i++ ) {
+ if ( set[ i ] !== null ) {
+ element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
+ }
}
},
// Restores a set of previously saved properties from a data storage
- restore: function(element, set) {
- for(var i=0; i < set.length; i++) {
- if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ restore: function( element, set ) {
+ var val, i;
+ for( i=0; i < set.length; i++ ) {
+ if ( set[ i ] !== null ) {
+ val = element.data( dataSpace + set[ i ] );
+ // support: jQuery 1.6.2
+ // http://bugs.jquery.com/ticket/9917
+ // jQuery 1.6.2 incorrectly returns undefined for any falsy value.
+ // We can't differentiate between "" and 0 here, so we just assume
+ // empty string since it's likely to be a more common value...
+ if ( val === undefined ) {
+ val = "";
+ }
+ element.css( set[ i ], val );
+ }
}
},
- setMode: function(el, mode) {
- if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ setMode: function( el, mode ) {
+ if (mode === "toggle") {
+ mode = el.is( ":hidden" ) ? "show" : "hide";
+ }
return mode;
},
- getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
- // this should be a little more flexible in the future to handle a string & hash
+ // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ getBaseline: function( origin, original ) {
var y, x;
- switch (origin[0]) {
- case 'top': y = 0; break;
- case 'middle': y = 0.5; break;
- case 'bottom': y = 1; break;
- default: y = origin[0] / original.height;
- };
- switch (origin[1]) {
- case 'left': x = 0; break;
- case 'center': x = 0.5; break;
- case 'right': x = 1; break;
- default: x = origin[1] / original.width;
+ switch ( origin[ 0 ] ) {
+ case "top": y = 0; break;
+ case "middle": y = 0.5; break;
+ case "bottom": y = 1; break;
+ default: y = origin[ 0 ] / original.height;
+ }
+ switch ( origin[ 1 ] ) {
+ case "left": x = 0; break;
+ case "center": x = 0.5; break;
+ case "right": x = 1; break;
+ default: x = origin[ 1 ] / original.width;
+ }
+ return {
+ x: x,
+ y: y
};
- return {x: x, y: y};
},
// Wraps the element around a wrapper that copies position properties
- createWrapper: function(element) {
+ createWrapper: function( element ) {
// if the element is already wrapped, return it
- if (element.parent().is('.ui-effects-wrapper')) {
+ if ( element.parent().is( ".ui-effects-wrapper" )) {
return element.parent();
}
@@ -4407,108 +5182,149 @@ $.extend($.effects, {
var props = {
width: element.outerWidth(true),
height: element.outerHeight(true),
- 'float': element.css('float')
+ "float": element.css( "float" )
},
- wrapper = $('<div></div>')
- .addClass('ui-effects-wrapper')
+ wrapper = $( "<div></div>" )
+ .addClass( "ui-effects-wrapper" )
.css({
- fontSize: '100%',
- background: 'transparent',
- border: 'none',
+ fontSize: "100%",
+ background: "transparent",
+ border: "none",
margin: 0,
padding: 0
}),
+ // Store the size in case width/height are defined in % - Fixes #5245
+ size = {
+ width: element.width(),
+ height: element.height()
+ },
active = document.activeElement;
- element.wrap(wrapper);
+ // support: Firefox
+ // Firefox incorrectly exposes anonymous content
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+ try {
+ active.id;
+ } catch( e ) {
+ active = document.body;
+ }
+
+ element.wrap( wrapper );
// Fixes #7595 - Elements lose focus when wrapped.
if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
$( active ).focus();
}
-
- wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element
// transfer positioning properties to the wrapper
- if (element.css('position') == 'static') {
- wrapper.css({ position: 'relative' });
- element.css({ position: 'relative' });
+ if ( element.css( "position" ) === "static" ) {
+ wrapper.css({ position: "relative" });
+ element.css({ position: "relative" });
} else {
- $.extend(props, {
- position: element.css('position'),
- zIndex: element.css('z-index')
+ $.extend( props, {
+ position: element.css( "position" ),
+ zIndex: element.css( "z-index" )
});
- $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
- props[pos] = element.css(pos);
- if (isNaN(parseInt(props[pos], 10))) {
- props[pos] = 'auto';
+ $.each([ "top", "left", "bottom", "right" ], function(i, pos) {
+ props[ pos ] = element.css( pos );
+ if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
+ props[ pos ] = "auto";
}
});
- element.css({position: 'relative', top: 0, left: 0, right: 'auto', bottom: 'auto' });
+ element.css({
+ position: "relative",
+ top: 0,
+ left: 0,
+ right: "auto",
+ bottom: "auto"
+ });
}
+ element.css(size);
- return wrapper.css(props).show();
+ return wrapper.css( props ).show();
},
- removeWrapper: function(element) {
- var parent,
- active = document.activeElement;
-
- if (element.parent().is('.ui-effects-wrapper')) {
- parent = element.parent().replaceWith(element);
+ removeWrapper: function( element ) {
+ var active = document.activeElement;
+
+ if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+ element.parent().replaceWith( element );
+
// Fixes #7595 - Elements lose focus when wrapped.
if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
$( active ).focus();
}
- return parent;
}
-
+
+
return element;
},
- setTransition: function(element, list, factor, value) {
+ setTransition: function( element, list, factor, value ) {
value = value || {};
- $.each(list, function(i, x){
- unit = element.cssUnit(x);
- if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ $.each( list, function( i, x ) {
+ var unit = element.cssUnit( x );
+ if ( unit[ 0 ] > 0 ) {
+ value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
+ }
});
return value;
}
});
+// return an effect options object for the given parameters:
+function _normalizeArguments( effect, options, speed, callback ) {
-function _normalizeArguments(effect, options, speed, callback) {
- // shift params for method overloading
- if (typeof effect == 'object') {
- callback = options;
- speed = null;
+ // allow passing all options as the first parameter
+ if ( $.isPlainObject( effect ) ) {
options = effect;
- effect = options.effect;
+ effect = effect.effect;
+ }
+
+ // convert to an object
+ effect = { effect: effect };
+
+ // catch (effect, null, ...)
+ if ( options == null ) {
+ options = {};
}
- if ($.isFunction(options)) {
+
+ // catch (effect, callback)
+ if ( $.isFunction( options ) ) {
callback = options;
speed = null;
options = {};
}
- if (typeof options == 'number' || $.fx.speeds[options]) {
+
+ // catch (effect, speed, ?)
+ if ( typeof options === "number" || $.fx.speeds[ options ] ) {
callback = speed;
speed = options;
options = {};
}
- if ($.isFunction(speed)) {
+
+ // catch (effect, options, callback)
+ if ( $.isFunction( speed ) ) {
callback = speed;
speed = null;
}
- options = options || {};
+ // add options to effect
+ if ( options ) {
+ $.extend( effect, options );
+ }
speed = speed || options.duration;
- speed = $.fx.off ? 0 : typeof speed == 'number'
- ? speed : speed in $.fx.speeds ? $.fx.speeds[speed] : $.fx.speeds._default;
+ effect.duration = $.fx.off ? 0 :
+ typeof speed === "number" ? speed :
+ speed in $.fx.speeds ? $.fx.speeds[ speed ] :
+ $.fx.speeds._default;
- callback = callback || options.complete;
+ effect.complete = callback || options.complete;
- return [effect, options, speed, callback];
+ return effect;
}
function standardSpeed( speed ) {
@@ -4516,1346 +5332,411 @@ function standardSpeed( speed ) {
if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) {
return true;
}
-
+
// invalid strings - treat as "normal" speed
- if ( typeof speed === "string" && !$.effects[ speed ] ) {
+ if ( typeof speed === "string" && !$.effects.effect[ speed ] ) {
+ // TODO: remove in 2.0 (#7115)
+ if ( backCompat && $.effects[ speed ] ) {
+ return false;
+ }
return true;
}
-
+
return false;
}
$.fn.extend({
- effect: function(effect, options, speed, callback) {
- var args = _normalizeArguments.apply(this, arguments),
- // TODO: make effects take actual parameters instead of a hash
- args2 = {
- options: args[1],
- duration: args[2],
- callback: args[3]
- },
- mode = args2.options.mode,
- effectMethod = $.effects[effect];
-
- if ( $.fx.off || !effectMethod ) {
+ effect: function( /* effect, options, speed, callback */ ) {
+ var args = _normalizeArguments.apply( this, arguments ),
+ mode = args.mode,
+ queue = args.queue,
+ effectMethod = $.effects.effect[ args.effect ],
+
+ // DEPRECATED: remove in 2.0 (#7115)
+ oldEffectMethod = !effectMethod && backCompat && $.effects[ args.effect ];
+
+ if ( $.fx.off || !( effectMethod || oldEffectMethod ) ) {
// delegate to the original method (e.g., .show()) if possible
if ( mode ) {
- return this[ mode ]( args2.duration, args2.callback );
+ return this[ mode ]( args.duration, args.complete );
} else {
- return this.each(function() {
- if ( args2.callback ) {
- args2.callback.call( this );
+ return this.each( function() {
+ if ( args.complete ) {
+ args.complete.call( this );
}
});
}
}
-
- return effectMethod.call(this, args2);
+
+ function run( next ) {
+ var elem = $( this ),
+ complete = args.complete,
+ mode = args.mode;
+
+ function done() {
+ if ( $.isFunction( complete ) ) {
+ complete.call( elem[0] );
+ }
+ if ( $.isFunction( next ) ) {
+ next();
+ }
+ }
+
+ // if the element is hiddden and mode is hide,
+ // or element is visible and mode is show
+ if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
+ done();
+ } else {
+ effectMethod.call( elem[0], args, done );
+ }
+ }
+
+ // TODO: remove this check in 2.0, effectMethod will always be true
+ if ( effectMethod ) {
+ return queue === false ? this.each( run ) : this.queue( queue || "fx", run );
+ } else {
+ // DEPRECATED: remove in 2.0 (#7115)
+ return oldEffectMethod.call(this, {
+ options: args,
+ duration: args.duration,
+ callback: args.complete,
+ mode: args.mode
+ });
+ }
},
_show: $.fn.show,
- show: function(speed) {
+ show: function( speed ) {
if ( standardSpeed( speed ) ) {
- return this._show.apply(this, arguments);
+ return this._show.apply( this, arguments );
} else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'show';
- return this.effect.apply(this, args);
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "show";
+ return this.effect.call( this, args );
}
},
_hide: $.fn.hide,
- hide: function(speed) {
+ hide: function( speed ) {
if ( standardSpeed( speed ) ) {
- return this._hide.apply(this, arguments);
+ return this._hide.apply( this, arguments );
} else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'hide';
- return this.effect.apply(this, args);
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "hide";
+ return this.effect.call( this, args );
}
},
// jQuery core overloads toggle and creates _toggle
__toggle: $.fn.toggle,
- toggle: function(speed) {
+ toggle: function( speed ) {
if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) {
- return this.__toggle.apply(this, arguments);
+ return this.__toggle.apply( this, arguments );
} else {
- var args = _normalizeArguments.apply(this, arguments);
- args[1].mode = 'toggle';
- return this.effect.apply(this, args);
+ var args = _normalizeArguments.apply( this, arguments );
+ args.mode = "toggle";
+ return this.effect.call( this, args );
}
},
// helper functions
cssUnit: function(key) {
- var style = this.css(key), val = [];
- $.each( ['em','px','%','pt'], function(i, unit){
- if(style.indexOf(unit) > 0)
- val = [parseFloat(style), unit];
+ var style = this.css( key ),
+ val = [];
+
+ $.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
+ if ( style.indexOf( unit ) > 0 ) {
+ val = [ parseFloat( style ), unit ];
+ }
});
return val;
}
});
-
+})();
/******************************************************************************/
/*********************************** EASING ***********************************/
/******************************************************************************/
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
+(function() {
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
+// based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
-$.extend($.easing,
-{
- def: 'easeOutQuad',
- swing: function (x, t, b, c, d) {
- //alert($.easing.default);
- return $.easing[$.easing.def](x, t, b, c, d);
- },
- easeInQuad: function (x, t, b, c, d) {
- return c*(t/=d)*t + b;
- },
- easeOutQuad: function (x, t, b, c, d) {
- return -c *(t/=d)*(t-2) + b;
- },
- easeInOutQuad: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t + b;
- return -c/2 * ((--t)*(t-2) - 1) + b;
- },
- easeInCubic: function (x, t, b, c, d) {
- return c*(t/=d)*t*t + b;
- },
- easeOutCubic: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t + 1) + b;
- },
- easeInOutCubic: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t + b;
- return c/2*((t-=2)*t*t + 2) + b;
- },
- easeInQuart: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t + b;
- },
- easeOutQuart: function (x, t, b, c, d) {
- return -c * ((t=t/d-1)*t*t*t - 1) + b;
- },
- easeInOutQuart: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
- return -c/2 * ((t-=2)*t*t*t - 2) + b;
- },
- easeInQuint: function (x, t, b, c, d) {
- return c*(t/=d)*t*t*t*t + b;
- },
- easeOutQuint: function (x, t, b, c, d) {
- return c*((t=t/d-1)*t*t*t*t + 1) + b;
- },
- easeInOutQuint: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
- return c/2*((t-=2)*t*t*t*t + 2) + b;
- },
- easeInSine: function (x, t, b, c, d) {
- return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
- },
- easeOutSine: function (x, t, b, c, d) {
- return c * Math.sin(t/d * (Math.PI/2)) + b;
- },
- easeInOutSine: function (x, t, b, c, d) {
- return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
- },
- easeInExpo: function (x, t, b, c, d) {
- return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
- },
- easeOutExpo: function (x, t, b, c, d) {
- return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
- },
- easeInOutExpo: function (x, t, b, c, d) {
- if (t==0) return b;
- if (t==d) return b+c;
- if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
- return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
- },
- easeInCirc: function (x, t, b, c, d) {
- return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
- },
- easeOutCirc: function (x, t, b, c, d) {
- return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
- },
- easeInOutCirc: function (x, t, b, c, d) {
- if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
- return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
- },
- easeInElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+var baseEasings = {};
+
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+ baseEasings[ name ] = function( p ) {
+ return Math.pow( p, i + 2 );
+ };
+});
+
+$.extend( baseEasings, {
+ Sine: function ( p ) {
+ return 1 - Math.cos( p * Math.PI / 2 );
},
- easeOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ Circ: function ( p ) {
+ return 1 - Math.sqrt( 1 - p * p );
},
- easeInOutElastic: function (x, t, b, c, d) {
- var s=1.70158;var p=0;var a=c;
- if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
- if (a < Math.abs(c)) { a=c; var s=p/4; }
- else var s = p/(2*Math.PI) * Math.asin (c/a);
- if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
- return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
- },
- easeInBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*(t/=d)*t*((s+1)*t - s) + b;
- },
- easeOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
- },
- easeInOutBack: function (x, t, b, c, d, s) {
- if (s == undefined) s = 1.70158;
- if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
- return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ Elastic: function( p ) {
+ return p === 0 || p === 1 ? p :
+ -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 );
},
- easeInBounce: function (x, t, b, c, d) {
- return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
- },
- easeOutBounce: function (x, t, b, c, d) {
- if ((t/=d) < (1/2.75)) {
- return c*(7.5625*t*t) + b;
- } else if (t < (2/2.75)) {
- return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
- } else if (t < (2.5/2.75)) {
- return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
- } else {
- return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
- }
+ Back: function( p ) {
+ return p * p * ( 3 * p - 2 );
},
- easeInOutBounce: function (x, t, b, c, d) {
- if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
- return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
- }
-});
+ Bounce: function ( p ) {
+ var pow2,
+ bounce = 4;
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
-
-})(jQuery);
-/*
- * jQuery UI Effects Blind 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.blind = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'vertical') ? 'height' : 'width';
- var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
- if(mode == 'show') wrapper.css(ref, 0); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = mode == 'show' ? distance : 0;
-
- // Animate
- wrapper.animate(animation, o.duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Bounce 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.bounce = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'up'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 5; // Default # of times
- var speed = o.duration || 250; // Default speed per bounce
- if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
- if (mode == 'hide') distance = distance / (times * 2);
- if (mode != 'hide') times--;
-
- // Animate
- if (mode == 'show') { // Show Bounce
- var animation = {opacity: 1};
- animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation, speed / 2, o.options.easing);
- distance = distance / 2;
- times--;
- };
- for (var i = 0; i < times; i++) { // Bounces
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
- distance = (mode == 'hide') ? distance * 2 : distance / 2;
- };
- if (mode == 'hide') { // Last Bounce
- var animation = {opacity: 0};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- el.animate(animation, speed / 2, o.options.easing, function(){
- el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- } else {
- var animation1 = {}, animation2 = {};
- animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
- el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- };
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Clip 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.clip = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','height','width'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'vertical'; // Default direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var animate = el[0].tagName == 'IMG' ? wrapper : el;
- var ref = {
- size: (direction == 'vertical') ? 'height' : 'width',
- position: (direction == 'vertical') ? 'top' : 'left'
- };
- var distance = (direction == 'vertical') ? animate.height() : animate.width();
- if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
-
- // Animation
- var animation = {};
- animation[ref.size] = mode == 'show' ? distance : 0;
- animation[ref.position] = mode == 'show' ? 0 : distance / 2;
-
- // Animate
- animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Drop 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.drop = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','opacity'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
- if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-
- // Animation
- var animation = {opacity: mode == 'show' ? 1 : 0};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Explode 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.explode = function(o) {
-
- return this.queue(function() {
-
- var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
- var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-
- o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
- var el = $(this).show().css('visibility', 'hidden');
- var offset = el.offset();
-
- //Substract the margins - not fixing the problem yet.
- offset.top -= parseInt(el.css("marginTop"),10) || 0;
- offset.left -= parseInt(el.css("marginLeft"),10) || 0;
-
- var width = el.outerWidth(true);
- var height = el.outerHeight(true);
-
- for(var i=0;i<rows;i++) { // =
- for(var j=0;j<cells;j++) { // ||
- el
- .clone()
- .appendTo('body')
- .wrap('<div></div>')
- .css({
- position: 'absolute',
- visibility: 'visible',
- left: -j*(width/cells),
- top: -i*(height/rows)
- })
- .parent()
- .addClass('ui-effects-explode')
- .css({
- position: 'absolute',
- overflow: 'hidden',
- width: width/cells,
- height: height/rows,
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
- opacity: o.options.mode == 'show' ? 0 : 1
- }).animate({
- left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
- top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
- opacity: o.options.mode == 'show' ? 1 : 0
- }, o.duration || 500);
- }
+ while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+ return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
}
+});
- // Set a timeout, to call the callback approx. when the other animations have finished
- setTimeout(function() {
-
- o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
- if(o.callback) o.callback.apply(el[0]); // Callback
- el.dequeue();
-
- $('div.ui-effects-explode').remove();
-
- }, o.duration || 500);
-
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Fade 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Fade
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.fade = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'hide');
-
- elem.animate({ opacity: mode }, {
- queue: false,
- duration: o.duration,
- easing: o.options.easing,
- complete: function() {
- (o.callback && o.callback.apply(this, arguments));
- elem.dequeue();
- }
- });
- });
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Fold 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Fold
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.fold = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
- var size = o.options.size || 15; // Default fold size
- var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
- var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var widthFirst = ((mode == 'show') != horizFirst);
- var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
- var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
- var percent = /([0-9]+)%/.exec(size);
- if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
- if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
-
- // Animation
- var animation1 = {}, animation2 = {};
- animation1[ref[0]] = mode == 'show' ? distance[0] : size;
- animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
-
- // Animate
- wrapper.animate(animation1, duration, o.options.easing)
- .animate(animation2, duration, o.options.easing, function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(el[0], arguments); // Callback
- el.dequeue();
- });
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Highlight 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.highlight = function(o) {
- return this.queue(function() {
- var elem = $(this),
- props = ['backgroundImage', 'backgroundColor', 'opacity'],
- mode = $.effects.setMode(elem, o.options.mode || 'show'),
- animation = {
- backgroundColor: elem.css('backgroundColor')
- };
-
- if (mode == 'hide') {
- animation.opacity = 0;
- }
-
- $.effects.save(elem, props);
- elem
- .show()
- .css({
- backgroundImage: 'none',
- backgroundColor: o.options.color || '#ffff99'
- })
- .animate(animation, {
- queue: false,
- duration: o.duration,
- easing: o.options.easing,
- complete: function() {
- (mode == 'hide' && elem.hide());
- $.effects.restore(elem, props);
- (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
- (o.callback && o.callback.apply(this, arguments));
- elem.dequeue();
- }
- });
- });
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Pulsate 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.pulsate = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'show');
- times = ((o.options.times || 5) * 2) - 1;
- duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
- isVisible = elem.is(':visible'),
- animateTo = 0;
-
- if (!isVisible) {
- elem.css('opacity', 0).show();
- animateTo = 1;
- }
-
- if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
- times--;
- }
-
- for (var i = 0; i < times; i++) {
- elem.animate({ opacity: animateTo }, duration, o.options.easing);
- animateTo = (animateTo + 1) % 2;
- }
-
- elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
- if (animateTo == 0) {
- elem.hide();
- }
- (o.callback && o.callback.apply(this, arguments));
- });
-
- elem
- .queue('fx', function() { elem.dequeue(); })
- .dequeue();
- });
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Scale 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.puff = function(o) {
- return this.queue(function() {
- var elem = $(this),
- mode = $.effects.setMode(elem, o.options.mode || 'hide'),
- percent = parseInt(o.options.percent, 10) || 150,
- factor = percent / 100,
- original = { height: elem.height(), width: elem.width() };
-
- $.extend(o.options, {
- fade: true,
- mode: mode,
- percent: mode == 'hide' ? percent : 100,
- from: mode == 'hide'
- ? original
- : {
- height: original.height * factor,
- width: original.width * factor
- }
- });
-
- elem.effect('scale', o.options, o.duration, o.callback);
- elem.dequeue();
- });
-};
-
-$.effects.scale = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this);
-
- // Set options
- var options = $.extend(true, {}, o.options);
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
- var direction = o.options.direction || 'both'; // Set default axis
- var origin = o.options.origin; // The origin of the scaling
- if (mode != 'effect') { // Set default origin and restore for show/hide
- options.origin = origin || ['middle','center'];
- options.restore = true;
- }
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
-
- // Adjust
- var factor = { // Set scaling factor
- y: direction != 'horizontal' ? (percent / 100) : 1,
- x: direction != 'vertical' ? (percent / 100) : 1
- };
- el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
-
- if (o.options.fade) { // Fade option to support puff
- if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
- if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
- };
-
- // Animation
- options.from = el.from; options.to = el.to; options.mode = mode;
-
- // Animate
- el.effect('size', options, o.duration, o.callback);
- el.dequeue();
- });
-
-};
-
-$.effects.size = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right','width','height','overflow','opacity'];
- var props1 = ['position','top','bottom','left','right','overflow','opacity']; // Always restore
- var props2 = ['width','height','overflow']; // Copy for children
- var cProps = ['fontSize'];
- var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
- var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var restore = o.options.restore || false; // Default restore
- var scale = o.options.scale || 'both'; // Default scale mode
- var origin = o.options.origin; // The origin of the sizing
- var original = {height: el.height(), width: el.width()}; // Save original
- el.from = o.options.from || original; // Default from state
- el.to = o.options.to || original; // Default to state
- // Adjust
- if (origin) { // Calculate baseline shifts
- var baseline = $.effects.getBaseline(origin, original);
- el.from.top = (original.height - el.from.height) * baseline.y;
- el.from.left = (original.width - el.from.width) * baseline.x;
- el.to.top = (original.height - el.to.height) * baseline.y;
- el.to.left = (original.width - el.to.width) * baseline.x;
- };
- var factor = { // Set scaling factor
- from: {y: el.from.height / original.height, x: el.from.width / original.width},
- to: {y: el.to.height / original.height, x: el.to.width / original.width}
- };
- if (scale == 'box' || scale == 'both') { // Scale the css box
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(vProps);
- el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- props = props.concat(hProps);
- el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
- el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
- };
- };
- if (scale == 'content' || scale == 'both') { // Scale the content
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- props = props.concat(cProps);
- el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
- el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
- };
- };
- $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- el.css('overflow','hidden').css(el.from); // Shift
-
- // Animate
- if (scale == 'content' || scale == 'both') { // Scale the children
- vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
- hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
- props2 = props.concat(vProps).concat(hProps); // Concat
- el.find("*[width]").each(function(){
- child = $(this);
- if (restore) $.effects.save(child, props2);
- var c_original = {height: child.height(), width: child.width()}; // Save original
- child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
- child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
- if (factor.from.y != factor.to.y) { // Vertical props scaling
- child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
- child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
- };
- if (factor.from.x != factor.to.x) { // Horizontal props scaling
- child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
- child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
- };
- child.css(child.from); // Shift children
- child.animate(child.to, o.duration, o.options.easing, function(){
- if (restore) $.effects.restore(child, props2); // Restore children
- }); // Animate children
- });
- };
-
- // Animate
- el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if (el.to.opacity === 0) {
- el.css('opacity', el.from.opacity);
- }
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
-
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Shake 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.shake = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
- var direction = o.options.direction || 'left'; // Default direction
- var distance = o.options.distance || 20; // Default distance
- var times = o.options.times || 3; // Default # of times
- var speed = o.duration || o.options.duration || 140; // Default speed per shake
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-
- // Animation
- var animation = {}, animation1 = {}, animation2 = {};
- animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
- animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
- animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
-
- // Animate
- el.animate(animation, speed, o.options.easing);
- for (var i = 1; i < times; i++) { // Shakes
- el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
- };
- el.animate(animation1, speed, o.options.easing).
- animate(animation, speed / 2, o.options.easing, function(){ // Last shake
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- });
- el.queue('fx', function() { el.dequeue(); });
- el.dequeue();
- });
-
-};
-
-})(jQuery);
-/*
- * jQuery UI Effects Slide 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- * jquery.effects.core.js
- */
-(function( $, undefined ) {
-
-$.effects.slide = function(o) {
-
- return this.queue(function() {
-
- // Create element
- var el = $(this), props = ['position','top','bottom','left','right'];
-
- // Set options
- var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
- var direction = o.options.direction || 'left'; // Default Direction
-
- // Adjust
- $.effects.save(el, props); el.show(); // Save & Show
- $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
- var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
- var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
- var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
- if (mode == 'show') el.css(ref, motion == 'pos' ? (isNaN(distance) ? "-" + distance : -distance) : distance); // Shift
-
- // Animation
- var animation = {};
- animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
- // Animate
- el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
- if(mode == 'hide') el.hide(); // Hide
- $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
- if(o.callback) o.callback.apply(this, arguments); // Callback
- el.dequeue();
- }});
+$.each( baseEasings, function( name, easeIn ) {
+ $.easing[ "easeIn" + name ] = easeIn;
+ $.easing[ "easeOut" + name ] = function( p ) {
+ return 1 - easeIn( 1 - p );
+ };
+ $.easing[ "easeInOut" + name ] = function( p ) {
+ return p < 0.5 ?
+ easeIn( p * 2 ) / 2 :
+ 1 - easeIn( p * -2 + 2 ) / 2;
+ };
+});
- });
+})();
-};
+})(jQuery));
-})(jQuery);
-/*
- * jQuery UI Effects Transfer 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- * jquery.effects.core.js
- */
(function( $, undefined ) {
-$.effects.transfer = function(o) {
- return this.queue(function() {
- var elem = $(this),
- target = $(o.options.to),
- endPosition = target.offset(),
- animation = {
- top: endPosition.top,
- left: endPosition.left,
- height: target.innerHeight(),
- width: target.innerWidth()
- },
- startPosition = elem.offset(),
- transfer = $('<div class="ui-effects-transfer"></div>')
- .appendTo(document.body)
- .addClass(o.options.className)
- .css({
- top: startPosition.top,
- left: startPosition.left,
- height: elem.innerHeight(),
- width: elem.innerWidth(),
- position: 'absolute'
- })
- .animate(animation, o.duration, o.options.easing, function() {
- transfer.remove();
- (o.callback && o.callback.apply(elem[0], arguments));
- elem.dequeue();
- });
- });
-};
+var uid = 0,
+ hideProps = {},
+ showProps = {};
-})(jQuery);
-/*
- * jQuery UI Accordion 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
-(function( $, undefined ) {
+hideProps.height = hideProps.paddingTop = hideProps.paddingBottom =
+ hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide";
+showProps.height = showProps.paddingTop = showProps.paddingBottom =
+ showProps.borderTopWidth = showProps.borderBottomWidth = "show";
$.widget( "ui.accordion", {
+ version: "1.9.2",
options: {
active: 0,
- animated: "slide",
- autoHeight: true,
- clearStyle: false,
+ animate: {},
collapsible: false,
event: "click",
- fillSpace: false,
header: "> li > :first-child,> :not(li):even",
+ heightStyle: "auto",
icons: {
- header: "ui-icon-triangle-1-e",
- headerSelected: "ui-icon-triangle-1-s"
+ activeHeader: "ui-icon-triangle-1-s",
+ header: "ui-icon-triangle-1-e"
},
- navigation: false,
- navigationFilter: function() {
- return this.href.toLowerCase() === location.href.toLowerCase();
- }
+
+ // callbacks
+ activate: null,
+ beforeActivate: null
},
_create: function() {
- var self = this,
- options = self.options;
-
- self.running = 0;
-
- self.element
- .addClass( "ui-accordion ui-widget ui-helper-reset" )
- // in lack of child-selectors in CSS
- // we need to mark top-LIs in a UL-accordion for some IE-fix
- .children( "li" )
- .addClass( "ui-accordion-li-fix" );
-
- self.headers = self.element.find( options.header )
- .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" )
- .bind( "mouseenter.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).addClass( "ui-state-hover" );
- })
- .bind( "mouseleave.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).removeClass( "ui-state-hover" );
- })
- .bind( "focus.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).addClass( "ui-state-focus" );
- })
- .bind( "blur.accordion", function() {
- if ( options.disabled ) {
- return;
- }
- $( this ).removeClass( "ui-state-focus" );
- });
-
- self.headers.next()
- .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" );
-
- if ( options.navigation ) {
- var current = self.element.find( "a" ).filter( options.navigationFilter ).eq( 0 );
- if ( current.length ) {
- var header = current.closest( ".ui-accordion-header" );
- if ( header.length ) {
- // anchor within header
- self.active = header;
- } else {
- // anchor within content
- self.active = current.closest( ".ui-accordion-content" ).prev();
- }
- }
- }
-
- self.active = self._findActive( self.active || options.active )
- .addClass( "ui-state-default ui-state-active" )
- .toggleClass( "ui-corner-all" )
- .toggleClass( "ui-corner-top" );
- self.active.next().addClass( "ui-accordion-content-active" );
+ var accordionId = this.accordionId = "ui-accordion-" +
+ (this.element.attr( "id" ) || ++uid),
+ options = this.options;
+
+ this.prevShow = this.prevHide = $();
+ this.element.addClass( "ui-accordion ui-widget ui-helper-reset" );
+
+ this.headers = this.element.find( options.header )
+ .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" );
+ this._hoverable( this.headers );
+ this._focusable( this.headers );
+
+ this.headers.next()
+ .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" )
+ .hide();
+
+ // don't allow collapsible: false and active: false / null
+ if ( !options.collapsible && (options.active === false || options.active == null) ) {
+ options.active = 0;
+ }
+ // handle negative values
+ if ( options.active < 0 ) {
+ options.active += this.headers.length;
+ }
+ this.active = this._findActive( options.active )
+ .addClass( "ui-accordion-header-active ui-state-active" )
+ .toggleClass( "ui-corner-all ui-corner-top" );
+ this.active.next()
+ .addClass( "ui-accordion-content-active" )
+ .show();
+
+ this._createIcons();
+ this.refresh();
- self._createIcons();
- self.resize();
-
// ARIA
- self.element.attr( "role", "tablist" );
+ this.element.attr( "role", "tablist" );
- self.headers
+ this.headers
.attr( "role", "tab" )
- .bind( "keydown.accordion", function( event ) {
- return self._keydown( event );
+ .each(function( i ) {
+ var header = $( this ),
+ headerId = header.attr( "id" ),
+ panel = header.next(),
+ panelId = panel.attr( "id" );
+ if ( !headerId ) {
+ headerId = accordionId + "-header-" + i;
+ header.attr( "id", headerId );
+ }
+ if ( !panelId ) {
+ panelId = accordionId + "-panel-" + i;
+ panel.attr( "id", panelId );
+ }
+ header.attr( "aria-controls", panelId );
+ panel.attr( "aria-labelledby", headerId );
})
.next()
.attr( "role", "tabpanel" );
- self.headers
- .not( self.active || "" )
+ this.headers
+ .not( this.active )
.attr({
- "aria-expanded": "false",
"aria-selected": "false",
tabIndex: -1
})
.next()
+ .attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ })
.hide();
// make sure at least one header is in the tab order
- if ( !self.active.length ) {
- self.headers.eq( 0 ).attr( "tabIndex", 0 );
+ if ( !this.active.length ) {
+ this.headers.eq( 0 ).attr( "tabIndex", 0 );
} else {
- self.active
+ this.active.attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ })
+ .next()
.attr({
"aria-expanded": "true",
- "aria-selected": "true",
- tabIndex: 0
+ "aria-hidden": "false"
});
}
- // only need links in tab order for Safari
- if ( !$.browser.safari ) {
- self.headers.find( "a" ).attr( "tabIndex", -1 );
- }
+ this._on( this.headers, { keydown: "_keydown" });
+ this._on( this.headers.next(), { keydown: "_panelKeyDown" });
+ this._setupEvents( options.event );
+ },
- if ( options.event ) {
- self.headers.bind( options.event.split(" ").join(".accordion ") + ".accordion", function(event) {
- self._clickHandler.call( self, event, this );
- event.preventDefault();
- });
- }
+ _getCreateEventData: function() {
+ return {
+ header: this.active,
+ content: !this.active.length ? $() : this.active.next()
+ };
},
_createIcons: function() {
- var options = this.options;
- if ( options.icons ) {
- $( "<span></span>" )
- .addClass( "ui-icon " + options.icons.header )
+ var icons = this.options.icons;
+ if ( icons ) {
+ $( "<span>" )
+ .addClass( "ui-accordion-header-icon ui-icon " + icons.header )
.prependTo( this.headers );
- this.active.children( ".ui-icon" )
- .toggleClass(options.icons.header)
- .toggleClass(options.icons.headerSelected);
- this.element.addClass( "ui-accordion-icons" );
+ this.active.children( ".ui-accordion-header-icon" )
+ .removeClass( icons.header )
+ .addClass( icons.activeHeader );
+ this.headers.addClass( "ui-accordion-icons" );
}
},
_destroyIcons: function() {
- this.headers.children( ".ui-icon" ).remove();
- this.element.removeClass( "ui-accordion-icons" );
+ this.headers
+ .removeClass( "ui-accordion-icons" )
+ .children( ".ui-accordion-header-icon" )
+ .remove();
},
- destroy: function() {
- var options = this.options;
+ _destroy: function() {
+ var contents;
+ // clean up main element
this.element
.removeClass( "ui-accordion ui-widget ui-helper-reset" )
.removeAttr( "role" );
+ // clean up headers
this.headers
- .unbind( ".accordion" )
- .removeClass( "ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
+ .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" )
.removeAttr( "role" )
- .removeAttr( "aria-expanded" )
.removeAttr( "aria-selected" )
- .removeAttr( "tabIndex" );
-
- this.headers.find( "a" ).removeAttr( "tabIndex" );
+ .removeAttr( "aria-controls" )
+ .removeAttr( "tabIndex" )
+ .each(function() {
+ if ( /^ui-accordion/.test( this.id ) ) {
+ this.removeAttribute( "id" );
+ }
+ });
this._destroyIcons();
- var contents = this.headers.next()
+
+ // clean up content panels
+ contents = this.headers.next()
.css( "display", "" )
.removeAttr( "role" )
- .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled" );
- if ( options.autoHeight || options.fillHeight ) {
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-labelledby" )
+ .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" )
+ .each(function() {
+ if ( /^ui-accordion/.test( this.id ) ) {
+ this.removeAttribute( "id" );
+ }
+ });
+ if ( this.options.heightStyle !== "content" ) {
contents.css( "height", "" );
}
-
- return $.Widget.prototype.destroy.call( this );
},
_setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
-
- if ( key == "active" ) {
- this.activate( value );
+ if ( key === "active" ) {
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
+
+ if ( key === "event" ) {
+ if ( this.options.event ) {
+ this._off( this.headers, this.options.event );
+ }
+ this._setupEvents( value );
+ }
+
+ this._super( key, value );
+
+ // setting collapsible: false while collapsed; open first panel
+ if ( key === "collapsible" && !value && this.options.active === false ) {
+ this._activate( 0 );
}
- if ( key == "icons" ) {
+
+ if ( key === "icons" ) {
this._destroyIcons();
if ( value ) {
this._createIcons();
}
}
+
// #5332 - opacity doesn't cascade to positioned elements in IE
// so we need to add the disabled class to the headers and panels
- if ( key == "disabled" ) {
- this.headers.add(this.headers.next())
- [ value ? "addClass" : "removeClass" ](
- "ui-accordion-disabled ui-state-disabled" );
+ if ( key === "disabled" ) {
+ this.headers.add( this.headers.next() )
+ .toggleClass( "ui-state-disabled", !!value );
}
},
_keydown: function( event ) {
- if ( this.options.disabled || event.altKey || event.ctrlKey ) {
+ if ( event.altKey || event.ctrlKey ) {
return;
}
@@ -5875,32 +5756,57 @@ $.widget( "ui.accordion", {
break;
case keyCode.SPACE:
case keyCode.ENTER:
- this._clickHandler( { target: event.target }, event.target );
- event.preventDefault();
+ this._eventHandler( event );
+ break;
+ case keyCode.HOME:
+ toFocus = this.headers[ 0 ];
+ break;
+ case keyCode.END:
+ toFocus = this.headers[ length - 1 ];
+ break;
}
if ( toFocus ) {
$( event.target ).attr( "tabIndex", -1 );
$( toFocus ).attr( "tabIndex", 0 );
toFocus.focus();
- return false;
+ event.preventDefault();
}
-
- return true;
},
- resize: function() {
- var options = this.options,
- maxHeight;
+ _panelKeyDown : function( event ) {
+ if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
+ $( event.currentTarget ).prev().focus();
+ }
+ },
- if ( options.fillSpace ) {
- if ( $.browser.msie ) {
- var defOverflow = this.element.parent().css( "overflow" );
- this.element.parent().css( "overflow", "hidden");
- }
- maxHeight = this.element.parent().height();
- if ($.browser.msie) {
- this.element.parent().css( "overflow", defOverflow );
+ refresh: function() {
+ var maxHeight, overflow,
+ heightStyle = this.options.heightStyle,
+ parent = this.element.parent();
+
+
+ if ( heightStyle === "fill" ) {
+ // IE 6 treats height like minHeight, so we need to turn off overflow
+ // in order to get a reliable height
+ // we use the minHeight support test because we assume that only
+ // browsers that don't support minHeight will treat height as minHeight
+ if ( !$.support.minHeight ) {
+ overflow = parent.css( "overflow" );
+ parent.css( "overflow", "hidden");
+ }
+ maxHeight = parent.height();
+ this.element.siblings( ":visible" ).each(function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
+
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
+ });
+ if ( overflow ) {
+ parent.css( "overflow", overflow );
}
this.headers.each(function() {
@@ -5913,364 +5819,423 @@ $.widget( "ui.accordion", {
$( this ).innerHeight() + $( this ).height() ) );
})
.css( "overflow", "auto" );
- } else if ( options.autoHeight ) {
+ } else if ( heightStyle === "auto" ) {
maxHeight = 0;
this.headers.next()
.each(function() {
- maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
})
.height( maxHeight );
}
-
- return this;
},
- activate: function( index ) {
- // TODO this gets called on init, changing the option without an explicit call for that
- this.options.active = index;
- // call clickHandler with custom event
+ _activate: function( index ) {
var active = this._findActive( index )[ 0 ];
- this._clickHandler( { target: active }, active );
- return this;
+ // trying to activate the already active panel
+ if ( active === this.active[ 0 ] ) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the currently active header
+ active = active || this.active[ 0 ];
+
+ this._eventHandler({
+ target: active,
+ currentTarget: active,
+ preventDefault: $.noop
+ });
},
_findActive: function( selector ) {
- return selector
- ? typeof selector === "number"
- ? this.headers.filter( ":eq(" + selector + ")" )
- : this.headers.not( this.headers.not( selector ) )
- : selector === false
- ? $( [] )
- : this.headers.filter( ":eq(0)" );
+ return typeof selector === "number" ? this.headers.eq( selector ) : $();
},
- // TODO isn't event.target enough? why the separate target argument?
- _clickHandler: function( event, target ) {
- var options = this.options;
- if ( options.disabled ) {
- return;
- }
-
- // called only when using activate(false) to close all parts programmatically
- if ( !event.target ) {
- if ( !options.collapsible ) {
- return;
- }
- this.active
- .removeClass( "ui-state-active ui-corner-top" )
- .addClass( "ui-state-default ui-corner-all" )
- .children( ".ui-icon" )
- .removeClass( options.icons.headerSelected )
- .addClass( options.icons.header );
- this.active.next().addClass( "ui-accordion-content-active" );
- var toHide = this.active.next(),
- data = {
- options: options,
- newHeader: $( [] ),
- oldHeader: options.active,
- newContent: $( [] ),
- oldContent: toHide
- },
- toShow = ( this.active = $( [] ) );
- this._toggle( toShow, toHide, data );
+ _setupEvents: function( event ) {
+ var events = {};
+ if ( !event ) {
return;
}
+ $.each( event.split(" "), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ });
+ this._on( this.headers, events );
+ },
- // get the click target
- var clicked = $( event.currentTarget || target ),
- clickedIsActive = clicked[0] === this.active[0];
+ _eventHandler: function( event ) {
+ var options = this.options,
+ active = this.active,
+ clicked = $( event.currentTarget ),
+ clickedIsActive = clicked[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : clicked.next(),
+ toHide = active.next(),
+ eventData = {
+ oldHeader: active,
+ oldPanel: toHide,
+ newHeader: collapsing ? $() : clicked,
+ newPanel: toShow
+ };
- // TODO the option is changed, is that correct?
- // TODO if it is correct, shouldn't that happen after determining that the click is valid?
- options.active = options.collapsible && clickedIsActive ?
- false :
- this.headers.index( clicked );
+ event.preventDefault();
- // if animations are still active, or the active header is the target, ignore click
- if ( this.running || ( !options.collapsible && clickedIsActive ) ) {
+ if (
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
return;
}
- // find elements to show and hide
- var active = this.active,
- toShow = clicked.next(),
- toHide = this.active.next(),
- data = {
- options: options,
- newHeader: clickedIsActive && options.collapsible ? $([]) : clicked,
- oldHeader: this.active,
- newContent: clickedIsActive && options.collapsible ? $([]) : toShow,
- oldContent: toHide
- },
- down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+ options.active = collapsing ? false : this.headers.index( clicked );
// when the call to ._toggle() comes after the class changes
// it causes a very odd bug in IE 8 (see #6720)
- this.active = clickedIsActive ? $([]) : clicked;
- this._toggle( toShow, toHide, data, clickedIsActive, down );
+ this.active = clickedIsActive ? $() : clicked;
+ this._toggle( eventData );
// switch classes
- active
- .removeClass( "ui-state-active ui-corner-top" )
- .addClass( "ui-state-default ui-corner-all" )
- .children( ".ui-icon" )
- .removeClass( options.icons.headerSelected )
+ // corner classes on the previously active header stay after the animation
+ active.removeClass( "ui-accordion-header-active ui-state-active" );
+ if ( options.icons ) {
+ active.children( ".ui-accordion-header-icon" )
+ .removeClass( options.icons.activeHeader )
.addClass( options.icons.header );
+ }
+
if ( !clickedIsActive ) {
clicked
- .removeClass( "ui-state-default ui-corner-all" )
- .addClass( "ui-state-active ui-corner-top" )
- .children( ".ui-icon" )
+ .removeClass( "ui-corner-all" )
+ .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" );
+ if ( options.icons ) {
+ clicked.children( ".ui-accordion-header-icon" )
.removeClass( options.icons.header )
- .addClass( options.icons.headerSelected );
+ .addClass( options.icons.activeHeader );
+ }
+
clicked
.next()
.addClass( "ui-accordion-content-active" );
}
-
- return;
},
- _toggle: function( toShow, toHide, data, clickedIsActive, down ) {
- var self = this,
- options = self.options;
+ _toggle: function( data ) {
+ var toShow = data.newPanel,
+ toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
- self.toShow = toShow;
- self.toHide = toHide;
- self.data = data;
+ // handle activating a panel during the animation for another activation
+ this.prevShow.add( this.prevHide ).stop( true, true );
+ this.prevShow = toShow;
+ this.prevHide = toHide;
- var complete = function() {
- if ( !self ) {
- return;
- }
- return self._completed.apply( self, arguments );
- };
+ if ( this.options.animate ) {
+ this._animate( toShow, toHide, data );
+ } else {
+ toHide.hide();
+ toShow.show();
+ this._toggleComplete( data );
+ }
- // trigger changestart event
- self._trigger( "changestart", null, self.data );
+ toHide.attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+ toHide.prev().attr( "aria-selected", "false" );
+ // if we're switching panels, remove the old header from the tab order
+ // if we're opening from collapsed state, remove the previous header from the tab order
+ // if we're collapsing, then keep the collapsing header in the tab order
+ if ( toShow.length && toHide.length ) {
+ toHide.prev().attr( "tabIndex", -1 );
+ } else if ( toShow.length ) {
+ this.headers.filter(function() {
+ return $( this ).attr( "tabIndex" ) === 0;
+ })
+ .attr( "tabIndex", -1 );
+ }
- // count elements to animate
- self.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+ toShow
+ .attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ })
+ .prev()
+ .attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ },
- if ( options.animated ) {
- var animOptions = {};
+ _animate: function( toShow, toHide, data ) {
+ var total, easing, duration,
+ that = this,
+ adjust = 0,
+ down = toShow.length &&
+ ( !toHide.length || ( toShow.index() < toHide.index() ) ),
+ animate = this.options.animate || {},
+ options = down && animate.down || animate,
+ complete = function() {
+ that._toggleComplete( data );
+ };
- if ( options.collapsible && clickedIsActive ) {
- animOptions = {
- toShow: $( [] ),
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: options.autoHeight || options.fillSpace
- };
- } else {
- animOptions = {
- toShow: toShow,
- toHide: toHide,
- complete: complete,
- down: down,
- autoHeight: options.autoHeight || options.fillSpace
- };
- }
+ if ( typeof options === "number" ) {
+ duration = options;
+ }
+ if ( typeof options === "string" ) {
+ easing = options;
+ }
+ // fall back from options to animation in case of partial down settings
+ easing = easing || options.easing || animate.easing;
+ duration = duration || options.duration || animate.duration;
- if ( !options.proxied ) {
- options.proxied = options.animated;
- }
+ if ( !toHide.length ) {
+ return toShow.animate( showProps, duration, easing, complete );
+ }
+ if ( !toShow.length ) {
+ return toHide.animate( hideProps, duration, easing, complete );
+ }
- if ( !options.proxiedDuration ) {
- options.proxiedDuration = options.duration;
+ total = toShow.show().outerHeight();
+ toHide.animate( hideProps, {
+ duration: duration,
+ easing: easing,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
}
+ });
+ toShow
+ .hide()
+ .animate( showProps, {
+ duration: duration,
+ easing: easing,
+ complete: complete,
+ step: function( now, fx ) {
+ fx.now = Math.round( now );
+ if ( fx.prop !== "height" ) {
+ adjust += fx.now;
+ } else if ( that.options.heightStyle !== "content" ) {
+ fx.now = Math.round( total - toHide.outerHeight() - adjust );
+ adjust = 0;
+ }
+ }
+ });
+ },
- options.animated = $.isFunction( options.proxied ) ?
- options.proxied( animOptions ) :
- options.proxied;
+ _toggleComplete: function( data ) {
+ var toHide = data.oldPanel;
- options.duration = $.isFunction( options.proxiedDuration ) ?
- options.proxiedDuration( animOptions ) :
- options.proxiedDuration;
+ toHide
+ .removeClass( "ui-accordion-content-active" )
+ .prev()
+ .removeClass( "ui-corner-top" )
+ .addClass( "ui-corner-all" );
- var animations = $.ui.accordion.animations,
- duration = options.duration,
- easing = options.animated;
+ // Work around for rendering bug in IE (#5421)
+ if ( toHide.length ) {
+ toHide.parent()[0].className = toHide.parent()[0].className;
+ }
- if ( easing && !animations[ easing ] && !$.easing[ easing ] ) {
- easing = "slide";
+ this._trigger( "activate", null, data );
+ }
+});
+
+
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+ // navigation options
+ (function( $, prototype ) {
+ $.extend( prototype.options, {
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() === location.href.toLowerCase();
}
- if ( !animations[ easing ] ) {
- animations[ easing ] = function( options ) {
- this.slide( options, {
- easing: easing,
- duration: duration || 700
+ });
+
+ var _create = prototype._create;
+ prototype._create = function() {
+ if ( this.options.navigation ) {
+ var that = this,
+ headers = this.element.find( this.options.header ),
+ content = headers.next(),
+ current = headers.add( content )
+ .find( "a" )
+ .filter( this.options.navigationFilter )
+ [ 0 ];
+ if ( current ) {
+ headers.add( content ).each( function( index ) {
+ if ( $.contains( this, current ) ) {
+ that.options.active = Math.floor( index / 2 );
+ return false;
+ }
});
- };
+ }
}
+ _create.call( this );
+ };
+ }( jQuery, jQuery.ui.accordion.prototype ) );
+
+ // height options
+ (function( $, prototype ) {
+ $.extend( prototype.options, {
+ heightStyle: null, // remove default so we fall back to old values
+ autoHeight: true, // use heightStyle: "auto"
+ clearStyle: false, // use heightStyle: "content"
+ fillSpace: false // use heightStyle: "fill"
+ });
- animations[ easing ]( animOptions );
- } else {
- if ( options.collapsible && clickedIsActive ) {
- toShow.toggle();
- } else {
- toHide.hide();
- toShow.show();
+ var _create = prototype._create,
+ _setOption = prototype._setOption;
+
+ $.extend( prototype, {
+ _create: function() {
+ this.options.heightStyle = this.options.heightStyle ||
+ this._mergeHeightStyle();
+
+ _create.call( this );
+ },
+
+ _setOption: function( key ) {
+ if ( key === "autoHeight" || key === "clearStyle" || key === "fillSpace" ) {
+ this.options.heightStyle = this._mergeHeightStyle();
+ }
+ _setOption.apply( this, arguments );
+ },
+
+ _mergeHeightStyle: function() {
+ var options = this.options;
+
+ if ( options.fillSpace ) {
+ return "fill";
+ }
+
+ if ( options.clearStyle ) {
+ return "content";
+ }
+
+ if ( options.autoHeight ) {
+ return "auto";
+ }
}
+ });
+ }( jQuery, jQuery.ui.accordion.prototype ) );
- complete( true );
- }
+ // icon options
+ (function( $, prototype ) {
+ $.extend( prototype.options.icons, {
+ activeHeader: null, // remove default so we fall back to old values
+ headerSelected: "ui-icon-triangle-1-s"
+ });
- // TODO assert that the blur and focus triggers are really necessary, remove otherwise
- toHide.prev()
- .attr({
- "aria-expanded": "false",
- "aria-selected": "false",
- tabIndex: -1
- })
- .blur();
- toShow.prev()
- .attr({
- "aria-expanded": "true",
- "aria-selected": "true",
- tabIndex: 0
- })
- .focus();
- },
+ var _createIcons = prototype._createIcons;
+ prototype._createIcons = function() {
+ if ( this.options.icons ) {
+ this.options.icons.activeHeader = this.options.icons.activeHeader ||
+ this.options.icons.headerSelected;
+ }
+ _createIcons.call( this );
+ };
+ }( jQuery, jQuery.ui.accordion.prototype ) );
- _completed: function( cancel ) {
- this.running = cancel ? 0 : --this.running;
- if ( this.running ) {
- return;
- }
+ // expanded active option, activate method
+ (function( $, prototype ) {
+ prototype.activate = prototype._activate;
- if ( this.options.clearStyle ) {
- this.toShow.add( this.toHide ).css({
- height: "",
- overflow: ""
- });
- }
+ var _findActive = prototype._findActive;
+ prototype._findActive = function( index ) {
+ if ( index === -1 ) {
+ index = false;
+ }
+ if ( index && typeof index !== "number" ) {
+ index = this.headers.index( this.headers.filter( index ) );
+ if ( index === -1 ) {
+ index = false;
+ }
+ }
+ return _findActive.call( this, index );
+ };
+ }( jQuery, jQuery.ui.accordion.prototype ) );
- // other classes are removed before the animation; this one needs to stay until completed
- this.toHide.removeClass( "ui-accordion-content-active" );
- // Work around for rendering bug in IE (#5421)
- if ( this.toHide.length ) {
- this.toHide.parent()[0].className = this.toHide.parent()[0].className;
- }
+ // resize method
+ jQuery.ui.accordion.prototype.resize = jQuery.ui.accordion.prototype.refresh;
- this._trigger( "change", null, this.data );
- }
-});
+ // change events
+ (function( $, prototype ) {
+ $.extend( prototype.options, {
+ change: null,
+ changestart: null
+ });
-$.extend( $.ui.accordion, {
- version: "1.8.16",
- animations: {
- slide: function( options, additions ) {
- options = $.extend({
- easing: "swing",
- duration: 300
- }, options, additions );
- if ( !options.toHide.size() ) {
- options.toShow.animate({
- height: "show",
- paddingTop: "show",
- paddingBottom: "show"
- }, options );
- return;
+ var _trigger = prototype._trigger;
+ prototype._trigger = function( type, event, data ) {
+ var ret = _trigger.apply( this, arguments );
+ if ( !ret ) {
+ return false;
}
- if ( !options.toShow.size() ) {
- options.toHide.animate({
- height: "hide",
- paddingTop: "hide",
- paddingBottom: "hide"
- }, options );
- return;
+
+ if ( type === "beforeActivate" ) {
+ ret = _trigger.call( this, "changestart", event, {
+ oldHeader: data.oldHeader,
+ oldContent: data.oldPanel,
+ newHeader: data.newHeader,
+ newContent: data.newPanel
+ });
+ } else if ( type === "activate" ) {
+ ret = _trigger.call( this, "change", event, {
+ oldHeader: data.oldHeader,
+ oldContent: data.oldPanel,
+ newHeader: data.newHeader,
+ newContent: data.newPanel
+ });
}
- var overflow = options.toShow.css( "overflow" ),
- percentDone = 0,
- showProps = {},
- hideProps = {},
- fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
- originalWidth;
- // fix width before calculating height of hidden element
- var s = options.toShow;
- originalWidth = s[0].style.width;
- s.width( parseInt( s.parent().width(), 10 )
- - parseInt( s.css( "paddingLeft" ), 10 )
- - parseInt( s.css( "paddingRight" ), 10 )
- - ( parseInt( s.css( "borderLeftWidth" ), 10 ) || 0 )
- - ( parseInt( s.css( "borderRightWidth" ), 10) || 0 ) );
-
- $.each( fxAttrs, function( i, prop ) {
- hideProps[ prop ] = "hide";
-
- var parts = ( "" + $.css( options.toShow[0], prop ) ).match( /^([\d+-.]+)(.*)$/ );
- showProps[ prop ] = {
- value: parts[ 1 ],
- unit: parts[ 2 ] || "px"
- };
- });
- options.toShow.css({ height: 0, overflow: "hidden" }).show();
- options.toHide
- .filter( ":hidden" )
- .each( options.complete )
- .end()
- .filter( ":visible" )
- .animate( hideProps, {
- step: function( now, settings ) {
- // only calculate the percent when animating height
- // IE gets very inconsistent results when animating elements
- // with small values, which is common for padding
- if ( settings.prop == "height" ) {
- percentDone = ( settings.end - settings.start === 0 ) ? 0 :
- ( settings.now - settings.start ) / ( settings.end - settings.start );
- }
+ return ret;
+ };
+ }( jQuery, jQuery.ui.accordion.prototype ) );
+
+ // animated option
+ // NOTE: this only provides support for "slide", "bounceslide", and easings
+ // not the full $.ui.accordion.animations API
+ (function( $, prototype ) {
+ $.extend( prototype.options, {
+ animate: null,
+ animated: "slide"
+ });
- options.toShow[ 0 ].style[ settings.prop ] =
- ( percentDone * showProps[ settings.prop ].value )
- + showProps[ settings.prop ].unit;
- },
- duration: options.duration,
- easing: options.easing,
- complete: function() {
- if ( !options.autoHeight ) {
- options.toShow.css( "height", "" );
- }
- options.toShow.css({
- width: originalWidth,
- overflow: overflow
- });
- options.complete();
+ var _create = prototype._create;
+ prototype._create = function() {
+ var options = this.options;
+ if ( options.animate === null ) {
+ if ( !options.animated ) {
+ options.animate = false;
+ } else if ( options.animated === "slide" ) {
+ options.animate = 300;
+ } else if ( options.animated === "bounceslide" ) {
+ options.animate = {
+ duration: 200,
+ down: {
+ easing: "easeOutBounce",
+ duration: 1000
+ }
+ };
+ } else {
+ options.animate = options.animated;
}
- });
- },
- bounceslide: function( options ) {
- this.slide( options, {
- easing: options.down ? "easeOutBounce" : "swing",
- duration: options.down ? 1000 : 200
- });
- }
- }
-});
+ }
+
+ _create.call( this );
+ };
+ }( jQuery, jQuery.ui.accordion.prototype ) );
+}
})( jQuery );
-/*
- * jQuery UI Autocomplete 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Autocomplete
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.position.js
- */
+
(function( $, undefined ) {
// used to prevent race conditions with remote data sources
var requestIndex = 0;
$.widget( "ui.autocomplete", {
+ version: "1.9.2",
+ defaultElement: "<input>",
options: {
appendTo: "body",
autoFocus: false,
@@ -6281,248 +6246,339 @@ $.widget( "ui.autocomplete", {
at: "left bottom",
collision: "none"
},
- source: null
+ source: null,
+
+ // callbacks
+ change: null,
+ close: null,
+ focus: null,
+ open: null,
+ response: null,
+ search: null,
+ select: null
},
pending: 0,
_create: function() {
- var self = this,
- doc = this.element[ 0 ].ownerDocument,
- suppressKeyPress;
+ // Some browsers only repeat keydown events, not keypress events,
+ // so we use the suppressKeyPress flag to determine if we've already
+ // handled the keydown event. #7269
+ // Unfortunately the code for & in keypress is the same as the up arrow,
+ // so we use the suppressKeyPressRepeat flag to avoid handling keypress
+ // events when we know the keydown event was used to modify the
+ // search term. #7799
+ var suppressKeyPress, suppressKeyPressRepeat, suppressInput;
+
+ this.isMultiLine = this._isMultiLine();
+ this.valueMethod = this.element[ this.element.is( "input,textarea" ) ? "val" : "text" ];
+ this.isNewMenu = true;
this.element
.addClass( "ui-autocomplete-input" )
- .attr( "autocomplete", "off" )
- // TODO verify these actually work as intended
- .attr({
- role: "textbox",
- "aria-autocomplete": "list",
- "aria-haspopup": "true"
- })
- .bind( "keydown.autocomplete", function( event ) {
- if ( self.options.disabled || self.element.propAttr( "readOnly" ) ) {
+ .attr( "autocomplete", "off" );
+
+ this._on( this.element, {
+ keydown: function( event ) {
+ if ( this.element.prop( "readOnly" ) ) {
+ suppressKeyPress = true;
+ suppressInput = true;
+ suppressKeyPressRepeat = true;
return;
}
suppressKeyPress = false;
+ suppressInput = false;
+ suppressKeyPressRepeat = false;
var keyCode = $.ui.keyCode;
switch( event.keyCode ) {
case keyCode.PAGE_UP:
- self._move( "previousPage", event );
+ suppressKeyPress = true;
+ this._move( "previousPage", event );
break;
case keyCode.PAGE_DOWN:
- self._move( "nextPage", event );
+ suppressKeyPress = true;
+ this._move( "nextPage", event );
break;
case keyCode.UP:
- self._move( "previous", event );
- // prevent moving cursor to beginning of text field in some browsers
- event.preventDefault();
+ suppressKeyPress = true;
+ this._keyEvent( "previous", event );
break;
case keyCode.DOWN:
- self._move( "next", event );
- // prevent moving cursor to end of text field in some browsers
- event.preventDefault();
+ suppressKeyPress = true;
+ this._keyEvent( "next", event );
break;
case keyCode.ENTER:
case keyCode.NUMPAD_ENTER:
// when menu is open and has focus
- if ( self.menu.active ) {
+ if ( this.menu.active ) {
// #6055 - Opera still allows the keypress to occur
// which causes forms to submit
suppressKeyPress = true;
event.preventDefault();
+ this.menu.select( event );
}
- //passthrough - ENTER and TAB both select the current element
+ break;
case keyCode.TAB:
- if ( !self.menu.active ) {
- return;
+ if ( this.menu.active ) {
+ this.menu.select( event );
}
- self.menu.select( event );
break;
case keyCode.ESCAPE:
- self.element.val( self.term );
- self.close( event );
+ if ( this.menu.element.is( ":visible" ) ) {
+ this._value( this.term );
+ this.close( event );
+ // Different browsers have different default behavior for escape
+ // Single press can mean undo or clear
+ // Double press in IE means clear the whole form
+ event.preventDefault();
+ }
break;
default:
- // keypress is triggered before the input value is changed
- clearTimeout( self.searching );
- self.searching = setTimeout(function() {
- // only search if the value has changed
- if ( self.term != self.element.val() ) {
- self.selectedItem = null;
- self.search( null, event );
- }
- }, self.options.delay );
+ suppressKeyPressRepeat = true;
+ // search timeout should be triggered before the input value is changed
+ this._searchTimeout( event );
break;
}
- })
- .bind( "keypress.autocomplete", function( event ) {
+ },
+ keypress: function( event ) {
if ( suppressKeyPress ) {
suppressKeyPress = false;
event.preventDefault();
+ return;
}
- })
- .bind( "focus.autocomplete", function() {
- if ( self.options.disabled ) {
+ if ( suppressKeyPressRepeat ) {
return;
}
- self.selectedItem = null;
- self.previous = self.element.val();
- })
- .bind( "blur.autocomplete", function( event ) {
- if ( self.options.disabled ) {
+ // replicate some key handlers to allow them to repeat in Firefox and Opera
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ this._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ this._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ this._keyEvent( "previous", event );
+ break;
+ case keyCode.DOWN:
+ this._keyEvent( "next", event );
+ break;
+ }
+ },
+ input: function( event ) {
+ if ( suppressInput ) {
+ suppressInput = false;
+ event.preventDefault();
+ return;
+ }
+ this._searchTimeout( event );
+ },
+ focus: function() {
+ this.selectedItem = null;
+ this.previous = this._value();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
return;
}
- clearTimeout( self.searching );
- // clicks on the menu (or a button to trigger a search) will cause a blur event
- self.closing = setTimeout(function() {
- self.close( event );
- self._change( event );
- }, 150 );
- });
+ clearTimeout( this.searching );
+ this.close( event );
+ this._change( event );
+ }
+ });
+
this._initSource();
- this.response = function() {
- return self._response.apply( self, arguments );
- };
- this.menu = $( "<ul></ul>" )
+ this.menu = $( "<ul>" )
.addClass( "ui-autocomplete" )
- .appendTo( $( this.options.appendTo || "body", doc )[0] )
- // prevent the close-on-blur in case of a "slow" click on the menu (long mousedown)
- .mousedown(function( event ) {
+ .appendTo( this.document.find( this.options.appendTo || "body" )[ 0 ] )
+ .menu({
+ // custom key handling for now
+ input: $(),
+ // disable ARIA support, the live region takes care of that
+ role: null
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ .hide()
+ .data( "menu" );
+
+ this._on( this.menu.element, {
+ mousedown: function( event ) {
+ // prevent moving focus out of the text field
+ event.preventDefault();
+
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ this.cancelBlur = true;
+ this._delay(function() {
+ delete this.cancelBlur;
+ });
+
// clicking on the scrollbar causes focus to shift to the body
// but we can't detect a mouseup or a click immediately afterward
// so we have to track the next mousedown and close the menu if
// the user clicks somewhere outside of the autocomplete
- var menuElement = self.menu.element[ 0 ];
+ var menuElement = this.menu.element[ 0 ];
if ( !$( event.target ).closest( ".ui-menu-item" ).length ) {
- setTimeout(function() {
- $( document ).one( 'mousedown', function( event ) {
- if ( event.target !== self.element[ 0 ] &&
- event.target !== menuElement &&
- !$.ui.contains( menuElement, event.target ) ) {
- self.close();
+ this._delay(function() {
+ var that = this;
+ this.document.one( "mousedown", function( event ) {
+ if ( event.target !== that.element[ 0 ] &&
+ event.target !== menuElement &&
+ !$.contains( menuElement, event.target ) ) {
+ that.close();
}
});
- }, 1 );
+ });
}
+ },
+ menufocus: function( event, ui ) {
+ // #7024 - Prevent accidental activation of menu items in Firefox
+ if ( this.isNewMenu ) {
+ this.isNewMenu = false;
+ if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
+ this.menu.blur();
+
+ this.document.one( "mousemove", function() {
+ $( event.target ).trigger( event.originalEvent );
+ });
- // use another timeout to make sure the blur-event-handler on the input was already triggered
- setTimeout(function() {
- clearTimeout( self.closing );
- }, 13);
- })
- .menu({
- focus: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" );
- if ( false !== self._trigger( "focus", event, { item: item } ) ) {
- // use value to match what will end up in the input, if it was a key event
- if ( /^key/.test(event.originalEvent.type) ) {
- self.element.val( item.value );
- }
- }
- },
- selected: function( event, ui ) {
- var item = ui.item.data( "item.autocomplete" ),
- previous = self.previous;
-
- // only trigger when focus was lost (click on menu)
- if ( self.element[0] !== doc.activeElement ) {
- self.element.focus();
- self.previous = previous;
- // #6109 - IE triggers two focus events and the second
- // is asynchronous, so we need to reset the previous
- // term synchronously and asynchronously :-(
- setTimeout(function() {
- self.previous = previous;
- self.selectedItem = item;
- }, 1);
+ return;
}
+ }
- if ( false !== self._trigger( "select", event, { item: item } ) ) {
- self.element.val( item.value );
+ // back compat for _renderItem using item.autocomplete, via #7810
+ // TODO remove the fallback, see #8156
+ var item = ui.item.data( "ui-autocomplete-item" ) || ui.item.data( "item.autocomplete" );
+ if ( false !== this._trigger( "focus", event, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
+ this._value( item.value );
}
- // reset the term after the select event
- // this allows custom select handling to work properly
- self.term = self.element.val();
+ } else {
+ // Normally the input is populated with the item's value as the
+ // menu is navigated, causing screen readers to notice a change and
+ // announce the item. Since the focus event was canceled, this doesn't
+ // happen, so we update the live region so that screen readers can
+ // still notice the change and announce it.
+ this.liveRegion.text( item.value );
+ }
+ },
+ menuselect: function( event, ui ) {
+ // back compat for _renderItem using item.autocomplete, via #7810
+ // TODO remove the fallback, see #8156
+ var item = ui.item.data( "ui-autocomplete-item" ) || ui.item.data( "item.autocomplete" ),
+ previous = this.previous;
+
+ // only trigger when focus was lost (click on menu)
+ if ( this.element[0] !== this.document[0].activeElement ) {
+ this.element.focus();
+ this.previous = previous;
+ // #6109 - IE triggers two focus events and the second
+ // is asynchronous, so we need to reset the previous
+ // term synchronously and asynchronously :-(
+ this._delay(function() {
+ this.previous = previous;
+ this.selectedItem = item;
+ });
+ }
- self.close( event );
- self.selectedItem = item;
- },
- blur: function( event, ui ) {
- // don't set the value of the text field if it's already correct
- // this prevents moving the cursor unnecessarily
- if ( self.menu.element.is(":visible") &&
- ( self.element.val() !== self.term ) ) {
- self.element.val( self.term );
- }
+ if ( false !== this._trigger( "select", event, { item: item } ) ) {
+ this._value( item.value );
}
+ // reset the term after the select event
+ // this allows custom select handling to work properly
+ this.term = this._value();
+
+ this.close( event );
+ this.selectedItem = item;
+ }
+ });
+
+ this.liveRegion = $( "<span>", {
+ role: "status",
+ "aria-live": "polite"
})
- .zIndex( this.element.zIndex() + 1 )
- // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
- .css({ top: 0, left: 0 })
- .hide()
- .data( "menu" );
+ .addClass( "ui-helper-hidden-accessible" )
+ .insertAfter( this.element );
+
if ( $.fn.bgiframe ) {
- this.menu.element.bgiframe();
+ this.menu.element.bgiframe();
}
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ });
},
- destroy: function() {
+ _destroy: function() {
+ clearTimeout( this.searching );
this.element
.removeClass( "ui-autocomplete-input" )
- .removeAttr( "autocomplete" )
- .removeAttr( "role" )
- .removeAttr( "aria-autocomplete" )
- .removeAttr( "aria-haspopup" );
+ .removeAttr( "autocomplete" );
this.menu.element.remove();
- $.Widget.prototype.destroy.call( this );
+ this.liveRegion.remove();
},
_setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
if ( key === "source" ) {
this._initSource();
}
if ( key === "appendTo" ) {
- this.menu.element.appendTo( $( value || "body", this.element[0].ownerDocument )[0] )
+ this.menu.element.appendTo( this.document.find( value || "body" )[0] );
}
if ( key === "disabled" && value && this.xhr ) {
this.xhr.abort();
}
},
+ _isMultiLine: function() {
+ // Textareas are always multi-line
+ if ( this.element.is( "textarea" ) ) {
+ return true;
+ }
+ // Inputs are always single-line, even if inside a contentEditable element
+ // IE also treats inputs as contentEditable
+ if ( this.element.is( "input" ) ) {
+ return false;
+ }
+ // All other element types are determined by whether or not they're contentEditable
+ return this.element.prop( "isContentEditable" );
+ },
+
_initSource: function() {
- var self = this,
- array,
- url;
+ var array, url,
+ that = this;
if ( $.isArray(this.options.source) ) {
array = this.options.source;
this.source = function( request, response ) {
- response( $.ui.autocomplete.filter(array, request.term) );
+ response( $.ui.autocomplete.filter( array, request.term ) );
};
} else if ( typeof this.options.source === "string" ) {
url = this.options.source;
this.source = function( request, response ) {
- if ( self.xhr ) {
- self.xhr.abort();
+ if ( that.xhr ) {
+ that.xhr.abort();
}
- self.xhr = $.ajax({
+ that.xhr = $.ajax({
url: url,
data: request,
dataType: "json",
- autocompleteRequest: ++requestIndex,
- success: function( data, status ) {
- if ( this.autocompleteRequest === requestIndex ) {
- response( data );
- }
+ success: function( data ) {
+ response( data );
},
error: function() {
- if ( this.autocompleteRequest === requestIndex ) {
- response( [] );
- }
+ response( [] );
}
});
};
@@ -6531,17 +6587,27 @@ $.widget( "ui.autocomplete", {
}
},
+ _searchTimeout: function( event ) {
+ clearTimeout( this.searching );
+ this.searching = this._delay(function() {
+ // only search if the value has changed
+ if ( this.term !== this._value() ) {
+ this.selectedItem = null;
+ this.search( null, event );
+ }
+ }, this.options.delay );
+ },
+
search: function( value, event ) {
- value = value != null ? value : this.element.val();
+ value = value != null ? value : this._value();
// always save the actual value, not the one passed as an argument
- this.term = this.element.val();
+ this.term = this._value();
if ( value.length < this.options.minLength ) {
return this.close( event );
}
- clearTimeout( this.closing );
if ( this._trigger( "search", event ) === false ) {
return;
}
@@ -6552,35 +6618,57 @@ $.widget( "ui.autocomplete", {
_search: function( value ) {
this.pending++;
this.element.addClass( "ui-autocomplete-loading" );
+ this.cancelSearch = false;
- this.source( { term: value }, this.response );
+ this.source( { term: value }, this._response() );
},
- _response: function( content ) {
- if ( !this.options.disabled && content && content.length ) {
+ _response: function() {
+ var that = this,
+ index = ++requestIndex;
+
+ return function( content ) {
+ if ( index === requestIndex ) {
+ that.__response( content );
+ }
+
+ that.pending--;
+ if ( !that.pending ) {
+ that.element.removeClass( "ui-autocomplete-loading" );
+ }
+ };
+ },
+
+ __response: function( content ) {
+ if ( content ) {
content = this._normalize( content );
+ }
+ this._trigger( "response", null, { content: content } );
+ if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
this._suggest( content );
this._trigger( "open" );
} else {
- this.close();
- }
- this.pending--;
- if ( !this.pending ) {
- this.element.removeClass( "ui-autocomplete-loading" );
+ // use ._close() instead of .close() so we don't cancel future searches
+ this._close();
}
},
close: function( event ) {
- clearTimeout( this.closing );
- if ( this.menu.element.is(":visible") ) {
+ this.cancelSearch = true;
+ this._close( event );
+ },
+
+ _close: function( event ) {
+ if ( this.menu.element.is( ":visible" ) ) {
this.menu.element.hide();
- this.menu.deactivate();
+ this.menu.blur();
+ this.isNewMenu = true;
this._trigger( "close", event );
}
},
-
+
_change: function( event ) {
- if ( this.previous !== this.element.val() ) {
+ if ( this.previous !== this._value() ) {
this._trigger( "change", event, { item: this.selectedItem } );
}
},
@@ -6590,7 +6678,7 @@ $.widget( "ui.autocomplete", {
if ( items.length && items[0].label && items[0].value ) {
return items;
}
- return $.map( items, function(item) {
+ return $.map( items, function( item ) {
if ( typeof item === "string" ) {
return {
label: item,
@@ -6609,8 +6697,6 @@ $.widget( "ui.autocomplete", {
.empty()
.zIndex( this.element.zIndex() + 1 );
this._renderMenu( ul, items );
- // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
- this.menu.deactivate();
this.menu.refresh();
// size and position menu
@@ -6621,41 +6707,46 @@ $.widget( "ui.autocomplete", {
}, this.options.position ));
if ( this.options.autoFocus ) {
- this.menu.next( new $.Event("mouseover") );
+ this.menu.next();
}
},
_resizeMenu: function() {
var ul = this.menu.element;
ul.outerWidth( Math.max(
- ul.width( "" ).outerWidth(),
+ // Firefox wraps long text (possibly a rounding bug)
+ // so we add 1px to avoid the wrapping (#7513)
+ ul.width( "" ).outerWidth() + 1,
this.element.outerWidth()
) );
},
_renderMenu: function( ul, items ) {
- var self = this;
+ var that = this;
$.each( items, function( index, item ) {
- self._renderItem( ul, item );
+ that._renderItemData( ul, item );
});
},
- _renderItem: function( ul, item) {
- return $( "<li></li>" )
- .data( "item.autocomplete", item )
- .append( $( "<a></a>" ).text( item.label ) )
+ _renderItemData: function( ul, item ) {
+ return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
+ },
+
+ _renderItem: function( ul, item ) {
+ return $( "<li>" )
+ .append( $( "<a>" ).text( item.label ) )
.appendTo( ul );
},
_move: function( direction, event ) {
- if ( !this.menu.element.is(":visible") ) {
+ if ( !this.menu.element.is( ":visible" ) ) {
this.search( null, event );
return;
}
- if ( this.menu.first() && /^previous/.test(direction) ||
- this.menu.last() && /^next/.test(direction) ) {
- this.element.val( this.term );
- this.menu.deactivate();
+ if ( this.menu.isFirstItem() && /^previous/.test( direction ) ||
+ this.menu.isLastItem() && /^next/.test( direction ) ) {
+ this._value( this.term );
+ this.menu.blur();
return;
}
this.menu[ direction ]( event );
@@ -6663,12 +6754,25 @@ $.widget( "ui.autocomplete", {
widget: function() {
return this.menu.element;
+ },
+
+ _value: function() {
+ return this.valueMethod.apply( this.element, arguments );
+ },
+
+ _keyEvent: function( keyEvent, event ) {
+ if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+ this._move( keyEvent, event );
+
+ // prevents moving cursor to beginning/end of the text field in some browsers
+ event.preventDefault();
+ }
}
});
$.extend( $.ui.autocomplete, {
escapeRegex: function( value ) {
- return value.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
+ return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&");
},
filter: function(array, term) {
var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
@@ -6678,204 +6782,39 @@ $.extend( $.ui.autocomplete, {
}
});
-}( jQuery ));
-
-/*
- * jQuery UI Menu (not officially released)
- *
- * This widget isn't yet finished and the API is subject to change. We plan to finish
- * it for the next release. You're welcome to give it a try anyway and give us feedback,
- * as long as you're okay with migrating your code later on. We can help with that, too.
- *
- * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Menu
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
-(function($) {
-$.widget("ui.menu", {
- _create: function() {
- var self = this;
- this.element
- .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
- .attr({
- role: "listbox",
- "aria-activedescendant": "ui-active-menuitem"
- })
- .click(function( event ) {
- if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
- return;
- }
- // temporary
- event.preventDefault();
- self.select( event );
- });
- this.refresh();
- },
-
- refresh: function() {
- var self = this;
-
- // don't refresh list items that are already adapted
- var items = this.element.children("li:not(.ui-menu-item):has(a)")
- .addClass("ui-menu-item")
- .attr("role", "menuitem");
-
- items.children("a")
- .addClass("ui-corner-all")
- .attr("tabindex", -1)
- // mouseenter doesn't work with event delegation
- .mouseenter(function( event ) {
- self.activate( event, $(this).parent() );
- })
- .mouseleave(function() {
- self.deactivate();
- });
- },
-
- activate: function( event, item ) {
- this.deactivate();
- if (this.hasScroll()) {
- var offset = item.offset().top - this.element.offset().top,
- scroll = this.element.scrollTop(),
- elementHeight = this.element.height();
- if (offset < 0) {
- this.element.scrollTop( scroll + offset);
- } else if (offset >= elementHeight) {
- this.element.scrollTop( scroll + offset - elementHeight + item.height());
+// live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+$.widget( "ui.autocomplete", $.ui.autocomplete, {
+ options: {
+ messages: {
+ noResults: "No search results.",
+ results: function( amount ) {
+ return amount + ( amount > 1 ? " results are" : " result is" ) +
+ " available, use up and down arrow keys to navigate.";
}
}
- this.active = item.eq(0)
- .children("a")
- .addClass("ui-state-hover")
- .attr("id", "ui-active-menuitem")
- .end();
- this._trigger("focus", event, { item: item });
- },
-
- deactivate: function() {
- if (!this.active) { return; }
-
- this.active.children("a")
- .removeClass("ui-state-hover")
- .removeAttr("id");
- this._trigger("blur");
- this.active = null;
- },
-
- next: function(event) {
- this.move("next", ".ui-menu-item:first", event);
- },
-
- previous: function(event) {
- this.move("prev", ".ui-menu-item:last", event);
- },
-
- first: function() {
- return this.active && !this.active.prevAll(".ui-menu-item").length;
- },
-
- last: function() {
- return this.active && !this.active.nextAll(".ui-menu-item").length;
},
- move: function(direction, edge, event) {
- if (!this.active) {
- this.activate(event, this.element.children(edge));
+ __response: function( content ) {
+ var message;
+ this._superApply( arguments );
+ if ( this.options.disabled || this.cancelSearch ) {
return;
}
- var next = this.active[direction + "All"](".ui-menu-item").eq(0);
- if (next.length) {
- this.activate(event, next);
- } else {
- this.activate(event, this.element.children(edge));
- }
- },
-
- // TODO merge with previousPage
- nextPage: function(event) {
- if (this.hasScroll()) {
- // TODO merge with no-scroll-else
- if (!this.active || this.last()) {
- this.activate(event, this.element.children(".ui-menu-item:first"));
- return;
- }
- var base = this.active.offset().top,
- height = this.element.height(),
- result = this.element.children(".ui-menu-item").filter(function() {
- var close = $(this).offset().top - base - height + $(this).height();
- // TODO improve approximation
- return close < 10 && close > -10;
- });
-
- // TODO try to catch this earlier when scrollTop indicates the last page anyway
- if (!result.length) {
- result = this.element.children(".ui-menu-item:last");
- }
- this.activate(event, result);
- } else {
- this.activate(event, this.element.children(".ui-menu-item")
- .filter(!this.active || this.last() ? ":first" : ":last"));
- }
- },
-
- // TODO merge with nextPage
- previousPage: function(event) {
- if (this.hasScroll()) {
- // TODO merge with no-scroll-else
- if (!this.active || this.first()) {
- this.activate(event, this.element.children(".ui-menu-item:last"));
- return;
- }
-
- var base = this.active.offset().top,
- height = this.element.height();
- result = this.element.children(".ui-menu-item").filter(function() {
- var close = $(this).offset().top - base + height - $(this).height();
- // TODO improve approximation
- return close < 10 && close > -10;
- });
-
- // TODO try to catch this earlier when scrollTop indicates the last page anyway
- if (!result.length) {
- result = this.element.children(".ui-menu-item:first");
- }
- this.activate(event, result);
+ if ( content && content.length ) {
+ message = this.options.messages.results( content.length );
} else {
- this.activate(event, this.element.children(".ui-menu-item")
- .filter(!this.active || this.first() ? ":last" : ":first"));
+ message = this.options.messages.noResults;
}
- },
-
- hasScroll: function() {
- return this.element.height() < this.element[ $.fn.prop ? "prop" : "attr" ]("scrollHeight");
- },
-
- select: function( event ) {
- this._trigger("selected", event, { item: this.active });
+ this.liveRegion.text( message );
}
});
-}(jQuery));
-/*
- * jQuery UI Button 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Button
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
+
+}( jQuery ));
+
(function( $, undefined ) {
var lastActive, startXPos, startYPos, clickDragged,
@@ -6906,6 +6845,8 @@ var lastActive, startXPos, startYPos, clickDragged,
};
$.widget( "ui.button", {
+ version: "1.9.2",
+ defaultElement: "<button>",
options: {
disabled: null,
text: true,
@@ -6917,49 +6858,48 @@ $.widget( "ui.button", {
},
_create: function() {
this.element.closest( "form" )
- .unbind( "reset.button" )
- .bind( "reset.button", formResetHandler );
+ .unbind( "reset" + this.eventNamespace )
+ .bind( "reset" + this.eventNamespace, formResetHandler );
if ( typeof this.options.disabled !== "boolean" ) {
- this.options.disabled = this.element.propAttr( "disabled" );
+ this.options.disabled = !!this.element.prop( "disabled" );
+ } else {
+ this.element.prop( "disabled", this.options.disabled );
}
this._determineButtonType();
this.hasTitle = !!this.buttonElement.attr( "title" );
- var self = this,
+ var that = this,
options = this.options,
toggleButton = this.type === "checkbox" || this.type === "radio",
- hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ activeClass = !toggleButton ? "ui-state-active" : "",
focusClass = "ui-state-focus";
if ( options.label === null ) {
- options.label = this.buttonElement.html();
+ options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html());
}
- if ( this.element.is( ":disabled" ) ) {
- options.disabled = true;
- }
+ this._hoverable( this.buttonElement );
this.buttonElement
.addClass( baseClasses )
.attr( "role", "button" )
- .bind( "mouseenter.button", function() {
+ .bind( "mouseenter" + this.eventNamespace, function() {
if ( options.disabled ) {
return;
}
- $( this ).addClass( "ui-state-hover" );
if ( this === lastActive ) {
$( this ).addClass( "ui-state-active" );
}
})
- .bind( "mouseleave.button", function() {
+ .bind( "mouseleave" + this.eventNamespace, function() {
if ( options.disabled ) {
return;
}
- $( this ).removeClass( hoverClass );
+ $( this ).removeClass( activeClass );
})
- .bind( "click.button", function( event ) {
+ .bind( "click" + this.eventNamespace, function( event ) {
if ( options.disabled ) {
event.preventDefault();
event.stopImmediatePropagation();
@@ -6967,26 +6907,26 @@ $.widget( "ui.button", {
});
this.element
- .bind( "focus.button", function() {
+ .bind( "focus" + this.eventNamespace, function() {
// no need to check disabled, focus won't be triggered anyway
- self.buttonElement.addClass( focusClass );
+ that.buttonElement.addClass( focusClass );
})
- .bind( "blur.button", function() {
- self.buttonElement.removeClass( focusClass );
+ .bind( "blur" + this.eventNamespace, function() {
+ that.buttonElement.removeClass( focusClass );
});
if ( toggleButton ) {
- this.element.bind( "change.button", function() {
+ this.element.bind( "change" + this.eventNamespace, function() {
if ( clickDragged ) {
return;
}
- self.refresh();
+ that.refresh();
});
// if mouse moves between mousedown and mouseup (drag) set clickDragged flag
// prevents issue where button state changes but checkbox/radio checked state
// does not in Firefox (see ticket #6970)
this.buttonElement
- .bind( "mousedown.button", function( event ) {
+ .bind( "mousedown" + this.eventNamespace, function( event ) {
if ( options.disabled ) {
return;
}
@@ -6994,7 +6934,7 @@ $.widget( "ui.button", {
startXPos = event.pageX;
startYPos = event.pageY;
})
- .bind( "mouseup.button", function( event ) {
+ .bind( "mouseup" + this.eventNamespace, function( event ) {
if ( options.disabled ) {
return;
}
@@ -7005,22 +6945,22 @@ $.widget( "ui.button", {
}
if ( this.type === "checkbox" ) {
- this.buttonElement.bind( "click.button", function() {
+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
if ( options.disabled || clickDragged ) {
return false;
}
$( this ).toggleClass( "ui-state-active" );
- self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ that.buttonElement.attr( "aria-pressed", that.element[0].checked );
});
} else if ( this.type === "radio" ) {
- this.buttonElement.bind( "click.button", function() {
+ this.buttonElement.bind( "click" + this.eventNamespace, function() {
if ( options.disabled || clickDragged ) {
return false;
}
$( this ).addClass( "ui-state-active" );
- self.buttonElement.attr( "aria-pressed", "true" );
+ that.buttonElement.attr( "aria-pressed", "true" );
- var radio = self.element[ 0 ];
+ var radio = that.element[ 0 ];
radioGroup( radio )
.not( radio )
.map(function() {
@@ -7031,31 +6971,31 @@ $.widget( "ui.button", {
});
} else {
this.buttonElement
- .bind( "mousedown.button", function() {
+ .bind( "mousedown" + this.eventNamespace, function() {
if ( options.disabled ) {
return false;
}
$( this ).addClass( "ui-state-active" );
lastActive = this;
- $( document ).one( "mouseup", function() {
+ that.document.one( "mouseup", function() {
lastActive = null;
});
})
- .bind( "mouseup.button", function() {
+ .bind( "mouseup" + this.eventNamespace, function() {
if ( options.disabled ) {
return false;
}
$( this ).removeClass( "ui-state-active" );
})
- .bind( "keydown.button", function(event) {
+ .bind( "keydown" + this.eventNamespace, function(event) {
if ( options.disabled ) {
return false;
}
- if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ if ( event.keyCode === $.ui.keyCode.SPACE || event.keyCode === $.ui.keyCode.ENTER ) {
$( this ).addClass( "ui-state-active" );
}
})
- .bind( "keyup.button", function() {
+ .bind( "keyup" + this.eventNamespace, function() {
$( this ).removeClass( "ui-state-active" );
});
@@ -7077,10 +7017,11 @@ $.widget( "ui.button", {
},
_determineButtonType: function() {
+ var ancestor, labelSelector, checked;
- if ( this.element.is(":checkbox") ) {
+ if ( this.element.is("[type=checkbox]") ) {
this.type = "checkbox";
- } else if ( this.element.is(":radio") ) {
+ } else if ( this.element.is("[type=radio]") ) {
this.type = "radio";
} else if ( this.element.is("input") ) {
this.type = "input";
@@ -7091,8 +7032,8 @@ $.widget( "ui.button", {
if ( this.type === "checkbox" || this.type === "radio" ) {
// we don't search against the document in case the element
// is disconnected from the DOM
- var ancestor = this.element.parents().filter(":last"),
- labelSelector = "label[for='" + this.element.attr("id") + "']";
+ ancestor = this.element.parents().last();
+ labelSelector = "label[for='" + this.element.attr("id") + "']";
this.buttonElement = ancestor.find( labelSelector );
if ( !this.buttonElement.length ) {
ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings();
@@ -7103,11 +7044,11 @@ $.widget( "ui.button", {
}
this.element.addClass( "ui-helper-hidden-accessible" );
- var checked = this.element.is( ":checked" );
+ checked = this.element.is( ":checked" );
if ( checked ) {
this.buttonElement.addClass( "ui-state-active" );
}
- this.buttonElement.attr( "aria-pressed", checked );
+ this.buttonElement.prop( "aria-pressed", checked );
} else {
this.buttonElement = this.element;
}
@@ -7117,7 +7058,7 @@ $.widget( "ui.button", {
return this.buttonElement;
},
- destroy: function() {
+ _destroy: function() {
this.element
.removeClass( "ui-helper-hidden-accessible" );
this.buttonElement
@@ -7129,17 +7070,15 @@ $.widget( "ui.button", {
if ( !this.hasTitle ) {
this.buttonElement.removeAttr( "title" );
}
-
- $.Widget.prototype.destroy.call( this );
},
_setOption: function( key, value ) {
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
if ( key === "disabled" ) {
if ( value ) {
- this.element.propAttr( "disabled", true );
+ this.element.prop( "disabled", true );
} else {
- this.element.propAttr( "disabled", false );
+ this.element.prop( "disabled", false );
}
return;
}
@@ -7147,7 +7086,9 @@ $.widget( "ui.button", {
},
refresh: function() {
- var isDisabled = this.element.is( ":disabled" );
+ //See #8237 & #8828
+ var isDisabled = this.element.is( "input, button" ) ? this.element.is( ":disabled" ) : this.element.hasClass( "ui-button-disabled" );
+
if ( isDisabled !== this.options.disabled ) {
this._setOption( "disabled", isDisabled );
}
@@ -7184,14 +7125,14 @@ $.widget( "ui.button", {
return;
}
var buttonElement = this.buttonElement.removeClass( typeClasses ),
- buttonText = $( "<span></span>" )
+ buttonText = $( "<span></span>", this.document[0] )
.addClass( "ui-button-text" )
.html( this.options.label )
.appendTo( buttonElement.empty() )
.text(),
icons = this.options.icons,
multipleIcons = icons.primary && icons.secondary,
- buttonClasses = [];
+ buttonClasses = [];
if ( icons.primary || icons.secondary ) {
if ( this.options.text ) {
@@ -7210,7 +7151,7 @@ $.widget( "ui.button", {
buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" );
if ( !this.hasTitle ) {
- buttonElement.attr( "title", buttonText );
+ buttonElement.attr( "title", $.trim( buttonText ) );
}
}
} else {
@@ -7221,14 +7162,15 @@ $.widget( "ui.button", {
});
$.widget( "ui.buttonset", {
+ version: "1.9.2",
options: {
- items: ":button, :submit, :reset, :checkbox, :radio, a, :data(button)"
+ items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(button)"
},
_create: function() {
this.element.addClass( "ui-buttonset" );
},
-
+
_init: function() {
this.refresh();
},
@@ -7238,12 +7180,12 @@ $.widget( "ui.buttonset", {
this.buttons.button( "option", key, value );
}
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
},
-
+
refresh: function() {
- var ltr = this.element.css( "direction" ) === "ltr";
-
+ var rtl = this.element.css( "direction" ) === "rtl";
+
this.buttons = this.element.find( this.options.items )
.filter( ":ui-button" )
.button( "refresh" )
@@ -7256,15 +7198,15 @@ $.widget( "ui.buttonset", {
})
.removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
.filter( ":first" )
- .addClass( ltr ? "ui-corner-left" : "ui-corner-right" )
+ .addClass( rtl ? "ui-corner-right" : "ui-corner-left" )
.end()
.filter( ":last" )
- .addClass( ltr ? "ui-corner-right" : "ui-corner-left" )
+ .addClass( rtl ? "ui-corner-left" : "ui-corner-right" )
.end()
.end();
},
- destroy: function() {
+ _destroy: function() {
this.element.removeClass( "ui-buttonset" );
this.buttons
.map(function() {
@@ -7273,27 +7215,14 @@ $.widget( "ui.buttonset", {
.removeClass( "ui-corner-left ui-corner-right" )
.end()
.button( "destroy" );
-
- $.Widget.prototype.destroy.call( this );
}
});
}( jQuery ) );
-/*
- * jQuery UI Datepicker 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- * jquery.ui.core.js
- */
+
(function( $, undefined ) {
-$.extend($.ui, { datepicker: { version: "1.8.16" } });
+$.extend($.ui, { datepicker: { version: "1.9.2" } });
var PROP_NAME = 'datepicker';
var dpuuid = new Date().getTime();
@@ -7396,7 +7325,7 @@ function Datepicker() {
$.extend(Datepicker.prototype, {
/* Class name added to elements to indicate already configured with a date picker. */
markerClassName: 'hasDatepicker',
-
+
//Keep track of the maximum number of rows displayed (see #7043)
maxRows: 4,
@@ -7405,7 +7334,7 @@ $.extend(Datepicker.prototype, {
if (this.debug)
console.log.apply('', arguments);
},
-
+
// TODO rename to "widget" when switching to widget factory
_widgetDatepicker: function() {
return this.dpDiv;
@@ -7514,7 +7443,10 @@ $.extend(Datepicker.prototype, {
inst.trigger.click(function() {
if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
$.datepicker._hideDatepicker();
- else
+ else if ($.datepicker._datepickerShowing && $.datepicker._lastInput != input[0]) {
+ $.datepicker._hideDatepicker();
+ $.datepicker._showDatepicker(input[0]);
+ } else
$.datepicker._showDatepicker(input[0]);
return false;
});
@@ -7586,7 +7518,7 @@ $.extend(Datepicker.prototype, {
this.uuid += 1;
var id = 'dp' + this.uuid;
this._dialogInput = $('<input type="text" id="' + id +
- '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ '" style="position: absolute; top: -100px; width: 0px;"/>');
this._dialogInput.keydown(this._doKeyDown);
$('body').append(this._dialogInput);
inst = this._dialogInst = this._newInst(this._dialogInput, false);
@@ -7660,7 +7592,7 @@ $.extend(Datepicker.prototype, {
var inline = $target.children('.' + this._inlineClass);
inline.children().removeClass('ui-state-disabled');
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
- removeAttr("disabled");
+ prop("disabled", false);
}
this._disabledInputs = $.map(this._disabledInputs,
function(value) { return (value == target ? null : value); }); // delete entry
@@ -7685,7 +7617,7 @@ $.extend(Datepicker.prototype, {
var inline = $target.children('.' + this._inlineClass);
inline.children().addClass('ui-state-disabled');
inline.find("select.ui-datepicker-month, select.ui-datepicker-year").
- attr("disabled", "disabled");
+ prop("disabled", true);
}
this._disabledInputs = $.map(this._disabledInputs,
function(value) { return (value == target ? null : value); }); // delete entry
@@ -7808,7 +7740,7 @@ $.extend(Datepicker.prototype, {
case 9: $.datepicker._hideDatepicker();
handled = false;
break; // hide on tab out
- case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass + ':not(.' +
$.datepicker._currentClass + ')', inst.dpDiv);
if (sel[0])
$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
@@ -7898,15 +7830,15 @@ $.extend(Datepicker.prototype, {
$.datepicker._updateDatepicker(inst);
}
}
- catch (event) {
- $.datepicker.log(event);
+ catch (err) {
+ $.datepicker.log(err);
}
}
return true;
},
/* Pop-up the date picker for a given input field.
- If false returned from beforeShow event handler do not show.
+ If false returned from beforeShow event handler do not show.
@param input element - the input field attached to the date picker or
event - if triggered by focus */
_showDatepicker: function(input) {
@@ -7917,15 +7849,15 @@ $.extend(Datepicker.prototype, {
return;
var inst = $.datepicker._getInst(input);
if ($.datepicker._curInst && $.datepicker._curInst != inst) {
- if ( $.datepicker._datepickerShowing ) {
- $.datepicker._triggerOnClose($.datepicker._curInst);
- }
$.datepicker._curInst.dpDiv.stop(true, true);
+ if ( inst && $.datepicker._datepickerShowing ) {
+ $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] );
+ }
}
var beforeShow = $.datepicker._get(inst, 'beforeShow');
var beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {};
if(beforeShowSettings === false){
- //false
+ //false
return;
}
extendRemove(inst.settings, beforeShowSettings);
@@ -7943,10 +7875,6 @@ $.extend(Datepicker.prototype, {
isFixed |= $(this).css('position') == 'fixed';
return !isFixed;
});
- if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
- $.datepicker._pos[0] -= document.documentElement.scrollLeft;
- $.datepicker._pos[1] -= document.documentElement.scrollTop;
- }
var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
$.datepicker._pos = null;
//to avoid flashes on Firefox
@@ -7973,7 +7901,9 @@ $.extend(Datepicker.prototype, {
};
inst.dpDiv.zIndex($(input).zIndex()+1);
$.datepicker._datepickerShowing = true;
- if ($.effects && $.effects[showAnim])
+
+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+ if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) )
inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
else
inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
@@ -7987,11 +7917,11 @@ $.extend(Datepicker.prototype, {
/* Generate the date picker content. */
_updateDatepicker: function(inst) {
- var self = this;
- self.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+ this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
var borders = $.datepicker._getBorders(inst.dpDiv);
instActive = inst; // for delegate hover events
inst.dpDiv.empty().append(this._generateHTML(inst));
+ this._attachHandlers(inst);
var cover = inst.dpDiv.find('iframe.ui-datepicker-cover'); // IE6- only
if( !!cover.length ){ //avoid call to outerXXXX() when not in IE6
cover.css({left: -borders[0], top: -borders[1], width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
@@ -8012,7 +7942,7 @@ $.extend(Datepicker.prototype, {
// this breaks the change event in IE
inst.input.is(':visible') && !inst.input.is(':disabled') && inst.input[0] != document.activeElement)
inst.input.focus();
- // deffered render of the years select (to avoid flashes on Firefox)
+ // deffered render of the years select (to avoid flashes on Firefox)
if( inst.yearshtml ){
var origyearshtml = inst.yearshtml;
setTimeout(function(){
@@ -8042,8 +7972,8 @@ $.extend(Datepicker.prototype, {
var dpHeight = inst.dpDiv.outerHeight();
var inputWidth = inst.input ? inst.input.outerWidth() : 0;
var inputHeight = inst.input ? inst.input.outerHeight() : 0;
- var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
- var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+ var viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft());
+ var viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop());
offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
@@ -8062,19 +7992,11 @@ $.extend(Datepicker.prototype, {
_findPos: function(obj) {
var inst = this._getInst(obj);
var isRTL = this._get(inst, 'isRTL');
- while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
- obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
- }
- var position = $(obj).offset();
- return [position.left, position.top];
- },
-
- /* Trigger custom callback of onClose. */
- _triggerOnClose: function(inst) {
- var onClose = this._get(inst, 'onClose');
- if (onClose)
- onClose.apply((inst.input ? inst.input[0] : null),
- [(inst.input ? inst.input.val() : ''), inst]);
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1 || $.expr.filters.hidden(obj))) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
},
/* Hide the date picker from view.
@@ -8088,17 +8010,21 @@ $.extend(Datepicker.prototype, {
var duration = this._get(inst, 'duration');
var postProcess = function() {
$.datepicker._tidyDialog(inst);
- this._curInst = null;
};
- if ($.effects && $.effects[showAnim])
+
+ // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+ if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) )
inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
else
inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
(showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
if (!showAnim)
postProcess();
- $.datepicker._triggerOnClose(inst);
this._datepickerShowing = false;
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]);
this._lastInput = null;
if (this._inDialog) {
this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
@@ -8120,12 +8046,16 @@ $.extend(Datepicker.prototype, {
_checkExternalClick: function(event) {
if (!$.datepicker._curInst)
return;
- var $target = $(event.target);
- if ($target[0].id != $.datepicker._mainDivId &&
+
+ var $target = $(event.target),
+ inst = $.datepicker._getInst($target[0]);
+
+ if ( ( ( $target[0].id != $.datepicker._mainDivId &&
$target.parents('#' + $.datepicker._mainDivId).length == 0 &&
!$target.hasClass($.datepicker.markerClassName) &&
- !$target.hasClass($.datepicker._triggerClass) &&
- $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ !$target.closest("." + $.datepicker._triggerClass).length &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) ||
+ ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst != inst ) )
$.datepicker._hideDatepicker();
},
@@ -8375,7 +8305,10 @@ $.extend(Datepicker.prototype, {
}
}
if (iValue < value.length){
- throw "Extra/unparsed characters found in date: " + value.substring(iValue);
+ var extra = value.substr(iValue);
+ if (!/^\s+/.test(extra)) {
+ throw "Extra/unparsed characters found in date: " + extra;
+ }
}
if (year == -1)
year = new Date().getFullYear();
@@ -8682,6 +8615,43 @@ $.extend(Datepicker.prototype, {
return startDate;
},
+ /* Attach the onxxx handlers. These are declared statically so
+ * they work with static code transformers like Caja.
+ */
+ _attachHandlers: function(inst) {
+ var stepMonths = this._get(inst, 'stepMonths');
+ var id = '#' + inst.id.replace( /\\\\/g, "\\" );
+ inst.dpDiv.find('[data-handler]').map(function () {
+ var handler = {
+ prev: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, -stepMonths, 'M');
+ },
+ next: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._adjustDate(id, +stepMonths, 'M');
+ },
+ hide: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._hideDatepicker();
+ },
+ today: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._gotoToday(id);
+ },
+ selectDay: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectDay(id, +this.getAttribute('data-month'), +this.getAttribute('data-year'), this);
+ return false;
+ },
+ selectMonth: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'M');
+ return false;
+ },
+ selectYear: function () {
+ window['DP_jQuery_' + dpuuid].datepicker._selectMonthYear(id, this, 'Y');
+ return false;
+ }
+ };
+ $(this).bind(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')]);
+ });
+ },
+
/* Generate the HTML for the current state of the date picker. */
_generateHTML: function(inst) {
var today = new Date();
@@ -8724,8 +8694,7 @@ $.extend(Datepicker.prototype, {
this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
this._getFormatConfig(inst)));
var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ '<a class="ui-datepicker-prev ui-corner-all" data-handler="prev" data-event="click"' +
' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
var nextText = this._get(inst, 'nextText');
@@ -8733,19 +8702,17 @@ $.extend(Datepicker.prototype, {
this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
this._getFormatConfig(inst)));
var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
- '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ '<a class="ui-datepicker-next ui-corner-all" data-handler="next" data-event="click"' +
' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
var currentText = this._get(inst, 'currentText');
var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
currentText = (!navigationAsDateFormat ? currentText :
this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
- var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" data-handler="hide" data-event="click">' +
+ this._get(inst, 'closeText') + '</button>' : '');
var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
- (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
- '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" data-handler="today" data-event="click"' +
'>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
var firstDay = parseInt(this._get(inst, 'firstDay'),10);
firstDay = (isNaN(firstDay) ? 0 : firstDay);
@@ -8824,8 +8791,7 @@ $.extend(Datepicker.prototype, {
(printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
(printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
- (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
- inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (unselectable ? '' : ' data-handler="selectDay" data-event="click" data-month="' + printDate.getMonth() + '" data-year="' + printDate.getFullYear() + '"') + '>' + // actions
(otherMonth && !showOtherMonths ? '&#xa0;' : // display for other months
(unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
(printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
@@ -8842,13 +8808,13 @@ $.extend(Datepicker.prototype, {
drawMonth = 0;
drawYear++;
}
- calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
group += calender;
}
html += group;
}
- html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ html += buttonPanel + ($.ui.ie6 && !inst.inline ?
'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
inst._keyEvent = false;
return html;
@@ -8868,9 +8834,7 @@ $.extend(Datepicker.prototype, {
else {
var inMinYear = (minDate && minDate.getFullYear() == drawYear);
var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
- monthHtml += '<select class="ui-datepicker-month" ' +
- 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
- '>';
+ monthHtml += '<select class="ui-datepicker-month" data-handler="selectMonth" data-event="change">';
for (var month = 0; month < 12; month++) {
if ((!inMinYear || month >= minDate.getMonth()) &&
(!inMaxYear || month <= maxDate.getMonth()))
@@ -8901,16 +8865,14 @@ $.extend(Datepicker.prototype, {
var endYear = Math.max(year, determineYear(years[1] || ''));
year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
- inst.yearshtml += '<select class="ui-datepicker-year" ' +
- 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
- '>';
+ inst.yearshtml += '<select class="ui-datepicker-year" data-handler="selectYear" data-event="change">';
for (; year <= endYear; year++) {
inst.yearshtml += '<option value="' + year + '"' +
(year == drawYear ? ' selected="selected"' : '') +
'>' + year + '</option>';
}
inst.yearshtml += '</select>';
-
+
html += inst.yearshtml;
inst.yearshtml = null;
}
@@ -9021,26 +8983,21 @@ $.extend(Datepicker.prototype, {
* Bind hover events for datepicker elements.
* Done via delegate so the binding only occurs once in the lifetime of the parent div.
* Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
- */
+ */
function bindHover(dpDiv) {
var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a';
- return dpDiv.bind('mouseout', function(event) {
- var elem = $( event.target ).closest( selector );
- if ( !elem.length ) {
- return;
- }
- elem.removeClass( "ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover" );
+ return dpDiv.delegate(selector, 'mouseout', function() {
+ $(this).removeClass('ui-state-hover');
+ if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if (this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
})
- .bind('mouseover', function(event) {
- var elem = $( event.target ).closest( selector );
- if ($.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0]) ||
- !elem.length ) {
- return;
+ .delegate(selector, 'mouseover', function(){
+ if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if (this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if (this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
}
- elem.parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
- elem.addClass('ui-state-hover');
- if (elem.hasClass('ui-datepicker-prev')) elem.addClass('ui-datepicker-prev-hover');
- if (elem.hasClass('ui-datepicker-next')) elem.addClass('ui-datepicker-next-hover');
});
}
@@ -9053,27 +9010,21 @@ function extendRemove(target, props) {
return target;
};
-/* Determine whether an object is an array. */
-function isArray(a) {
- return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
- (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
-
/* Invoke the datepicker functionality.
@param options string - a command, optionally followed by additional parameters or
- Object - settings for attaching new datepicker functionality
+ Object - settings for attaching new datepicker functionality
@return jQuery object */
$.fn.datepicker = function(options){
-
+
/* Verify an empty collection wasn't passed - Fixes #6976 */
if ( !this.length ) {
return this;
}
-
+
/* Initialise the date picker. */
if (!$.datepicker.initialized) {
$(document).mousedown($.datepicker._checkExternalClick).
- find('body').append($.datepicker.dpDiv);
+ find(document.body).append($.datepicker.dpDiv);
$.datepicker.initialized = true;
}
@@ -9095,38 +9046,17 @@ $.fn.datepicker = function(options){
$.datepicker = new Datepicker(); // singleton instance
$.datepicker.initialized = false;
$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "1.8.16";
+$.datepicker.version = "1.9.2";
// Workaround for #4055
// Add another global to avoid noConflict issues with inline event handlers
window['DP_jQuery_' + dpuuid] = $;
})(jQuery);
-/*
- * jQuery UI Dialog 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- * jquery.ui.button.js
- * jquery.ui.draggable.js
- * jquery.ui.mouse.js
- * jquery.ui.position.js
- * jquery.ui.resizable.js
- */
+
(function( $, undefined ) {
-var uiDialogClasses =
- 'ui-dialog ' +
- 'ui-widget ' +
- 'ui-widget-content ' +
- 'ui-corner-all ',
+var uiDialogClasses = "ui-dialog ui-widget ui-widget-content ui-corner-all ",
sizeRelatedOptions = {
buttons: true,
height: true,
@@ -9141,173 +9071,170 @@ var uiDialogClasses =
maxWidth: true,
minHeight: true,
minWidth: true
- },
- // support for jQuery 1.3.2 - handle common attrFn methods for dialog
- attrFn = $.attrFn || {
- val: true,
- css: true,
- html: true,
- text: true,
- data: true,
- width: true,
- height: true,
- offset: true,
- click: true
};
$.widget("ui.dialog", {
+ version: "1.9.2",
options: {
autoOpen: true,
buttons: {},
closeOnEscape: true,
- closeText: 'close',
- dialogClass: '',
+ closeText: "close",
+ dialogClass: "",
draggable: true,
hide: null,
- height: 'auto',
+ height: "auto",
maxHeight: false,
maxWidth: false,
minHeight: 150,
minWidth: 150,
modal: false,
position: {
- my: 'center',
- at: 'center',
- collision: 'fit',
+ my: "center",
+ at: "center",
+ of: window,
+ collision: "fit",
// ensure that the titlebar is never outside the document
- using: function(pos) {
- var topOffset = $(this).css(pos).offset().top;
- if (topOffset < 0) {
- $(this).css('top', pos.top - topOffset);
+ using: function( pos ) {
+ var topOffset = $( this ).css( pos ).offset().top;
+ if ( topOffset < 0 ) {
+ $( this ).css( "top", pos.top - topOffset );
}
}
},
resizable: true,
show: null,
stack: true,
- title: '',
+ title: "",
width: 300,
zIndex: 1000
},
_create: function() {
- this.originalTitle = this.element.attr('title');
+ this.originalTitle = this.element.attr( "title" );
// #5742 - .attr() might return a DOMElement
if ( typeof this.originalTitle !== "string" ) {
this.originalTitle = "";
}
-
+ this.oldPosition = {
+ parent: this.element.parent(),
+ index: this.element.parent().children().index( this.element )
+ };
this.options.title = this.options.title || this.originalTitle;
- var self = this,
- options = self.options,
+ var that = this,
+ options = this.options,
- title = options.title || '&#160;',
- titleId = $.ui.dialog.getTitleId(self.element),
+ title = options.title || "&#160;",
+ uiDialog,
+ uiDialogTitlebar,
+ uiDialogTitlebarClose,
+ uiDialogTitle,
+ uiDialogButtonPane;
- uiDialog = (self.uiDialog = $('<div></div>'))
- .appendTo(document.body)
- .hide()
- .addClass(uiDialogClasses + options.dialogClass)
+ uiDialog = ( this.uiDialog = $( "<div>" ) )
+ .addClass( uiDialogClasses + options.dialogClass )
.css({
+ display: "none",
+ outline: 0, // TODO: move to stylesheet
zIndex: options.zIndex
})
// setting tabIndex makes the div focusable
- // setting outline to 0 prevents a border on focus in Mozilla
- .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
- if (options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
- event.keyCode === $.ui.keyCode.ESCAPE) {
-
- self.close(event);
+ .attr( "tabIndex", -1)
+ .keydown(function( event ) {
+ if ( options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE ) {
+ that.close( event );
event.preventDefault();
}
})
- .attr({
- role: 'dialog',
- 'aria-labelledby': titleId
+ .mousedown(function( event ) {
+ that.moveToTop( false, event );
})
- .mousedown(function(event) {
- self.moveToTop(false, event);
- }),
+ .appendTo( "body" );
- uiDialogContent = self.element
+ this.element
.show()
- .removeAttr('title')
- .addClass(
- 'ui-dialog-content ' +
- 'ui-widget-content')
- .appendTo(uiDialog),
-
- uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
- .addClass(
- 'ui-dialog-titlebar ' +
- 'ui-widget-header ' +
- 'ui-corner-all ' +
- 'ui-helper-clearfix'
- )
- .prependTo(uiDialog),
-
- uiDialogTitlebarClose = $('<a href="#"></a>')
- .addClass(
- 'ui-dialog-titlebar-close ' +
- 'ui-corner-all'
- )
- .attr('role', 'button')
- .hover(
- function() {
- uiDialogTitlebarClose.addClass('ui-state-hover');
- },
- function() {
- uiDialogTitlebarClose.removeClass('ui-state-hover');
- }
- )
- .focus(function() {
- uiDialogTitlebarClose.addClass('ui-state-focus');
- })
- .blur(function() {
- uiDialogTitlebarClose.removeClass('ui-state-focus');
+ .removeAttr( "title" )
+ .addClass( "ui-dialog-content ui-widget-content" )
+ .appendTo( uiDialog );
+
+ uiDialogTitlebar = ( this.uiDialogTitlebar = $( "<div>" ) )
+ .addClass( "ui-dialog-titlebar ui-widget-header " +
+ "ui-corner-all ui-helper-clearfix" )
+ .bind( "mousedown", function() {
+ // Dialog isn't getting focus when dragging (#8063)
+ uiDialog.focus();
})
- .click(function(event) {
- self.close(event);
- return false;
+ .prependTo( uiDialog );
+
+ uiDialogTitlebarClose = $( "<a href='#'></a>" )
+ .addClass( "ui-dialog-titlebar-close ui-corner-all" )
+ .attr( "role", "button" )
+ .click(function( event ) {
+ event.preventDefault();
+ that.close( event );
})
- .appendTo(uiDialogTitlebar),
+ .appendTo( uiDialogTitlebar );
- uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
- .addClass(
- 'ui-icon ' +
- 'ui-icon-closethick'
- )
- .text(options.closeText)
- .appendTo(uiDialogTitlebarClose),
+ ( this.uiDialogTitlebarCloseText = $( "<span>" ) )
+ .addClass( "ui-icon ui-icon-closethick" )
+ .text( options.closeText )
+ .appendTo( uiDialogTitlebarClose );
- uiDialogTitle = $('<span></span>')
- .addClass('ui-dialog-title')
- .attr('id', titleId)
- .html(title)
- .prependTo(uiDialogTitlebar);
+ uiDialogTitle = $( "<span>" )
+ .uniqueId()
+ .addClass( "ui-dialog-title" )
+ .html( title )
+ .prependTo( uiDialogTitlebar );
- //handling of deprecated beforeclose (vs beforeClose) option
- //Ticket #4669 http://dev.jqueryui.com/ticket/4669
- //TODO: remove in 1.9pre
- if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
- options.beforeClose = options.beforeclose;
- }
+ uiDialogButtonPane = ( this.uiDialogButtonPane = $( "<div>" ) )
+ .addClass( "ui-dialog-buttonpane ui-widget-content ui-helper-clearfix" );
+
+ ( this.uiButtonSet = $( "<div>" ) )
+ .addClass( "ui-dialog-buttonset" )
+ .appendTo( uiDialogButtonPane );
- uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+ uiDialog.attr({
+ role: "dialog",
+ "aria-labelledby": uiDialogTitle.attr( "id" )
+ });
+
+ uiDialogTitlebar.find( "*" ).add( uiDialogTitlebar ).disableSelection();
+ this._hoverable( uiDialogTitlebarClose );
+ this._focusable( uiDialogTitlebarClose );
- if (options.draggable && $.fn.draggable) {
- self._makeDraggable();
+ if ( options.draggable && $.fn.draggable ) {
+ this._makeDraggable();
}
- if (options.resizable && $.fn.resizable) {
- self._makeResizable();
+ if ( options.resizable && $.fn.resizable ) {
+ this._makeResizable();
}
- self._createButtons(options.buttons);
- self._isOpen = false;
+ this._createButtons( options.buttons );
+ this._isOpen = false;
- if ($.fn.bgiframe) {
+ if ( $.fn.bgiframe ) {
uiDialog.bgiframe();
}
+
+ // prevent tabbing out of modal dialogs
+ this._on( uiDialog, { keydown: function( event ) {
+ if ( !options.modal || event.keyCode !== $.ui.keyCode.TAB ) {
+ return;
+ }
+
+ var tabbables = $( ":tabbable", uiDialog ),
+ first = tabbables.filter( ":first" ),
+ last = tabbables.filter( ":last" );
+
+ if ( event.target === last[0] && !event.shiftKey ) {
+ first.focus( 1 );
+ return false;
+ } else if ( event.target === first[0] && event.shiftKey ) {
+ last.focus( 1 );
+ return false;
+ }
+ }});
},
_init: function() {
@@ -9316,72 +9243,81 @@ $.widget("ui.dialog", {
}
},
- destroy: function() {
- var self = this;
-
- if (self.overlay) {
- self.overlay.destroy();
+ _destroy: function() {
+ var next,
+ oldPosition = this.oldPosition;
+
+ if ( this.overlay ) {
+ this.overlay.destroy();
}
- self.uiDialog.hide();
- self.element
- .unbind('.dialog')
- .removeData('dialog')
- .removeClass('ui-dialog-content ui-widget-content')
- .hide().appendTo('body');
- self.uiDialog.remove();
+ this.uiDialog.hide();
+ this.element
+ .removeClass( "ui-dialog-content ui-widget-content" )
+ .hide()
+ .appendTo( "body" );
+ this.uiDialog.remove();
- if (self.originalTitle) {
- self.element.attr('title', self.originalTitle);
+ if ( this.originalTitle ) {
+ this.element.attr( "title", this.originalTitle );
}
- return self;
+ next = oldPosition.parent.children().eq( oldPosition.index );
+ // Don't try to place the dialog next to itself (#8613)
+ if ( next.length && next[ 0 ] !== this.element[ 0 ] ) {
+ next.before( this.element );
+ } else {
+ oldPosition.parent.append( this.element );
+ }
},
widget: function() {
return this.uiDialog;
},
- close: function(event) {
- var self = this,
+ close: function( event ) {
+ var that = this,
maxZ, thisZ;
-
- if (false === self._trigger('beforeClose', event)) {
+
+ if ( !this._isOpen ) {
return;
}
- if (self.overlay) {
- self.overlay.destroy();
+ if ( false === this._trigger( "beforeClose", event ) ) {
+ return;
}
- self.uiDialog.unbind('keypress.ui-dialog');
- self._isOpen = false;
+ this._isOpen = false;
- if (self.options.hide) {
- self.uiDialog.hide(self.options.hide, function() {
- self._trigger('close', event);
+ if ( this.overlay ) {
+ this.overlay.destroy();
+ }
+
+ if ( this.options.hide ) {
+ this._hide( this.uiDialog, this.options.hide, function() {
+ that._trigger( "close", event );
});
} else {
- self.uiDialog.hide();
- self._trigger('close', event);
+ this.uiDialog.hide();
+ this._trigger( "close", event );
}
$.ui.dialog.overlay.resize();
// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- if (self.options.modal) {
+ if ( this.options.modal ) {
maxZ = 0;
- $('.ui-dialog').each(function() {
- if (this !== self.uiDialog[0]) {
- thisZ = $(this).css('z-index');
- if(!isNaN(thisZ)) {
- maxZ = Math.max(maxZ, thisZ);
+ $( ".ui-dialog" ).each(function() {
+ if ( this !== that.uiDialog[0] ) {
+ thisZ = $( this ).css( "z-index" );
+ if ( !isNaN( thisZ ) ) {
+ maxZ = Math.max( maxZ, thisZ );
}
}
});
$.ui.dialog.maxZ = maxZ;
}
- return self;
+ return this;
},
isOpen: function() {
@@ -9390,179 +9326,158 @@ $.widget("ui.dialog", {
// the force parameter allows us to move modal dialogs to their correct
// position on open
- moveToTop: function(force, event) {
- var self = this,
- options = self.options,
+ moveToTop: function( force, event ) {
+ var options = this.options,
saveScroll;
- if ((options.modal && !force) ||
- (!options.stack && !options.modal)) {
- return self._trigger('focus', event);
+ if ( ( options.modal && !force ) ||
+ ( !options.stack && !options.modal ) ) {
+ return this._trigger( "focus", event );
}
- if (options.zIndex > $.ui.dialog.maxZ) {
+ if ( options.zIndex > $.ui.dialog.maxZ ) {
$.ui.dialog.maxZ = options.zIndex;
}
- if (self.overlay) {
+ if ( this.overlay ) {
$.ui.dialog.maxZ += 1;
- self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ;
+ this.overlay.$el.css( "z-index", $.ui.dialog.overlay.maxZ );
}
- //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
- // http://ui.jquery.com/bugs/ticket/3193
- saveScroll = { scrollTop: self.element.scrollTop(), scrollLeft: self.element.scrollLeft() };
+ // Save and then restore scroll
+ // Opera 9.5+ resets when parent z-index is changed.
+ // http://bugs.jqueryui.com/ticket/3193
+ saveScroll = {
+ scrollTop: this.element.scrollTop(),
+ scrollLeft: this.element.scrollLeft()
+ };
$.ui.dialog.maxZ += 1;
- self.uiDialog.css('z-index', $.ui.dialog.maxZ);
- self.element.attr(saveScroll);
- self._trigger('focus', event);
+ this.uiDialog.css( "z-index", $.ui.dialog.maxZ );
+ this.element.attr( saveScroll );
+ this._trigger( "focus", event );
- return self;
+ return this;
},
open: function() {
- if (this._isOpen) { return; }
+ if ( this._isOpen ) {
+ return;
+ }
- var self = this,
- options = self.options,
- uiDialog = self.uiDialog;
+ var hasFocus,
+ options = this.options,
+ uiDialog = this.uiDialog;
- self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
- self._size();
- self._position(options.position);
- uiDialog.show(options.show);
- self.moveToTop(true);
+ this._size();
+ this._position( options.position );
+ uiDialog.show( options.show );
+ this.overlay = options.modal ? new $.ui.dialog.overlay( this ) : null;
+ this.moveToTop( true );
- // prevent tabbing out of modal dialogs
- if (options.modal) {
- uiDialog.bind('keypress.ui-dialog', function(event) {
- if (event.keyCode !== $.ui.keyCode.TAB) {
- return;
- }
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ hasFocus = this.element.find( ":tabbable" );
+ if ( !hasFocus.length ) {
+ hasFocus = this.uiDialogButtonPane.find( ":tabbable" );
+ if ( !hasFocus.length ) {
+ hasFocus = uiDialog;
+ }
+ }
+ hasFocus.eq( 0 ).focus();
- var tabbables = $(':tabbable', this),
- first = tabbables.filter(':first'),
- last = tabbables.filter(':last');
+ this._isOpen = true;
+ this._trigger( "open" );
- if (event.target === last[0] && !event.shiftKey) {
- first.focus(1);
- return false;
- } else if (event.target === first[0] && event.shiftKey) {
- last.focus(1);
- return false;
- }
- });
- }
+ return this;
+ },
- // set focus to the first tabbable element in the content area or the first button
- // if there are no tabbable elements, set focus on the dialog itself
- $(self.element.find(':tabbable').get().concat(
- uiDialog.find('.ui-dialog-buttonpane :tabbable').get().concat(
- uiDialog.get()))).eq(0).focus();
-
- self._isOpen = true;
- self._trigger('open');
-
- return self;
- },
-
- _createButtons: function(buttons) {
- var self = this,
- hasButtons = false,
- uiDialogButtonPane = $('<div></div>')
- .addClass(
- 'ui-dialog-buttonpane ' +
- 'ui-widget-content ' +
- 'ui-helper-clearfix'
- ),
- uiButtonSet = $( "<div></div>" )
- .addClass( "ui-dialog-buttonset" )
- .appendTo( uiDialogButtonPane );
+ _createButtons: function( buttons ) {
+ var that = this,
+ hasButtons = false;
// if we already have a button pane, remove it
- self.uiDialog.find('.ui-dialog-buttonpane').remove();
+ this.uiDialogButtonPane.remove();
+ this.uiButtonSet.empty();
- if (typeof buttons === 'object' && buttons !== null) {
- $.each(buttons, function() {
+ if ( typeof buttons === "object" && buttons !== null ) {
+ $.each( buttons, function() {
return !(hasButtons = true);
});
}
- if (hasButtons) {
- $.each(buttons, function(name, props) {
+ if ( hasButtons ) {
+ $.each( buttons, function( name, props ) {
+ var button, click;
props = $.isFunction( props ) ?
{ click: props, text: name } :
props;
- var button = $('<button type="button"></button>')
- .click(function() {
- props.click.apply(self.element[0], arguments);
- })
- .appendTo(uiButtonSet);
- // can't use .attr( props, true ) with jQuery 1.3.2.
- $.each( props, function( key, value ) {
- if ( key === "click" ) {
- return;
- }
- if ( key in attrFn ) {
- button[ key ]( value );
- } else {
- button.attr( key, value );
- }
- });
- if ($.fn.button) {
+ // Default to a non-submitting button
+ props = $.extend( { type: "button" }, props );
+ // Change the context for the click callback to be the main element
+ click = props.click;
+ props.click = function() {
+ click.apply( that.element[0], arguments );
+ };
+ button = $( "<button></button>", props )
+ .appendTo( that.uiButtonSet );
+ if ( $.fn.button ) {
button.button();
}
});
- uiDialogButtonPane.appendTo(self.uiDialog);
+ this.uiDialog.addClass( "ui-dialog-buttons" );
+ this.uiDialogButtonPane.appendTo( this.uiDialog );
+ } else {
+ this.uiDialog.removeClass( "ui-dialog-buttons" );
}
},
_makeDraggable: function() {
- var self = this,
- options = self.options,
- doc = $(document),
- heightBeforeDrag;
+ var that = this,
+ options = this.options;
- function filteredUi(ui) {
+ function filteredUi( ui ) {
return {
position: ui.position,
offset: ui.offset
};
}
- self.uiDialog.draggable({
- cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
- handle: '.ui-dialog-titlebar',
- containment: 'document',
- start: function(event, ui) {
- heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
- $(this).height($(this).height()).addClass("ui-dialog-dragging");
- self._trigger('dragStart', event, filteredUi(ui));
+ this.uiDialog.draggable({
+ cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+ handle: ".ui-dialog-titlebar",
+ containment: "document",
+ start: function( event, ui ) {
+ $( this )
+ .addClass( "ui-dialog-dragging" );
+ that._trigger( "dragStart", event, filteredUi( ui ) );
},
- drag: function(event, ui) {
- self._trigger('drag', event, filteredUi(ui));
+ drag: function( event, ui ) {
+ that._trigger( "drag", event, filteredUi( ui ) );
},
- stop: function(event, ui) {
- options.position = [ui.position.left - doc.scrollLeft(),
- ui.position.top - doc.scrollTop()];
- $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
- self._trigger('dragStop', event, filteredUi(ui));
+ stop: function( event, ui ) {
+ options.position = [
+ ui.position.left - that.document.scrollLeft(),
+ ui.position.top - that.document.scrollTop()
+ ];
+ $( this )
+ .removeClass( "ui-dialog-dragging" );
+ that._trigger( "dragStop", event, filteredUi( ui ) );
$.ui.dialog.overlay.resize();
}
});
},
- _makeResizable: function(handles) {
+ _makeResizable: function( handles ) {
handles = (handles === undefined ? this.options.resizable : handles);
- var self = this,
- options = self.options,
+ var that = this,
+ options = this.options,
// .ui-resizable has position: relative defined in the stylesheet
// but dialogs have to use absolute or fixed positioning
- position = self.uiDialog.css('position'),
- resizeHandles = (typeof handles === 'string' ?
+ position = this.uiDialog.css( "position" ),
+ resizeHandles = typeof handles === 'string' ?
handles :
- 'n,e,s,w,se,sw,ne,nw'
- );
+ "n,e,s,w,se,sw,ne,nw";
- function filteredUi(ui) {
+ function filteredUi( ui ) {
return {
originalPosition: ui.originalPosition,
originalSize: ui.originalSize,
@@ -9571,101 +9486,99 @@ $.widget("ui.dialog", {
};
}
- self.uiDialog.resizable({
- cancel: '.ui-dialog-content',
- containment: 'document',
- alsoResize: self.element,
+ this.uiDialog.resizable({
+ cancel: ".ui-dialog-content",
+ containment: "document",
+ alsoResize: this.element,
maxWidth: options.maxWidth,
maxHeight: options.maxHeight,
minWidth: options.minWidth,
- minHeight: self._minHeight(),
+ minHeight: this._minHeight(),
handles: resizeHandles,
- start: function(event, ui) {
- $(this).addClass("ui-dialog-resizing");
- self._trigger('resizeStart', event, filteredUi(ui));
+ start: function( event, ui ) {
+ $( this ).addClass( "ui-dialog-resizing" );
+ that._trigger( "resizeStart", event, filteredUi( ui ) );
},
- resize: function(event, ui) {
- self._trigger('resize', event, filteredUi(ui));
+ resize: function( event, ui ) {
+ that._trigger( "resize", event, filteredUi( ui ) );
},
- stop: function(event, ui) {
- $(this).removeClass("ui-dialog-resizing");
- options.height = $(this).height();
- options.width = $(this).width();
- self._trigger('resizeStop', event, filteredUi(ui));
+ stop: function( event, ui ) {
+ $( this ).removeClass( "ui-dialog-resizing" );
+ options.height = $( this ).height();
+ options.width = $( this ).width();
+ that._trigger( "resizeStop", event, filteredUi( ui ) );
$.ui.dialog.overlay.resize();
}
})
- .css('position', position)
- .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ .css( "position", position )
+ .find( ".ui-resizable-se" )
+ .addClass( "ui-icon ui-icon-grip-diagonal-se" );
},
_minHeight: function() {
var options = this.options;
- if (options.height === 'auto') {
+ if ( options.height === "auto" ) {
return options.minHeight;
} else {
- return Math.min(options.minHeight, options.height);
+ return Math.min( options.minHeight, options.height );
}
},
- _position: function(position) {
+ _position: function( position ) {
var myAt = [],
- offset = [0, 0],
+ offset = [ 0, 0 ],
isVisible;
- if (position) {
+ if ( position ) {
// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
// if (typeof position == 'string' || $.isArray(position)) {
// myAt = $.isArray(position) ? position : position.split(' ');
- if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
- myAt = position.split ? position.split(' ') : [position[0], position[1]];
- if (myAt.length === 1) {
- myAt[1] = myAt[0];
+ if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) {
+ myAt = position.split ? position.split( " " ) : [ position[ 0 ], position[ 1 ] ];
+ if ( myAt.length === 1 ) {
+ myAt[ 1 ] = myAt[ 0 ];
}
- $.each(['left', 'top'], function(i, offsetPosition) {
- if (+myAt[i] === myAt[i]) {
- offset[i] = myAt[i];
- myAt[i] = offsetPosition;
+ $.each( [ "left", "top" ], function( i, offsetPosition ) {
+ if ( +myAt[ i ] === myAt[ i ] ) {
+ offset[ i ] = myAt[ i ];
+ myAt[ i ] = offsetPosition;
}
});
position = {
- my: myAt.join(" "),
- at: myAt.join(" "),
- offset: offset.join(" ")
+ my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " +
+ myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]),
+ at: myAt.join( " " )
};
- }
+ }
- position = $.extend({}, $.ui.dialog.prototype.options.position, position);
+ position = $.extend( {}, $.ui.dialog.prototype.options.position, position );
} else {
position = $.ui.dialog.prototype.options.position;
}
// need to show the dialog to get the actual offset in the position plugin
- isVisible = this.uiDialog.is(':visible');
- if (!isVisible) {
+ isVisible = this.uiDialog.is( ":visible" );
+ if ( !isVisible ) {
this.uiDialog.show();
}
- this.uiDialog
- // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
- .css({ top: 0, left: 0 })
- .position($.extend({ of: window }, position));
- if (!isVisible) {
+ this.uiDialog.position( position );
+ if ( !isVisible ) {
this.uiDialog.hide();
}
},
_setOptions: function( options ) {
- var self = this,
+ var that = this,
resizableOptions = {},
resize = false;
$.each( options, function( key, value ) {
- self._setOption( key, value );
-
+ that._setOption( key, value );
+
if ( key in sizeRelatedOptions ) {
resize = true;
}
@@ -9682,104 +9595,98 @@ $.widget("ui.dialog", {
}
},
- _setOption: function(key, value){
- var self = this,
- uiDialog = self.uiDialog;
-
- switch (key) {
- //handling of deprecated beforeclose (vs beforeClose) option
- //Ticket #4669 http://dev.jqueryui.com/ticket/4669
- //TODO: remove in 1.9pre
- case "beforeclose":
- key = "beforeClose";
- break;
+ _setOption: function( key, value ) {
+ var isDraggable, isResizable,
+ uiDialog = this.uiDialog;
+
+ switch ( key ) {
case "buttons":
- self._createButtons(value);
+ this._createButtons( value );
break;
case "closeText":
// ensure that we always pass a string
- self.uiDialogTitlebarCloseText.text("" + value);
+ this.uiDialogTitlebarCloseText.text( "" + value );
break;
case "dialogClass":
uiDialog
- .removeClass(self.options.dialogClass)
- .addClass(uiDialogClasses + value);
+ .removeClass( this.options.dialogClass )
+ .addClass( uiDialogClasses + value );
break;
case "disabled":
- if (value) {
- uiDialog.addClass('ui-dialog-disabled');
+ if ( value ) {
+ uiDialog.addClass( "ui-dialog-disabled" );
} else {
- uiDialog.removeClass('ui-dialog-disabled');
+ uiDialog.removeClass( "ui-dialog-disabled" );
}
break;
case "draggable":
- var isDraggable = uiDialog.is( ":data(draggable)" );
+ isDraggable = uiDialog.is( ":data(draggable)" );
if ( isDraggable && !value ) {
uiDialog.draggable( "destroy" );
}
-
+
if ( !isDraggable && value ) {
- self._makeDraggable();
+ this._makeDraggable();
}
break;
case "position":
- self._position(value);
+ this._position( value );
break;
case "resizable":
// currently resizable, becoming non-resizable
- var isResizable = uiDialog.is( ":data(resizable)" );
- if (isResizable && !value) {
- uiDialog.resizable('destroy');
+ isResizable = uiDialog.is( ":data(resizable)" );
+ if ( isResizable && !value ) {
+ uiDialog.resizable( "destroy" );
}
// currently resizable, changing handles
- if (isResizable && typeof value === 'string') {
- uiDialog.resizable('option', 'handles', value);
+ if ( isResizable && typeof value === "string" ) {
+ uiDialog.resizable( "option", "handles", value );
}
// currently non-resizable, becoming resizable
- if (!isResizable && value !== false) {
- self._makeResizable(value);
+ if ( !isResizable && value !== false ) {
+ this._makeResizable( value );
}
break;
case "title":
// convert whatever was passed in o a string, for html() to not throw up
- $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || '&#160;'));
+ $( ".ui-dialog-title", this.uiDialogTitlebar )
+ .html( "" + ( value || "&#160;" ) );
break;
}
- $.Widget.prototype._setOption.apply(self, arguments);
+ this._super( key, value );
},
_size: function() {
/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
* divs will both have width and height set, so we need to reset them
*/
- var options = this.options,
- nonContentHeight,
- minContentHeight,
+ var nonContentHeight, minContentHeight, autoHeight,
+ options = this.options,
isVisible = this.uiDialog.is( ":visible" );
// reset content sizing
this.element.show().css({
- width: 'auto',
+ width: "auto",
minHeight: 0,
height: 0
});
- if (options.minWidth > options.width) {
+ if ( options.minWidth > options.width ) {
options.width = options.minWidth;
}
// reset wrapper sizing
// determine the height of all the non-content elements
nonContentHeight = this.uiDialog.css({
- height: 'auto',
+ height: "auto",
width: options.width
})
- .height();
+ .outerHeight();
minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
-
+
if ( options.height === "auto" ) {
// only needed for IE6 support
if ( $.support.minHeight ) {
@@ -9789,7 +9696,7 @@ $.widget("ui.dialog", {
});
} else {
this.uiDialog.show();
- var autoHeight = this.element.css( "height", "auto" ).height();
+ autoHeight = this.element.css( "height", "auto" ).height();
if ( !isVisible ) {
this.uiDialog.hide();
}
@@ -9799,102 +9706,108 @@ $.widget("ui.dialog", {
this.element.height( Math.max( options.height - nonContentHeight, 0 ) );
}
- if (this.uiDialog.is(':data(resizable)')) {
- this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ if (this.uiDialog.is( ":data(resizable)" ) ) {
+ this.uiDialog.resizable( "option", "minHeight", this._minHeight() );
}
}
});
$.extend($.ui.dialog, {
- version: "1.8.16",
-
uuid: 0,
maxZ: 0,
getTitleId: function($el) {
- var id = $el.attr('id');
- if (!id) {
+ var id = $el.attr( "id" );
+ if ( !id ) {
this.uuid += 1;
id = this.uuid;
}
- return 'ui-dialog-title-' + id;
+ return "ui-dialog-title-" + id;
},
- overlay: function(dialog) {
- this.$el = $.ui.dialog.overlay.create(dialog);
+ overlay: function( dialog ) {
+ this.$el = $.ui.dialog.overlay.create( dialog );
}
});
-$.extend($.ui.dialog.overlay, {
+$.extend( $.ui.dialog.overlay, {
instances: [],
// reuse old instances due to IE memory leak with alpha transparency (see #5185)
oldInstances: [],
maxZ: 0,
- events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
- function(event) { return event + '.dialog-overlay'; }).join(' '),
- create: function(dialog) {
- if (this.instances.length === 0) {
+ events: $.map(
+ "focus,mousedown,mouseup,keydown,keypress,click".split( "," ),
+ function( event ) {
+ return event + ".dialog-overlay";
+ }
+ ).join( " " ),
+ create: function( dialog ) {
+ if ( this.instances.length === 0 ) {
// prevent use of anchors and inputs
// we use a setTimeout in case the overlay is created from an
// event that we're going to be cancelling (see #2804)
setTimeout(function() {
// handle $(el).dialog().dialog('close') (see #4065)
- if ($.ui.dialog.overlay.instances.length) {
- $(document).bind($.ui.dialog.overlay.events, function(event) {
+ if ( $.ui.dialog.overlay.instances.length ) {
+ $( document ).bind( $.ui.dialog.overlay.events, function( event ) {
// stop events if the z-index of the target is < the z-index of the overlay
// we cannot return true when we don't want to cancel the event (#3523)
- if ($(event.target).zIndex() < $.ui.dialog.overlay.maxZ) {
+ if ( $( event.target ).zIndex() < $.ui.dialog.overlay.maxZ ) {
return false;
}
});
}
- }, 1);
-
- // allow closing by pressing the escape key
- $(document).bind('keydown.dialog-overlay', function(event) {
- if (dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
- event.keyCode === $.ui.keyCode.ESCAPE) {
-
- dialog.close(event);
- event.preventDefault();
- }
- });
+ }, 1 );
// handle window resize
- $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ $( window ).bind( "resize.dialog-overlay", $.ui.dialog.overlay.resize );
}
- var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
- .appendTo(document.body)
- .css({
- width: this.width(),
- height: this.height()
- });
+ var $el = ( this.oldInstances.pop() || $( "<div>" ).addClass( "ui-widget-overlay" ) );
+
+ // allow closing by pressing the escape key
+ $( document ).bind( "keydown.dialog-overlay", function( event ) {
+ var instances = $.ui.dialog.overlay.instances;
+ // only react to the event if we're the top overlay
+ if ( instances.length !== 0 && instances[ instances.length - 1 ] === $el &&
+ dialog.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE ) {
+
+ dialog.close( event );
+ event.preventDefault();
+ }
+ });
+
+ $el.appendTo( document.body ).css({
+ width: this.width(),
+ height: this.height()
+ });
- if ($.fn.bgiframe) {
+ if ( $.fn.bgiframe ) {
$el.bgiframe();
}
- this.instances.push($el);
+ this.instances.push( $el );
return $el;
},
- destroy: function($el) {
- var indexOf = $.inArray($el, this.instances);
- if (indexOf != -1){
- this.oldInstances.push(this.instances.splice(indexOf, 1)[0]);
+ destroy: function( $el ) {
+ var indexOf = $.inArray( $el, this.instances ),
+ maxZ = 0;
+
+ if ( indexOf !== -1 ) {
+ this.oldInstances.push( this.instances.splice( indexOf, 1 )[ 0 ] );
}
- if (this.instances.length === 0) {
- $([document, window]).unbind('.dialog-overlay');
+ if ( this.instances.length === 0 ) {
+ $( [ document, window ] ).unbind( ".dialog-overlay" );
}
- $el.remove();
-
+ $el.height( 0 ).width( 0 ).remove();
+
// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
- var maxZ = 0;
- $.each(this.instances, function() {
- maxZ = Math.max(maxZ, this.css('z-index'));
+ $.each( this.instances, function() {
+ maxZ = Math.max( maxZ, this.css( "z-index" ) );
});
this.maxZ = maxZ;
},
@@ -9902,8 +9815,8 @@ $.extend($.ui.dialog.overlay, {
height: function() {
var scrollHeight,
offsetHeight;
- // handle IE 6
- if ($.browser.msie && $.browser.version < 7) {
+ // handle IE
+ if ( $.ui.ie ) {
scrollHeight = Math.max(
document.documentElement.scrollHeight,
document.body.scrollHeight
@@ -9913,14 +9826,14 @@ $.extend($.ui.dialog.overlay, {
document.body.offsetHeight
);
- if (scrollHeight < offsetHeight) {
- return $(window).height() + 'px';
+ if ( scrollHeight < offsetHeight ) {
+ return $( window ).height() + "px";
} else {
- return scrollHeight + 'px';
+ return scrollHeight + "px";
}
// handle "good" browsers
} else {
- return $(document).height() + 'px';
+ return $( document ).height() + "px";
}
},
@@ -9928,7 +9841,7 @@ $.extend($.ui.dialog.overlay, {
var scrollWidth,
offsetWidth;
// handle IE
- if ( $.browser.msie ) {
+ if ( $.ui.ie ) {
scrollWidth = Math.max(
document.documentElement.scrollWidth,
document.body.scrollWidth
@@ -9938,14 +9851,14 @@ $.extend($.ui.dialog.overlay, {
document.body.offsetWidth
);
- if (scrollWidth < offsetWidth) {
- return $(window).width() + 'px';
+ if ( scrollWidth < offsetWidth ) {
+ return $( window ).width() + "px";
} else {
- return scrollWidth + 'px';
+ return scrollWidth + "px";
}
// handle "good" browsers
} else {
- return $(document).width() + 'px';
+ return $( document ).width() + "px";
}
},
@@ -9958,9 +9871,9 @@ $.extend($.ui.dialog.overlay, {
* This is handled by shrinking the overlay before setting it
* to the full document size.
*/
- var $overlays = $([]);
- $.each($.ui.dialog.overlay.instances, function() {
- $overlays = $overlays.add(this);
+ var $overlays = $( [] );
+ $.each( $.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add( this );
});
$overlays.css({
@@ -9973,31 +9886,1674 @@ $.extend($.ui.dialog.overlay, {
}
});
-$.extend($.ui.dialog.overlay.prototype, {
+$.extend( $.ui.dialog.overlay.prototype, {
destroy: function() {
- $.ui.dialog.overlay.destroy(this.$el);
+ $.ui.dialog.overlay.destroy( this.$el );
}
});
-}(jQuery));
-/*
- * jQuery UI Position 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Position
- */
+}( jQuery ) );
+
+(function( $, undefined ) {
+
+var rvertical = /up|down|vertical/,
+ rpositivemotion = /up|left|vertical|horizontal/;
+
+$.effects.effect.blind = function( o, done ) {
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ direction = o.direction || "up",
+ vertical = rvertical.test( direction ),
+ ref = vertical ? "height" : "width",
+ ref2 = vertical ? "top" : "left",
+ motion = rpositivemotion.test( direction ),
+ animation = {},
+ show = mode === "show",
+ wrapper, distance, margin;
+
+ // if already wrapped, the wrapper's properties are my property. #6245
+ if ( el.parent().is( ".ui-effects-wrapper" ) ) {
+ $.effects.save( el.parent(), props );
+ } else {
+ $.effects.save( el, props );
+ }
+ el.show();
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+
+ distance = wrapper[ ref ]();
+ margin = parseFloat( wrapper.css( ref2 ) ) || 0;
+
+ animation[ ref ] = show ? distance : 0;
+ if ( !motion ) {
+ el
+ .css( vertical ? "bottom" : "right", 0 )
+ .css( vertical ? "top" : "left", "auto" )
+ .css({ position: "absolute" });
+
+ animation[ ref2 ] = show ? margin : distance + margin;
+ }
+
+ // start at 0 if we are showing
+ if ( show ) {
+ wrapper.css( ref, 0 );
+ if ( ! motion ) {
+ wrapper.css( ref2, margin + distance );
+ }
+ }
+
+ // Animate
+ wrapper.animate( animation, {
+ duration: o.duration,
+ easing: o.easing,
+ queue: false,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.bounce = function( o, done ) {
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+
+ // defaults:
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ hide = mode === "hide",
+ show = mode === "show",
+ direction = o.direction || "up",
+ distance = o.distance,
+ times = o.times || 5,
+
+ // number of internal animations
+ anims = times * 2 + ( show || hide ? 1 : 0 ),
+ speed = o.duration / anims,
+ easing = o.easing,
+
+ // utility:
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ),
+ i,
+ upAnim,
+ downAnim,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ // Avoid touching opacity to prevent clearType and PNG issues in IE
+ if ( show || hide ) {
+ props.push( "opacity" );
+ }
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el ); // Create Wrapper
+
+ // default distance for the BIGGEST bounce is the outer Distance / 3
+ if ( !distance ) {
+ distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3;
+ }
+
+ if ( show ) {
+ downAnim = { opacity: 1 };
+ downAnim[ ref ] = 0;
+
+ // if we are showing, force opacity 0 and set the initial position
+ // then do the "first" animation
+ el.css( "opacity", 0 )
+ .css( ref, motion ? -distance * 2 : distance * 2 )
+ .animate( downAnim, speed, easing );
+ }
+
+ // start at the smallest distance if we are hiding
+ if ( hide ) {
+ distance = distance / Math.pow( 2, times - 1 );
+ }
+
+ downAnim = {};
+ downAnim[ ref ] = 0;
+ // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+ for ( i = 0; i < times; i++ ) {
+ upAnim = {};
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate( upAnim, speed, easing )
+ .animate( downAnim, speed, easing );
+
+ distance = hide ? distance * 2 : distance / 2;
+ }
+
+ // Last Bounce when Hiding
+ if ( hide ) {
+ upAnim = { opacity: 0 };
+ upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+ el.animate( upAnim, speed, easing );
+ }
+
+ el.queue(function() {
+ if ( hide ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if ( queuelen > 1) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ el.dequeue();
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.clip = function( o, done ) {
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ direction = o.direction || "vertical",
+ vert = direction === "vertical",
+ size = vert ? "height" : "width",
+ position = vert ? "top" : "left",
+ animation = {},
+ wrapper, animate, distance;
+
+ // Save & Show
+ $.effects.save( el, props );
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+ animate = ( el[0].tagName === "IMG" ) ? wrapper : el;
+ distance = animate[ size ]();
+
+ // Shift
+ if ( show ) {
+ animate.css( size, 0 );
+ animate.css( position, distance / 2 );
+ }
+
+ // Create Animation Object:
+ animation[ size ] = show ? distance : 0;
+ animation[ position ] = show ? 0 : distance / 2;
+
+ // Animate
+ animate.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( !show ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.drop = function( o, done ) {
+
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+ motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg",
+ animation = {
+ opacity: show ? 1 : 0
+ },
+ distance;
+
+ // Adjust
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+
+ distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2;
+
+ if ( show ) {
+ el
+ .css( "opacity", 0 )
+ .css( ref, motion === "pos" ? -distance : distance );
+ }
+
+ // Animation
+ animation[ ref ] = ( show ?
+ ( motion === "pos" ? "+=" : "-=" ) :
+ ( motion === "pos" ? "-=" : "+=" ) ) +
+ distance;
+
+ // Animate
+ el.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.explode = function( o, done ) {
+
+ var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3,
+ cells = rows,
+ el = $( this ),
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+
+ // show and then visibility:hidden the element before calculating offset
+ offset = el.show().css( "visibility", "hidden" ).offset(),
+
+ // width and height of a piece
+ width = Math.ceil( el.outerWidth() / cells ),
+ height = Math.ceil( el.outerHeight() / rows ),
+ pieces = [],
+
+ // loop
+ i, j, left, top, mx, my;
+
+ // children animate complete:
+ function childComplete() {
+ pieces.push( this );
+ if ( pieces.length === rows * cells ) {
+ animComplete();
+ }
+ }
+
+ // clone the element for each row and cell.
+ for( i = 0; i < rows ; i++ ) { // ===>
+ top = offset.top + i * height;
+ my = i - ( rows - 1 ) / 2 ;
+
+ for( j = 0; j < cells ; j++ ) { // |||
+ left = offset.left + j * width;
+ mx = j - ( cells - 1 ) / 2 ;
+
+ // Create a clone of the now hidden main element that will be absolute positioned
+ // within a wrapper div off the -left and -top equal to size of our pieces
+ el
+ .clone()
+ .appendTo( "body" )
+ .wrap( "<div></div>" )
+ .css({
+ position: "absolute",
+ visibility: "visible",
+ left: -j * width,
+ top: -i * height
+ })
+
+ // select the wrapper - make it overflow: hidden and absolute positioned based on
+ // where the original was located +left and +top equal to the size of pieces
+ .parent()
+ .addClass( "ui-effects-explode" )
+ .css({
+ position: "absolute",
+ overflow: "hidden",
+ width: width,
+ height: height,
+ left: left + ( show ? mx * width : 0 ),
+ top: top + ( show ? my * height : 0 ),
+ opacity: show ? 0 : 1
+ }).animate({
+ left: left + ( show ? 0 : mx * width ),
+ top: top + ( show ? 0 : my * height ),
+ opacity: show ? 1 : 0
+ }, o.duration || 500, o.easing, childComplete );
+ }
+ }
+
+ function animComplete() {
+ el.css({
+ visibility: "visible"
+ });
+ $( pieces ).remove();
+ if ( !show ) {
+ el.hide();
+ }
+ done();
+ }
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.fade = function( o, done ) {
+ var el = $( this ),
+ mode = $.effects.setMode( el, o.mode || "toggle" );
+
+ el.animate({
+ opacity: mode
+ }, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: done
+ });
+};
+
+})( jQuery );
+
+(function( $, undefined ) {
+
+$.effects.effect.fold = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "hide" ),
+ show = mode === "show",
+ hide = mode === "hide",
+ size = o.size || 15,
+ percent = /([0-9]+)%/.exec( size ),
+ horizFirst = !!o.horizFirst,
+ widthFirst = show !== horizFirst,
+ ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ],
+ duration = o.duration / 2,
+ wrapper, distance,
+ animation1 = {},
+ animation2 = {};
+
+ $.effects.save( el, props );
+ el.show();
+
+ // Create Wrapper
+ wrapper = $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+ distance = widthFirst ?
+ [ wrapper.width(), wrapper.height() ] :
+ [ wrapper.height(), wrapper.width() ];
+
+ if ( percent ) {
+ size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ];
+ }
+ if ( show ) {
+ wrapper.css( horizFirst ? {
+ height: 0,
+ width: size
+ } : {
+ height: size,
+ width: 0
+ });
+ }
+
+ // Animation
+ animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size;
+ animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0;
+
+ // Animate
+ wrapper
+ .animate( animation1, duration, o.easing )
+ .animate( animation2, duration, o.easing, function() {
+ if ( hide ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.highlight = function( o, done ) {
+ var elem = $( this ),
+ props = [ "backgroundImage", "backgroundColor", "opacity" ],
+ mode = $.effects.setMode( elem, o.mode || "show" ),
+ animation = {
+ backgroundColor: elem.css( "backgroundColor" )
+ };
+
+ if (mode === "hide") {
+ animation.opacity = 0;
+ }
+
+ $.effects.save( elem, props );
+
+ elem
+ .show()
+ .css({
+ backgroundImage: "none",
+ backgroundColor: o.color || "#ffff99"
+ })
+ .animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ elem.hide();
+ }
+ $.effects.restore( elem, props );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.pulsate = function( o, done ) {
+ var elem = $( this ),
+ mode = $.effects.setMode( elem, o.mode || "show" ),
+ show = mode === "show",
+ hide = mode === "hide",
+ showhide = ( show || mode === "hide" ),
+
+ // showing or hiding leaves of the "last" animation
+ anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+ duration = o.duration / anims,
+ animateTo = 0,
+ queue = elem.queue(),
+ queuelen = queue.length,
+ i;
+
+ if ( show || !elem.is(":visible")) {
+ elem.css( "opacity", 0 ).show();
+ animateTo = 1;
+ }
+
+ // anims - 1 opacity "toggles"
+ for ( i = 1; i < anims; i++ ) {
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing );
+ animateTo = 1 - animateTo;
+ }
+
+ elem.animate({
+ opacity: animateTo
+ }, duration, o.easing);
+
+ elem.queue(function() {
+ if ( hide ) {
+ elem.hide();
+ }
+ done();
+ });
+
+ // We just queued up "anims" animations, we need to put them next in the queue
+ if ( queuelen > 1 ) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ elem.dequeue();
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.puff = function( o, done ) {
+ var elem = $( this ),
+ mode = $.effects.setMode( elem, o.mode || "hide" ),
+ hide = mode === "hide",
+ percent = parseInt( o.percent, 10 ) || 150,
+ factor = percent / 100,
+ original = {
+ height: elem.height(),
+ width: elem.width(),
+ outerHeight: elem.outerHeight(),
+ outerWidth: elem.outerWidth()
+ };
+
+ $.extend( o, {
+ effect: "scale",
+ queue: false,
+ fade: true,
+ mode: mode,
+ complete: done,
+ percent: hide ? percent : 100,
+ from: hide ?
+ original :
+ {
+ height: original.height * factor,
+ width: original.width * factor,
+ outerHeight: original.outerHeight * factor,
+ outerWidth: original.outerWidth * factor
+ }
+ });
+
+ elem.effect( o );
+};
+
+$.effects.effect.scale = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ options = $.extend( true, {}, o ),
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ percent = parseInt( o.percent, 10 ) ||
+ ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ),
+ direction = o.direction || "both",
+ origin = o.origin,
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ },
+ factor = {
+ y: direction !== "horizontal" ? (percent / 100) : 1,
+ x: direction !== "vertical" ? (percent / 100) : 1
+ };
+
+ // We are going to pass this effect to the size effect:
+ options.effect = "size";
+ options.queue = false;
+ options.complete = done;
+
+ // Set default origin and restore for show/hide
+ if ( mode !== "effect" ) {
+ options.origin = origin || ["middle","center"];
+ options.restore = true;
+ }
+
+ options.from = o.from || ( mode === "show" ? {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ } : original );
+ options.to = {
+ height: original.height * factor.y,
+ width: original.width * factor.x,
+ outerHeight: original.outerHeight * factor.y,
+ outerWidth: original.outerWidth * factor.x
+ };
+
+ // Fade option to support puff
+ if ( options.fade ) {
+ if ( mode === "show" ) {
+ options.from.opacity = 0;
+ options.to.opacity = 1;
+ }
+ if ( mode === "hide" ) {
+ options.from.opacity = 1;
+ options.to.opacity = 0;
+ }
+ }
+
+ // Animate
+ el.effect( options );
+
+};
+
+$.effects.effect.size = function( o, done ) {
+
+ // Create element
+ var original, baseline, factor,
+ el = $( this ),
+ props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ],
+
+ // Always restore
+ props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ],
+
+ // Copy for children
+ props2 = [ "width", "height", "overflow" ],
+ cProps = [ "fontSize" ],
+ vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ],
+ hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ],
+
+ // Set options
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ restore = o.restore || mode !== "effect",
+ scale = o.scale || "both",
+ origin = o.origin || [ "middle", "center" ],
+ position = el.css( "position" ),
+ props = restore ? props0 : props1,
+ zero = {
+ height: 0,
+ width: 0,
+ outerHeight: 0,
+ outerWidth: 0
+ };
+
+ if ( mode === "show" ) {
+ el.show();
+ }
+ original = {
+ height: el.height(),
+ width: el.width(),
+ outerHeight: el.outerHeight(),
+ outerWidth: el.outerWidth()
+ };
+
+ if ( o.mode === "toggle" && mode === "show" ) {
+ el.from = o.to || zero;
+ el.to = o.from || original;
+ } else {
+ el.from = o.from || ( mode === "show" ? zero : original );
+ el.to = o.to || ( mode === "hide" ? zero : original );
+ }
+
+ // Set scaling factor
+ factor = {
+ from: {
+ y: el.from.height / original.height,
+ x: el.from.width / original.width
+ },
+ to: {
+ y: el.to.height / original.height,
+ x: el.to.width / original.width
+ }
+ };
+
+ // Scale the css box
+ if ( scale === "box" || scale === "both" ) {
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ props = props.concat( vProps );
+ el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from );
+ el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to );
+ }
+
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ props = props.concat( hProps );
+ el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from );
+ el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to );
+ }
+ }
+
+ // Scale the content
+ if ( scale === "content" || scale === "both" ) {
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ props = props.concat( cProps ).concat( props2 );
+ el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from );
+ el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to );
+ }
+ }
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+ el.css( "overflow", "hidden" ).css( el.from );
+
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ baseline = $.effects.getBaseline( origin, original );
+ el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y;
+ el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x;
+ el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y;
+ el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x;
+ }
+ el.css( el.from ); // set top & left
+
+ // Animate
+ if ( scale === "content" || scale === "both" ) { // Scale the children
+
+ // Add margins/font-size
+ vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps);
+ hProps = hProps.concat([ "marginLeft", "marginRight" ]);
+ props2 = props0.concat(vProps).concat(hProps);
+
+ el.find( "*[width]" ).each( function(){
+ var child = $( this ),
+ c_original = {
+ height: child.height(),
+ width: child.width(),
+ outerHeight: child.outerHeight(),
+ outerWidth: child.outerWidth()
+ };
+ if (restore) {
+ $.effects.save(child, props2);
+ }
+
+ child.from = {
+ height: c_original.height * factor.from.y,
+ width: c_original.width * factor.from.x,
+ outerHeight: c_original.outerHeight * factor.from.y,
+ outerWidth: c_original.outerWidth * factor.from.x
+ };
+ child.to = {
+ height: c_original.height * factor.to.y,
+ width: c_original.width * factor.to.x,
+ outerHeight: c_original.height * factor.to.y,
+ outerWidth: c_original.width * factor.to.x
+ };
+
+ // Vertical props scaling
+ if ( factor.from.y !== factor.to.y ) {
+ child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from );
+ child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to );
+ }
+
+ // Horizontal props scaling
+ if ( factor.from.x !== factor.to.x ) {
+ child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from );
+ child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to );
+ }
+
+ // Animate children
+ child.css( child.from );
+ child.animate( child.to, o.duration, o.easing, function() {
+
+ // Restore children
+ if ( restore ) {
+ $.effects.restore( child, props2 );
+ }
+ });
+ });
+ }
+
+ // Animate
+ el.animate( el.to, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( el.to.opacity === 0 ) {
+ el.css( "opacity", el.from.opacity );
+ }
+ if( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ if ( !restore ) {
+
+ // we need to calculate our new positioning based on the scaling
+ if ( position === "static" ) {
+ el.css({
+ position: "relative",
+ top: el.to.top,
+ left: el.to.left
+ });
+ } else {
+ $.each([ "top", "left" ], function( idx, pos ) {
+ el.css( pos, function( _, str ) {
+ var val = parseInt( str, 10 ),
+ toRef = idx ? el.to.left : el.to.top;
+
+ // if original was "auto", recalculate the new value from wrapper
+ if ( str === "auto" ) {
+ return toRef + "px";
+ }
+
+ return val + toRef + "px";
+ });
+ });
+ }
+ }
+
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.shake = function( o, done ) {
+
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "height", "width" ],
+ mode = $.effects.setMode( el, o.mode || "effect" ),
+ direction = o.direction || "left",
+ distance = o.distance || 20,
+ times = o.times || 3,
+ anims = times * 2 + 1,
+ speed = Math.round(o.duration/anims),
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ animation = {},
+ animation1 = {},
+ animation2 = {},
+ i,
+
+ // we will need to re-assemble the queue to stack our animations in place
+ queue = el.queue(),
+ queuelen = queue.length;
+
+ $.effects.save( el, props );
+ el.show();
+ $.effects.createWrapper( el );
+
+ // Animation
+ animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance;
+ animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+ animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
+
+ // Animate
+ el.animate( animation, speed, o.easing );
+
+ // Shakes
+ for ( i = 1; i < times; i++ ) {
+ el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing );
+ }
+ el
+ .animate( animation1, speed, o.easing )
+ .animate( animation, speed / 2, o.easing )
+ .queue(function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ });
+
+ // inject all the animations we just queued to be first in line (after "inprogress")
+ if ( queuelen > 1) {
+ queue.splice.apply( queue,
+ [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) );
+ }
+ el.dequeue();
+
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.slide = function( o, done ) {
+
+ // Create element
+ var el = $( this ),
+ props = [ "position", "top", "bottom", "left", "right", "width", "height" ],
+ mode = $.effects.setMode( el, o.mode || "show" ),
+ show = mode === "show",
+ direction = o.direction || "left",
+ ref = (direction === "up" || direction === "down") ? "top" : "left",
+ positiveMotion = (direction === "up" || direction === "left"),
+ distance,
+ animation = {};
+
+ // Adjust
+ $.effects.save( el, props );
+ el.show();
+ distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true );
+
+ $.effects.createWrapper( el ).css({
+ overflow: "hidden"
+ });
+
+ if ( show ) {
+ el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance );
+ }
+
+ // Animation
+ animation[ ref ] = ( show ?
+ ( positiveMotion ? "+=" : "-=") :
+ ( positiveMotion ? "-=" : "+=")) +
+ distance;
+
+ // Animate
+ el.animate( animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.easing,
+ complete: function() {
+ if ( mode === "hide" ) {
+ el.hide();
+ }
+ $.effects.restore( el, props );
+ $.effects.removeWrapper( el );
+ done();
+ }
+ });
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+$.effects.effect.transfer = function( o, done ) {
+ var elem = $( this ),
+ target = $( o.to ),
+ targetFixed = target.css( "position" ) === "fixed",
+ body = $("body"),
+ fixTop = targetFixed ? body.scrollTop() : 0,
+ fixLeft = targetFixed ? body.scrollLeft() : 0,
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top - fixTop ,
+ left: endPosition.left - fixLeft ,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $( '<div class="ui-effects-transfer"></div>' )
+ .appendTo( document.body )
+ .addClass( o.className )
+ .css({
+ top: startPosition.top - fixTop ,
+ left: startPosition.left - fixLeft ,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: targetFixed ? "fixed" : "absolute"
+ })
+ .animate( animation, o.duration, o.easing, function() {
+ transfer.remove();
+ done();
+ });
+};
+
+})(jQuery);
+
+(function( $, undefined ) {
+
+var mouseHandled = false;
+
+$.widget( "ui.menu", {
+ version: "1.9.2",
+ defaultElement: "<ul>",
+ delay: 300,
+ options: {
+ icons: {
+ submenu: "ui-icon-carat-1-e"
+ },
+ menus: "ul",
+ position: {
+ my: "left top",
+ at: "right top"
+ },
+ role: "menu",
+
+ // callbacks
+ blur: null,
+ focus: null,
+ select: null
+ },
+
+ _create: function() {
+ this.activeMenu = this.element;
+ this.element
+ .uniqueId()
+ .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" )
+ .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length )
+ .attr({
+ role: this.options.role,
+ tabIndex: 0
+ })
+ // need to catch all clicks on disabled menu
+ // not possible through _on
+ .bind( "click" + this.eventNamespace, $.proxy(function( event ) {
+ if ( this.options.disabled ) {
+ event.preventDefault();
+ }
+ }, this ));
+
+ if ( this.options.disabled ) {
+ this.element
+ .addClass( "ui-state-disabled" )
+ .attr( "aria-disabled", "true" );
+ }
+
+ this._on({
+ // Prevent focus from sticking to links inside menu after clicking
+ // them (focus should always stay on UL during navigation).
+ "mousedown .ui-menu-item > a": function( event ) {
+ event.preventDefault();
+ },
+ "click .ui-state-disabled > a": function( event ) {
+ event.preventDefault();
+ },
+ "click .ui-menu-item:has(a)": function( event ) {
+ var target = $( event.target ).closest( ".ui-menu-item" );
+ if ( !mouseHandled && target.not( ".ui-state-disabled" ).length ) {
+ mouseHandled = true;
+
+ this.select( event );
+ // Open submenu on click
+ if ( target.has( ".ui-menu" ).length ) {
+ this.expand( event );
+ } else if ( !this.element.is( ":focus" ) ) {
+ // Redirect focus to the menu
+ this.element.trigger( "focus", [ true ] );
+
+ // If the active item is on the top level, let it stay active.
+ // Otherwise, blur the active item since it is no longer visible.
+ if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) {
+ clearTimeout( this.timer );
+ }
+ }
+ }
+ },
+ "mouseenter .ui-menu-item": function( event ) {
+ var target = $( event.currentTarget );
+ // Remove ui-state-active class from siblings of the newly focused menu item
+ // to avoid a jump caused by adjacent elements both having a class with a border
+ target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" );
+ this.focus( event, target );
+ },
+ mouseleave: "collapseAll",
+ "mouseleave .ui-menu": "collapseAll",
+ focus: function( event, keepActiveItem ) {
+ // If there's already an active item, keep it active
+ // If not, activate the first item
+ var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 );
+
+ if ( !keepActiveItem ) {
+ this.focus( event, item );
+ }
+ },
+ blur: function( event ) {
+ this._delay(function() {
+ if ( !$.contains( this.element[0], this.document[0].activeElement ) ) {
+ this.collapseAll( event );
+ }
+ });
+ },
+ keydown: "_keydown"
+ });
+
+ this.refresh();
+
+ // Clicks outside of a menu collapse any open menus
+ this._on( this.document, {
+ click: function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu" ).length ) {
+ this.collapseAll( event );
+ }
+
+ // Reset the mouseHandled flag
+ mouseHandled = false;
+ }
+ });
+ },
+
+ _destroy: function() {
+ // Destroy (sub)menus
+ this.element
+ .removeAttr( "aria-activedescendant" )
+ .find( ".ui-menu" ).andSelf()
+ .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" )
+ .removeAttr( "role" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "aria-labelledby" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-disabled" )
+ .removeUniqueId()
+ .show();
+
+ // Destroy menu items
+ this.element.find( ".ui-menu-item" )
+ .removeClass( "ui-menu-item" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-disabled" )
+ .children( "a" )
+ .removeUniqueId()
+ .removeClass( "ui-corner-all ui-state-hover" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-haspopup" )
+ .children().each( function() {
+ var elem = $( this );
+ if ( elem.data( "ui-menu-submenu-carat" ) ) {
+ elem.remove();
+ }
+ });
+
+ // Destroy menu dividers
+ this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" );
+ },
+
+ _keydown: function( event ) {
+ var match, prev, character, skip, regex,
+ preventDefault = true;
+
+ function escape( value ) {
+ return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" );
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.PAGE_UP:
+ this.previousPage( event );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ this.nextPage( event );
+ break;
+ case $.ui.keyCode.HOME:
+ this._move( "first", "first", event );
+ break;
+ case $.ui.keyCode.END:
+ this._move( "last", "last", event );
+ break;
+ case $.ui.keyCode.UP:
+ this.previous( event );
+ break;
+ case $.ui.keyCode.DOWN:
+ this.next( event );
+ break;
+ case $.ui.keyCode.LEFT:
+ this.collapse( event );
+ break;
+ case $.ui.keyCode.RIGHT:
+ if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+ this.expand( event );
+ }
+ break;
+ case $.ui.keyCode.ENTER:
+ case $.ui.keyCode.SPACE:
+ this._activate( event );
+ break;
+ case $.ui.keyCode.ESCAPE:
+ this.collapse( event );
+ break;
+ default:
+ preventDefault = false;
+ prev = this.previousFilter || "";
+ character = String.fromCharCode( event.keyCode );
+ skip = false;
+
+ clearTimeout( this.filterTimer );
+
+ if ( character === prev ) {
+ skip = true;
+ } else {
+ character = prev + character;
+ }
+
+ regex = new RegExp( "^" + escape( character ), "i" );
+ match = this.activeMenu.children( ".ui-menu-item" ).filter(function() {
+ return regex.test( $( this ).children( "a" ).text() );
+ });
+ match = skip && match.index( this.active.next() ) !== -1 ?
+ this.active.nextAll( ".ui-menu-item" ) :
+ match;
+
+ // If no matches on the current filter, reset to the last character pressed
+ // to move down the menu to the first item that starts with that character
+ if ( !match.length ) {
+ character = String.fromCharCode( event.keyCode );
+ regex = new RegExp( "^" + escape( character ), "i" );
+ match = this.activeMenu.children( ".ui-menu-item" ).filter(function() {
+ return regex.test( $( this ).children( "a" ).text() );
+ });
+ }
+
+ if ( match.length ) {
+ this.focus( event, match );
+ if ( match.length > 1 ) {
+ this.previousFilter = character;
+ this.filterTimer = this._delay(function() {
+ delete this.previousFilter;
+ }, 1000 );
+ } else {
+ delete this.previousFilter;
+ }
+ } else {
+ delete this.previousFilter;
+ }
+ }
+
+ if ( preventDefault ) {
+ event.preventDefault();
+ }
+ },
+
+ _activate: function( event ) {
+ if ( !this.active.is( ".ui-state-disabled" ) ) {
+ if ( this.active.children( "a[aria-haspopup='true']" ).length ) {
+ this.expand( event );
+ } else {
+ this.select( event );
+ }
+ }
+ },
+
+ refresh: function() {
+ var menus,
+ icon = this.options.icons.submenu,
+ submenus = this.element.find( this.options.menus );
+
+ // Initialize nested menus
+ submenus.filter( ":not(.ui-menu)" )
+ .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" )
+ .hide()
+ .attr({
+ role: this.options.role,
+ "aria-hidden": "true",
+ "aria-expanded": "false"
+ })
+ .each(function() {
+ var menu = $( this ),
+ item = menu.prev( "a" ),
+ submenuCarat = $( "<span>" )
+ .addClass( "ui-menu-icon ui-icon " + icon )
+ .data( "ui-menu-submenu-carat", true );
+
+ item
+ .attr( "aria-haspopup", "true" )
+ .prepend( submenuCarat );
+ menu.attr( "aria-labelledby", item.attr( "id" ) );
+ });
+
+ menus = submenus.add( this.element );
+
+ // Don't refresh list items that are already adapted
+ menus.children( ":not(.ui-menu-item):has(a)" )
+ .addClass( "ui-menu-item" )
+ .attr( "role", "presentation" )
+ .children( "a" )
+ .uniqueId()
+ .addClass( "ui-corner-all" )
+ .attr({
+ tabIndex: -1,
+ role: this._itemRole()
+ });
+
+ // Initialize unlinked menu-items containing spaces and/or dashes only as dividers
+ menus.children( ":not(.ui-menu-item)" ).each(function() {
+ var item = $( this );
+ // hyphen, em dash, en dash
+ if ( !/[^\-—–\s]/.test( item.text() ) ) {
+ item.addClass( "ui-widget-content ui-menu-divider" );
+ }
+ });
+
+ // Add aria-disabled attribute to any disabled menu item
+ menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" );
+
+ // If the active item has been removed, blur the menu
+ if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+ this.blur();
+ }
+ },
+
+ _itemRole: function() {
+ return {
+ menu: "menuitem",
+ listbox: "option"
+ }[ this.options.role ];
+ },
+
+ focus: function( event, item ) {
+ var nested, focused;
+ this.blur( event, event && event.type === "focus" );
+
+ this._scrollIntoView( item );
+
+ this.active = item.first();
+ focused = this.active.children( "a" ).addClass( "ui-state-focus" );
+ // Only update aria-activedescendant if there's a role
+ // otherwise we assume focus is managed elsewhere
+ if ( this.options.role ) {
+ this.element.attr( "aria-activedescendant", focused.attr( "id" ) );
+ }
+
+ // Highlight active parent menu item, if any
+ this.active
+ .parent()
+ .closest( ".ui-menu-item" )
+ .children( "a:first" )
+ .addClass( "ui-state-active" );
+
+ if ( event && event.type === "keydown" ) {
+ this._close();
+ } else {
+ this.timer = this._delay(function() {
+ this._close();
+ }, this.delay );
+ }
+
+ nested = item.children( ".ui-menu" );
+ if ( nested.length && ( /^mouse/.test( event.type ) ) ) {
+ this._startOpening(nested);
+ }
+ this.activeMenu = item.parent();
+
+ this._trigger( "focus", event, { item: item } );
+ },
+
+ _scrollIntoView: function( item ) {
+ var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+ if ( this._hasScroll() ) {
+ borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0;
+ paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0;
+ offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+ scroll = this.activeMenu.scrollTop();
+ elementHeight = this.activeMenu.height();
+ itemHeight = item.height();
+
+ if ( offset < 0 ) {
+ this.activeMenu.scrollTop( scroll + offset );
+ } else if ( offset + itemHeight > elementHeight ) {
+ this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight );
+ }
+ }
+ },
+
+ blur: function( event, fromFocus ) {
+ if ( !fromFocus ) {
+ clearTimeout( this.timer );
+ }
+
+ if ( !this.active ) {
+ return;
+ }
+
+ this.active.children( "a" ).removeClass( "ui-state-focus" );
+ this.active = null;
+
+ this._trigger( "blur", event, { item: this.active } );
+ },
+
+ _startOpening: function( submenu ) {
+ clearTimeout( this.timer );
+
+ // Don't open if already open fixes a Firefox bug that caused a .5 pixel
+ // shift in the submenu position when mousing over the carat icon
+ if ( submenu.attr( "aria-hidden" ) !== "true" ) {
+ return;
+ }
+
+ this.timer = this._delay(function() {
+ this._close();
+ this._open( submenu );
+ }, this.delay );
+ },
+
+ _open: function( submenu ) {
+ var position = $.extend({
+ of: this.active
+ }, this.options.position );
+
+ clearTimeout( this.timer );
+ this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) )
+ .hide()
+ .attr( "aria-hidden", "true" );
+
+ submenu
+ .show()
+ .removeAttr( "aria-hidden" )
+ .attr( "aria-expanded", "true" )
+ .position( position );
+ },
+
+ collapseAll: function( event, all ) {
+ clearTimeout( this.timer );
+ this.timer = this._delay(function() {
+ // If we were passed an event, look for the submenu that contains the event
+ var currentMenu = all ? this.element :
+ $( event && event.target ).closest( this.element.find( ".ui-menu" ) );
+
+ // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway
+ if ( !currentMenu.length ) {
+ currentMenu = this.element;
+ }
+
+ this._close( currentMenu );
+
+ this.blur( event );
+ this.activeMenu = currentMenu;
+ }, this.delay );
+ },
+
+ // With no arguments, closes the currently active menu - if nothing is active
+ // it closes all menus. If passed an argument, it will search for menus BELOW
+ _close: function( startMenu ) {
+ if ( !startMenu ) {
+ startMenu = this.active ? this.active.parent() : this.element;
+ }
+
+ startMenu
+ .find( ".ui-menu" )
+ .hide()
+ .attr( "aria-hidden", "true" )
+ .attr( "aria-expanded", "false" )
+ .end()
+ .find( "a.ui-state-active" )
+ .removeClass( "ui-state-active" );
+ },
+
+ collapse: function( event ) {
+ var newItem = this.active &&
+ this.active.parent().closest( ".ui-menu-item", this.element );
+ if ( newItem && newItem.length ) {
+ this._close();
+ this.focus( event, newItem );
+ }
+ },
+
+ expand: function( event ) {
+ var newItem = this.active &&
+ this.active
+ .children( ".ui-menu " )
+ .children( ".ui-menu-item" )
+ .first();
+
+ if ( newItem && newItem.length ) {
+ this._open( newItem.parent() );
+
+ // Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+ this._delay(function() {
+ this.focus( event, newItem );
+ });
+ }
+ },
+
+ next: function( event ) {
+ this._move( "next", "first", event );
+ },
+
+ previous: function( event ) {
+ this._move( "prev", "last", event );
+ },
+
+ isFirstItem: function() {
+ return this.active && !this.active.prevAll( ".ui-menu-item" ).length;
+ },
+
+ isLastItem: function() {
+ return this.active && !this.active.nextAll( ".ui-menu-item" ).length;
+ },
+
+ _move: function( direction, filter, event ) {
+ var next;
+ if ( this.active ) {
+ if ( direction === "first" || direction === "last" ) {
+ next = this.active
+ [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" )
+ .eq( -1 );
+ } else {
+ next = this.active
+ [ direction + "All" ]( ".ui-menu-item" )
+ .eq( 0 );
+ }
+ }
+ if ( !next || !next.length || !this.active ) {
+ next = this.activeMenu.children( ".ui-menu-item" )[ filter ]();
+ }
+
+ this.focus( event, next );
+ },
+
+ nextPage: function( event ) {
+ var item, base, height;
+
+ if ( !this.active ) {
+ this.next( event );
+ return;
+ }
+ if ( this.isLastItem() ) {
+ return;
+ }
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.nextAll( ".ui-menu-item" ).each(function() {
+ item = $( this );
+ return item.offset().top - base - height < 0;
+ });
+
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.children( ".ui-menu-item" )
+ [ !this.active ? "first" : "last" ]() );
+ }
+ },
+
+ previousPage: function( event ) {
+ var item, base, height;
+ if ( !this.active ) {
+ this.next( event );
+ return;
+ }
+ if ( this.isFirstItem() ) {
+ return;
+ }
+ if ( this._hasScroll() ) {
+ base = this.active.offset().top;
+ height = this.element.height();
+ this.active.prevAll( ".ui-menu-item" ).each(function() {
+ item = $( this );
+ return item.offset().top - base + height > 0;
+ });
+
+ this.focus( event, item );
+ } else {
+ this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() );
+ }
+ },
+
+ _hasScroll: function() {
+ return this.element.outerHeight() < this.element.prop( "scrollHeight" );
+ },
+
+ select: function( event ) {
+ // TODO: It should never be possible to not have an active item at this
+ // point, but the tests don't trigger mouseenter before click.
+ this.active = this.active || $( event.target ).closest( ".ui-menu-item" );
+ var ui = { item: this.active };
+ if ( !this.active.has( ".ui-menu" ).length ) {
+ this.collapseAll( event, true );
+ }
+ this._trigger( "select", event, ui );
+ }
+});
+
+}( jQuery ));
+
(function( $, undefined ) {
$.ui = $.ui || {};
-var horizontalPositions = /left|center|right/,
- verticalPositions = /top|center|bottom/,
- center = "center",
- _position = $.fn.position,
- _offset = $.fn.offset;
+var cachedScrollbarWidth,
+ max = Math.max,
+ abs = Math.abs,
+ round = Math.round,
+ rhorizontal = /left|center|right/,
+ rvertical = /top|center|bottom/,
+ roffset = /[\+\-]\d+%?/,
+ rposition = /^\w+/,
+ rpercent = /%$/,
+ _position = $.fn.position;
+
+function getOffsets( offsets, width, height ) {
+ return [
+ parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
+ parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
+ ];
+}
+function parseCss( element, property ) {
+ return parseInt( $.css( element, property ), 10 ) || 0;
+}
+
+$.position = {
+ scrollbarWidth: function() {
+ if ( cachedScrollbarWidth !== undefined ) {
+ return cachedScrollbarWidth;
+ }
+ var w1, w2,
+ div = $( "<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>" ),
+ innerDiv = div.children()[0];
+
+ $( "body" ).append( div );
+ w1 = innerDiv.offsetWidth;
+ div.css( "overflow", "scroll" );
+
+ w2 = innerDiv.offsetWidth;
+
+ if ( w1 === w2 ) {
+ w2 = div[0].clientWidth;
+ }
+
+ div.remove();
+
+ return (cachedScrollbarWidth = w1 - w2);
+ },
+ getScrollInfo: function( within ) {
+ var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ),
+ overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ),
+ hasOverflowX = overflowX === "scroll" ||
+ ( overflowX === "auto" && within.width < within.element[0].scrollWidth ),
+ hasOverflowY = overflowY === "scroll" ||
+ ( overflowY === "auto" && within.height < within.element[0].scrollHeight );
+ return {
+ width: hasOverflowX ? $.position.scrollbarWidth() : 0,
+ height: hasOverflowY ? $.position.scrollbarWidth() : 0
+ };
+ },
+ getWithinInfo: function( element ) {
+ var withinElement = $( element || window ),
+ isWindow = $.isWindow( withinElement[0] );
+ return {
+ element: withinElement,
+ isWindow: isWindow,
+ offset: withinElement.offset() || { left: 0, top: 0 },
+ scrollLeft: withinElement.scrollLeft(),
+ scrollTop: withinElement.scrollTop(),
+ width: isWindow ? withinElement.width() : withinElement.outerWidth(),
+ height: isWindow ? withinElement.height() : withinElement.outerHeight()
+ };
+ }
+};
$.fn.position = function( options ) {
if ( !options || !options.of ) {
@@ -10007,48 +11563,65 @@ $.fn.position = function( options ) {
// make a copy, we don't want to modify arguments
options = $.extend( {}, options );
- var target = $( options.of ),
+ var atOffset, targetWidth, targetHeight, targetOffset, basePosition,
+ target = $( options.of ),
+ within = $.position.getWithinInfo( options.within ),
+ scrollInfo = $.position.getScrollInfo( within ),
targetElem = target[0],
collision = ( options.collision || "flip" ).split( " " ),
- offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
- targetWidth,
- targetHeight,
- basePosition;
+ offsets = {};
if ( targetElem.nodeType === 9 ) {
targetWidth = target.width();
targetHeight = target.height();
- basePosition = { top: 0, left: 0 };
- // TODO: use $.isWindow() in 1.9
- } else if ( targetElem.setTimeout ) {
+ targetOffset = { top: 0, left: 0 };
+ } else if ( $.isWindow( targetElem ) ) {
targetWidth = target.width();
targetHeight = target.height();
- basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ targetOffset = { top: target.scrollTop(), left: target.scrollLeft() };
} else if ( targetElem.preventDefault ) {
// force left top to allow flipping
options.at = "left top";
targetWidth = targetHeight = 0;
- basePosition = { top: options.of.pageY, left: options.of.pageX };
+ targetOffset = { top: targetElem.pageY, left: targetElem.pageX };
} else {
targetWidth = target.outerWidth();
targetHeight = target.outerHeight();
- basePosition = target.offset();
+ targetOffset = target.offset();
}
+ // clone to reuse original targetOffset later
+ basePosition = $.extend( {}, targetOffset );
- // force my and at to have valid horizontal and veritcal positions
- // if a value is missing or invalid, it will be converted to center
+ // force my and at to have valid horizontal and vertical positions
+ // if a value is missing or invalid, it will be converted to center
$.each( [ "my", "at" ], function() {
- var pos = ( options[this] || "" ).split( " " );
+ var pos = ( options[ this ] || "" ).split( " " ),
+ horizontalOffset,
+ verticalOffset;
+
if ( pos.length === 1) {
- pos = horizontalPositions.test( pos[0] ) ?
- pos.concat( [center] ) :
- verticalPositions.test( pos[0] ) ?
- [ center ].concat( pos ) :
- [ center, center ];
- }
- pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : center;
- pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : center;
- options[ this ] = pos;
+ pos = rhorizontal.test( pos[ 0 ] ) ?
+ pos.concat( [ "center" ] ) :
+ rvertical.test( pos[ 0 ] ) ?
+ [ "center" ].concat( pos ) :
+ [ "center", "center" ];
+ }
+ pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
+ pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
+
+ // calculate offsets
+ horizontalOffset = roffset.exec( pos[ 0 ] );
+ verticalOffset = roffset.exec( pos[ 1 ] );
+ offsets[ this ] = [
+ horizontalOffset ? horizontalOffset[ 0 ] : 0,
+ verticalOffset ? verticalOffset[ 0 ] : 0
+ ];
+
+ // reduce to just the positions without the offsets
+ options[ this ] = [
+ rposition.exec( pos[ 0 ] )[ 0 ],
+ rposition.exec( pos[ 1 ] )[ 0 ]
+ ];
});
// normalize collision option
@@ -10056,65 +11629,63 @@ $.fn.position = function( options ) {
collision[ 1 ] = collision[ 0 ];
}
- // normalize offset option
- offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
- if ( offset.length === 1 ) {
- offset[ 1 ] = offset[ 0 ];
- }
- offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
-
- if ( options.at[0] === "right" ) {
+ if ( options.at[ 0 ] === "right" ) {
basePosition.left += targetWidth;
- } else if ( options.at[0] === center ) {
+ } else if ( options.at[ 0 ] === "center" ) {
basePosition.left += targetWidth / 2;
}
- if ( options.at[1] === "bottom" ) {
+ if ( options.at[ 1 ] === "bottom" ) {
basePosition.top += targetHeight;
- } else if ( options.at[1] === center ) {
+ } else if ( options.at[ 1 ] === "center" ) {
basePosition.top += targetHeight / 2;
}
- basePosition.left += offset[ 0 ];
- basePosition.top += offset[ 1 ];
+ atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
+ basePosition.left += atOffset[ 0 ];
+ basePosition.top += atOffset[ 1 ];
return this.each(function() {
- var elem = $( this ),
+ var collisionPosition, using,
+ elem = $( this ),
elemWidth = elem.outerWidth(),
elemHeight = elem.outerHeight(),
- marginLeft = parseInt( $.curCSS( this, "marginLeft", true ) ) || 0,
- marginTop = parseInt( $.curCSS( this, "marginTop", true ) ) || 0,
- collisionWidth = elemWidth + marginLeft +
- ( parseInt( $.curCSS( this, "marginRight", true ) ) || 0 ),
- collisionHeight = elemHeight + marginTop +
- ( parseInt( $.curCSS( this, "marginBottom", true ) ) || 0 ),
+ marginLeft = parseCss( this, "marginLeft" ),
+ marginTop = parseCss( this, "marginTop" ),
+ collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width,
+ collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height,
position = $.extend( {}, basePosition ),
- collisionPosition;
+ myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
- if ( options.my[0] === "right" ) {
+ if ( options.my[ 0 ] === "right" ) {
position.left -= elemWidth;
- } else if ( options.my[0] === center ) {
+ } else if ( options.my[ 0 ] === "center" ) {
position.left -= elemWidth / 2;
}
- if ( options.my[1] === "bottom" ) {
+ if ( options.my[ 1 ] === "bottom" ) {
position.top -= elemHeight;
- } else if ( options.my[1] === center ) {
+ } else if ( options.my[ 1 ] === "center" ) {
position.top -= elemHeight / 2;
}
- // prevent fractions (see #5280)
- position.left = Math.round( position.left );
- position.top = Math.round( position.top );
+ position.left += myOffset[ 0 ];
+ position.top += myOffset[ 1 ];
+
+ // if the browser doesn't support fractions, then round for consistent results
+ if ( !$.support.offsetFractions ) {
+ position.left = round( position.left );
+ position.top = round( position.top );
+ }
collisionPosition = {
- left: position.left - marginLeft,
- top: position.top - marginTop
+ marginLeft: marginLeft,
+ marginTop: marginTop
};
$.each( [ "left", "top" ], function( i, dir ) {
- if ( $.ui.position[ collision[i] ] ) {
- $.ui.position[ collision[i] ][ dir ]( position, {
+ if ( $.ui.position[ collision[ i ] ] ) {
+ $.ui.position[ collision[ i ] ][ dir ]( position, {
targetWidth: targetWidth,
targetHeight: targetHeight,
elemWidth: elemWidth,
@@ -10122,9 +11693,11 @@ $.fn.position = function( options ) {
collisionPosition: collisionPosition,
collisionWidth: collisionWidth,
collisionHeight: collisionHeight,
- offset: offset,
+ offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
my: options.my,
- at: options.at
+ at: options.at,
+ within: within,
+ elem : elem
});
}
});
@@ -10132,31 +11705,137 @@ $.fn.position = function( options ) {
if ( $.fn.bgiframe ) {
elem.bgiframe();
}
- elem.offset( $.extend( position, { using: options.using } ) );
+
+ if ( options.using ) {
+ // adds feedback as second argument to using callback, if present
+ using = function( props ) {
+ var left = targetOffset.left - position.left,
+ right = left + targetWidth - elemWidth,
+ top = targetOffset.top - position.top,
+ bottom = top + targetHeight - elemHeight,
+ feedback = {
+ target: {
+ element: target,
+ left: targetOffset.left,
+ top: targetOffset.top,
+ width: targetWidth,
+ height: targetHeight
+ },
+ element: {
+ element: elem,
+ left: position.left,
+ top: position.top,
+ width: elemWidth,
+ height: elemHeight
+ },
+ horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+ vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+ };
+ if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
+ feedback.horizontal = "center";
+ }
+ if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
+ feedback.vertical = "middle";
+ }
+ if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
+ feedback.important = "horizontal";
+ } else {
+ feedback.important = "vertical";
+ }
+ options.using.call( this, props, feedback );
+ };
+ }
+
+ elem.offset( $.extend( position, { using: using } ) );
});
};
$.ui.position = {
fit: {
left: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft();
- position.left = over > 0 ? position.left - over : Math.max( position.left - data.collisionPosition.left, position.left );
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+ outerWidth = within.width,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = withinOffset - collisionPosLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+ newOverRight;
+
+ // element is wider than within
+ if ( data.collisionWidth > outerWidth ) {
+ // element is initially over the left side of within
+ if ( overLeft > 0 && overRight <= 0 ) {
+ newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset;
+ position.left += overLeft - newOverRight;
+ // element is initially over right side of within
+ } else if ( overRight > 0 && overLeft <= 0 ) {
+ position.left = withinOffset;
+ // element is initially over both left and right sides of within
+ } else {
+ if ( overLeft > overRight ) {
+ position.left = withinOffset + outerWidth - data.collisionWidth;
+ } else {
+ position.left = withinOffset;
+ }
+ }
+ // too far left -> align with left edge
+ } else if ( overLeft > 0 ) {
+ position.left += overLeft;
+ // too far right -> align with right edge
+ } else if ( overRight > 0 ) {
+ position.left -= overRight;
+ // adjust based on position and margin
+ } else {
+ position.left = max( position.left - collisionPosLeft, position.left );
+ }
},
top: function( position, data ) {
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop();
- position.top = over > 0 ? position.top - over : Math.max( position.top - data.collisionPosition.top, position.top );
+ var within = data.within,
+ withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+ outerHeight = data.within.height,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = withinOffset - collisionPosTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+ newOverBottom;
+
+ // element is taller than within
+ if ( data.collisionHeight > outerHeight ) {
+ // element is initially over the top of within
+ if ( overTop > 0 && overBottom <= 0 ) {
+ newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset;
+ position.top += overTop - newOverBottom;
+ // element is initially over bottom of within
+ } else if ( overBottom > 0 && overTop <= 0 ) {
+ position.top = withinOffset;
+ // element is initially over both top and bottom of within
+ } else {
+ if ( overTop > overBottom ) {
+ position.top = withinOffset + outerHeight - data.collisionHeight;
+ } else {
+ position.top = withinOffset;
+ }
+ }
+ // too far up -> align with top
+ } else if ( overTop > 0 ) {
+ position.top += overTop;
+ // too far down -> align with bottom edge
+ } else if ( overBottom > 0 ) {
+ position.top -= overBottom;
+ // adjust based on position and margin
+ } else {
+ position.top = max( position.top - collisionPosTop, position.top );
+ }
}
},
-
flip: {
left: function( position, data ) {
- if ( data.at[0] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.left + data.collisionWidth - win.width() - win.scrollLeft(),
+ var within = data.within,
+ withinOffset = within.offset.left + within.scrollLeft,
+ outerWidth = within.width,
+ offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+ collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+ overLeft = collisionPosLeft - offsetLeft,
+ overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
myOffset = data.my[ 0 ] === "left" ?
-data.elemWidth :
data.my[ 0 ] === "right" ?
@@ -10164,90 +11843,155 @@ $.ui.position = {
0,
atOffset = data.at[ 0 ] === "left" ?
data.targetWidth :
- -data.targetWidth,
- offset = -2 * data.offset[ 0 ];
- position.left += data.collisionPosition.left < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
+ data.at[ 0 ] === "right" ?
+ -data.targetWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ],
+ newOverRight,
+ newOverLeft;
+
+ if ( overLeft < 0 ) {
+ newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset;
+ if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
+ else if ( overRight > 0 ) {
+ newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft;
+ if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
+ position.left += myOffset + atOffset + offset;
+ }
+ }
},
top: function( position, data ) {
- if ( data.at[1] === center ) {
- return;
- }
- var win = $( window ),
- over = data.collisionPosition.top + data.collisionHeight - win.height() - win.scrollTop(),
- myOffset = data.my[ 1 ] === "top" ?
+ var within = data.within,
+ withinOffset = within.offset.top + within.scrollTop,
+ outerHeight = within.height,
+ offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+ collisionPosTop = position.top - data.collisionPosition.marginTop,
+ overTop = collisionPosTop - offsetTop,
+ overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+ top = data.my[ 1 ] === "top",
+ myOffset = top ?
-data.elemHeight :
data.my[ 1 ] === "bottom" ?
data.elemHeight :
0,
atOffset = data.at[ 1 ] === "top" ?
data.targetHeight :
- -data.targetHeight,
- offset = -2 * data.offset[ 1 ];
- position.top += data.collisionPosition.top < 0 ?
- myOffset + atOffset + offset :
- over > 0 ?
- myOffset + atOffset + offset :
- 0;
+ data.at[ 1 ] === "bottom" ?
+ -data.targetHeight :
+ 0,
+ offset = -2 * data.offset[ 1 ],
+ newOverTop,
+ newOverBottom;
+ if ( overTop < 0 ) {
+ newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset;
+ if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) {
+ position.top += myOffset + atOffset + offset;
+ }
+ }
+ else if ( overBottom > 0 ) {
+ newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop;
+ if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) {
+ position.top += myOffset + atOffset + offset;
+ }
+ }
+ }
+ },
+ flipfit: {
+ left: function() {
+ $.ui.position.flip.left.apply( this, arguments );
+ $.ui.position.fit.left.apply( this, arguments );
+ },
+ top: function() {
+ $.ui.position.flip.top.apply( this, arguments );
+ $.ui.position.fit.top.apply( this, arguments );
}
}
};
-// offset setter from jQuery 1.4
-if ( !$.offset.setOffset ) {
- $.offset.setOffset = function( elem, options ) {
- // set position first, in-case top/left are set even on static elem
- if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
- elem.style.position = "relative";
- }
- var curElem = $( elem ),
- curOffset = curElem.offset(),
- curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
- curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
- props = {
- top: (options.top - curOffset.top) + curTop,
- left: (options.left - curOffset.left) + curLeft
- };
-
- if ( 'using' in options ) {
- options.using.call( elem, props );
- } else {
- curElem.css( props );
- }
- };
-
- $.fn.offset = function( options ) {
- var elem = this[ 0 ];
- if ( !elem || !elem.ownerDocument ) { return null; }
- if ( options ) {
- return this.each(function() {
- $.offset.setOffset( this, options );
- });
- }
- return _offset.call( this );
+// fraction support test
+(function () {
+ var testElement, testElementParent, testElementStyle, offsetLeft, i,
+ body = document.getElementsByTagName( "body" )[ 0 ],
+ div = document.createElement( "div" );
+
+ //Create a "fake body" for testing based on method used in jQuery.support
+ testElement = document.createElement( body ? "div" : "body" );
+ testElementStyle = {
+ visibility: "hidden",
+ width: 0,
+ height: 0,
+ border: 0,
+ margin: 0,
+ background: "none"
};
+ if ( body ) {
+ $.extend( testElementStyle, {
+ position: "absolute",
+ left: "-1000px",
+ top: "-1000px"
+ });
+ }
+ for ( i in testElementStyle ) {
+ testElement.style[ i ] = testElementStyle[ i ];
+ }
+ testElement.appendChild( div );
+ testElementParent = body || document.documentElement;
+ testElementParent.insertBefore( testElement, testElementParent.firstChild );
+
+ div.style.cssText = "position: absolute; left: 10.7432222px;";
+
+ offsetLeft = $( div ).offset().left;
+ $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11;
+
+ testElement.innerHTML = "";
+ testElementParent.removeChild( testElement );
+})();
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+ // offset option
+ (function( $ ) {
+ var _position = $.fn.position;
+ $.fn.position = function( options ) {
+ if ( !options || !options.offset ) {
+ return _position.call( this, options );
+ }
+ var offset = options.offset.split( " " ),
+ at = options.at.split( " " );
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ if ( /^\d/.test( offset[ 0 ] ) ) {
+ offset[ 0 ] = "+" + offset[ 0 ];
+ }
+ if ( /^\d/.test( offset[ 1 ] ) ) {
+ offset[ 1 ] = "+" + offset[ 1 ];
+ }
+ if ( at.length === 1 ) {
+ if ( /left|center|right/.test( at[ 0 ] ) ) {
+ at[ 1 ] = "center";
+ } else {
+ at[ 1 ] = at[ 0 ];
+ at[ 0 ] = "center";
+ }
+ }
+ return _position.call( this, $.extend( options, {
+ at: at[ 0 ] + offset[ 0 ] + " " + at[ 1 ] + offset[ 1 ],
+ offset: undefined
+ } ) );
+ };
+ }( jQuery ) );
}
-}( jQuery ));
-/*
- * jQuery UI Progressbar 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
+}( jQuery ) );
+
(function( $, undefined ) {
$.widget( "ui.progressbar", {
+ version: "1.9.2",
options: {
value: 0,
max: 100
@@ -10272,7 +12016,7 @@ $.widget( "ui.progressbar", {
this._refreshValue();
},
- destroy: function() {
+ _destroy: function() {
this.element
.removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
.removeAttr( "role" )
@@ -10281,8 +12025,6 @@ $.widget( "ui.progressbar", {
.removeAttr( "aria-valuenow" );
this.valueDiv.remove();
-
- $.Widget.prototype.destroy.apply( this, arguments );
},
value: function( newValue ) {
@@ -10303,7 +12045,7 @@ $.widget( "ui.progressbar", {
}
}
- $.Widget.prototype._setOption.apply( this, arguments );
+ this._super( key, value );
},
_value: function() {
@@ -10320,8 +12062,8 @@ $.widget( "ui.progressbar", {
},
_refreshValue: function() {
- var value = this.value();
- var percentage = this._percentage();
+ var value = this.value(),
+ percentage = this._percentage();
if ( this.oldValue !== value ) {
this.oldValue = value;
@@ -10336,25 +12078,8 @@ $.widget( "ui.progressbar", {
}
});
-$.extend( $.ui.progressbar, {
- version: "1.8.16"
-});
-
})( jQuery );
-/*
- * jQuery UI Slider 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.mouse.js
- * jquery.ui.widget.js
- */
+
(function( $, undefined ) {
// number of pages in a slider
@@ -10362,7 +12087,7 @@ $.extend( $.ui.progressbar, {
var numPages = 5;
$.widget( "ui.slider", $.ui.mouse, {
-
+ version: "1.9.2",
widgetEventPrefix: "slide",
options: {
@@ -10378,11 +12103,10 @@ $.widget( "ui.slider", $.ui.mouse, {
},
_create: function() {
- var self = this,
+ var i, handleCount,
o = this.options,
existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ),
handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>",
- handleCount = ( o.values && o.values.length ) || 1,
handles = [];
this._keySliding = false;
@@ -10417,15 +12141,17 @@ $.widget( "ui.slider", $.ui.mouse, {
.addClass( "ui-slider-range" +
// note: this isn't the most fittingly semantic framework class for this element,
// but worked best visually with a variety of themes
- " ui-widget-header" +
+ " ui-widget-header" +
( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) );
}
- for ( var i = existingHandles.length; i < handleCount; i += 1 ) {
+ handleCount = ( o.values && o.values.length ) || 1;
+
+ for ( i = existingHandles.length; i < handleCount; i++ ) {
handles.push( handle );
}
- this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( self.element ) );
+ this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) );
this.handle = this.handles.eq( 0 );
@@ -10433,11 +12159,12 @@ $.widget( "ui.slider", $.ui.mouse, {
.click(function( event ) {
event.preventDefault();
})
- .hover(function() {
+ .mouseenter(function() {
if ( !o.disabled ) {
$( this ).addClass( "ui-state-hover" );
}
- }, function() {
+ })
+ .mouseleave(function() {
$( this ).removeClass( "ui-state-hover" );
})
.focus(function() {
@@ -10453,22 +12180,14 @@ $.widget( "ui.slider", $.ui.mouse, {
});
this.handles.each(function( i ) {
- $( this ).data( "index.ui-slider-handle", i );
+ $( this ).data( "ui-slider-handle-index", i );
});
- this.handles
- .keydown(function( event ) {
- var ret = true,
- index = $( this ).data( "index.ui-slider-handle" ),
- allowed,
- curVal,
- newVal,
- step;
-
- if ( self.options.disabled ) {
- return;
- }
-
+ this._on( this.handles, {
+ keydown: function( event ) {
+ var allowed, curVal, newVal, step,
+ index = $( event.target ).data( "ui-slider-handle-index" );
+
switch ( event.keyCode ) {
case $.ui.keyCode.HOME:
case $.ui.keyCode.END:
@@ -10478,77 +12197,74 @@ $.widget( "ui.slider", $.ui.mouse, {
case $.ui.keyCode.RIGHT:
case $.ui.keyCode.DOWN:
case $.ui.keyCode.LEFT:
- ret = false;
- if ( !self._keySliding ) {
- self._keySliding = true;
- $( this ).addClass( "ui-state-active" );
- allowed = self._start( event, index );
+ event.preventDefault();
+ if ( !this._keySliding ) {
+ this._keySliding = true;
+ $( event.target ).addClass( "ui-state-active" );
+ allowed = this._start( event, index );
if ( allowed === false ) {
return;
}
}
break;
}
-
- step = self.options.step;
- if ( self.options.values && self.options.values.length ) {
- curVal = newVal = self.values( index );
+
+ step = this.options.step;
+ if ( this.options.values && this.options.values.length ) {
+ curVal = newVal = this.values( index );
} else {
- curVal = newVal = self.value();
+ curVal = newVal = this.value();
}
-
+
switch ( event.keyCode ) {
case $.ui.keyCode.HOME:
- newVal = self._valueMin();
+ newVal = this._valueMin();
break;
case $.ui.keyCode.END:
- newVal = self._valueMax();
+ newVal = this._valueMax();
break;
case $.ui.keyCode.PAGE_UP:
- newVal = self._trimAlignValue( curVal + ( (self._valueMax() - self._valueMin()) / numPages ) );
+ newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) );
break;
case $.ui.keyCode.PAGE_DOWN:
- newVal = self._trimAlignValue( curVal - ( (self._valueMax() - self._valueMin()) / numPages ) );
+ newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) );
break;
case $.ui.keyCode.UP:
case $.ui.keyCode.RIGHT:
- if ( curVal === self._valueMax() ) {
+ if ( curVal === this._valueMax() ) {
return;
}
- newVal = self._trimAlignValue( curVal + step );
+ newVal = this._trimAlignValue( curVal + step );
break;
case $.ui.keyCode.DOWN:
case $.ui.keyCode.LEFT:
- if ( curVal === self._valueMin() ) {
+ if ( curVal === this._valueMin() ) {
return;
}
- newVal = self._trimAlignValue( curVal - step );
+ newVal = this._trimAlignValue( curVal - step );
break;
}
-
- self._slide( event, index, newVal );
-
- return ret;
-
- })
- .keyup(function( event ) {
- var index = $( this ).data( "index.ui-slider-handle" );
-
- if ( self._keySliding ) {
- self._keySliding = false;
- self._stop( event, index );
- self._change( event, index );
- $( this ).removeClass( "ui-state-active" );
+
+ this._slide( event, index, newVal );
+ },
+ keyup: function( event ) {
+ var index = $( event.target ).data( "ui-slider-handle-index" );
+
+ if ( this._keySliding ) {
+ this._keySliding = false;
+ this._stop( event, index );
+ this._change( event, index );
+ $( event.target ).removeClass( "ui-state-active" );
}
-
- });
+ }
+ });
this._refreshValue();
this._animateOff = false;
},
- destroy: function() {
+ _destroy: function() {
this.handles.remove();
this.range.remove();
@@ -10559,26 +12275,15 @@ $.widget( "ui.slider", $.ui.mouse, {
" ui-slider-disabled" +
" ui-widget" +
" ui-widget-content" +
- " ui-corner-all" )
- .removeData( "slider" )
- .unbind( ".slider" );
+ " ui-corner-all" );
this._mouseDestroy();
-
- return this;
},
_mouseCapture: function( event ) {
- var o = this.options,
- position,
- normValue,
- distance,
- closestHandle,
- self,
- index,
- allowed,
- offset,
- mouseOverHandle;
+ var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+ that = this,
+ o = this.options;
if ( o.disabled ) {
return false;
@@ -10593,9 +12298,8 @@ $.widget( "ui.slider", $.ui.mouse, {
position = { x: event.pageX, y: event.pageY };
normValue = this._normValueFromMouse( position );
distance = this._valueMax() - this._valueMin() + 1;
- self = this;
this.handles.each(function( i ) {
- var thisDistance = Math.abs( normValue - self.values(i) );
+ var thisDistance = Math.abs( normValue - that.values(i) );
if ( distance > thisDistance ) {
distance = thisDistance;
closestHandle = $( this );
@@ -10617,12 +12321,12 @@ $.widget( "ui.slider", $.ui.mouse, {
}
this._mouseSliding = true;
- self._handleIndex = index;
+ this._handleIndex = index;
closestHandle
.addClass( "ui-state-active" )
.focus();
-
+
offset = closestHandle.offset();
mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
@@ -10641,14 +12345,14 @@ $.widget( "ui.slider", $.ui.mouse, {
return true;
},
- _mouseStart: function( event ) {
+ _mouseStart: function() {
return true;
},
_mouseDrag: function( event ) {
var position = { x: event.pageX, y: event.pageY },
normValue = this._normValueFromMouse( position );
-
+
this._slide( event, this._handleIndex, normValue );
return false;
@@ -10667,7 +12371,7 @@ $.widget( "ui.slider", $.ui.mouse, {
return false;
},
-
+
_detectOrientation: function() {
this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
},
@@ -10724,7 +12428,7 @@ $.widget( "ui.slider", $.ui.mouse, {
if ( this.options.values && this.options.values.length ) {
otherVal = this.values( index ? 0 : 1 );
- if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
) {
newVal = otherVal;
@@ -10845,10 +12549,10 @@ $.widget( "ui.slider", $.ui.mouse, {
if ( value ) {
this.handles.filter( ".ui-state-focus" ).blur();
this.handles.removeClass( "ui-state-hover" );
- this.handles.propAttr( "disabled", true );
+ this.handles.prop( "disabled", true );
this.element.addClass( "ui-disabled" );
} else {
- this.handles.propAttr( "disabled", false );
+ this.handles.prop( "disabled", false );
this.element.removeClass( "ui-disabled" );
}
break;
@@ -10873,6 +12577,12 @@ $.widget( "ui.slider", $.ui.mouse, {
}
this._animateOff = false;
break;
+ case "min":
+ case "max":
+ this._animateOff = true;
+ this._refreshValue();
+ this._animateOff = false;
+ break;
}
},
@@ -10909,7 +12619,7 @@ $.widget( "ui.slider", $.ui.mouse, {
return vals;
}
},
-
+
// returns the step-aligned value that val is closest to, between (inclusive) min and max
_trimAlignValue: function( val ) {
if ( val <= this._valueMin() ) {
@@ -10938,38 +12648,34 @@ $.widget( "ui.slider", $.ui.mouse, {
_valueMax: function() {
return this.options.max;
},
-
+
_refreshValue: function() {
- var oRange = this.options.range,
+ var lastValPercent, valPercent, value, valueMin, valueMax,
+ oRange = this.options.range,
o = this.options,
- self = this,
+ that = this,
animate = ( !this._animateOff ) ? o.animate : false,
- valPercent,
- _set = {},
- lastValPercent,
- value,
- valueMin,
- valueMax;
+ _set = {};
if ( this.options.values && this.options.values.length ) {
- this.handles.each(function( i, j ) {
- valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
- _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handles.each(function( i ) {
+ valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100;
+ _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
- if ( self.options.range === true ) {
- if ( self.orientation === "horizontal" ) {
+ if ( that.options.range === true ) {
+ if ( that.orientation === "horizontal" ) {
if ( i === 0 ) {
- self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
}
if ( i === 1 ) {
- self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
}
} else {
if ( i === 0 ) {
- self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
}
if ( i === 1 ) {
- self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
}
}
}
@@ -10982,7 +12688,7 @@ $.widget( "ui.slider", $.ui.mouse, {
valPercent = ( valueMax !== valueMin ) ?
( value - valueMin ) / ( valueMax - valueMin ) * 100 :
0;
- _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
if ( oRange === "min" && this.orientation === "horizontal" ) {
@@ -11002,766 +12708,2205 @@ $.widget( "ui.slider", $.ui.mouse, {
});
-$.extend( $.ui.slider, {
- version: "1.8.16"
+}(jQuery));
+
+(function( $ ) {
+
+function modifier( fn ) {
+ return function() {
+ var previous = this.element.val();
+ fn.apply( this, arguments );
+ this._refresh();
+ if ( previous !== this.element.val() ) {
+ this._trigger( "change" );
+ }
+ };
+}
+
+$.widget( "ui.spinner", {
+ version: "1.9.2",
+ defaultElement: "<input>",
+ widgetEventPrefix: "spin",
+ options: {
+ culture: null,
+ icons: {
+ down: "ui-icon-triangle-1-s",
+ up: "ui-icon-triangle-1-n"
+ },
+ incremental: true,
+ max: null,
+ min: null,
+ numberFormat: null,
+ page: 10,
+ step: 1,
+
+ change: null,
+ spin: null,
+ start: null,
+ stop: null
+ },
+
+ _create: function() {
+ // handle string values that need to be parsed
+ this._setOption( "max", this.options.max );
+ this._setOption( "min", this.options.min );
+ this._setOption( "step", this.options.step );
+
+ // format the value, but don't constrain
+ this._value( this.element.val(), true );
+
+ this._draw();
+ this._on( this._events );
+ this._refresh();
+
+ // turning off autocomplete prevents the browser from remembering the
+ // value when navigating through history, so we re-enable autocomplete
+ // if the page is unloaded before the widget is destroyed. #7790
+ this._on( this.window, {
+ beforeunload: function() {
+ this.element.removeAttr( "autocomplete" );
+ }
+ });
+ },
+
+ _getCreateOptions: function() {
+ var options = {},
+ element = this.element;
+
+ $.each( [ "min", "max", "step" ], function( i, option ) {
+ var value = element.attr( option );
+ if ( value !== undefined && value.length ) {
+ options[ option ] = value;
+ }
+ });
+
+ return options;
+ },
+
+ _events: {
+ keydown: function( event ) {
+ if ( this._start( event ) && this._keydown( event ) ) {
+ event.preventDefault();
+ }
+ },
+ keyup: "_stop",
+ focus: function() {
+ this.previous = this.element.val();
+ },
+ blur: function( event ) {
+ if ( this.cancelBlur ) {
+ delete this.cancelBlur;
+ return;
+ }
+
+ this._refresh();
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event );
+ }
+ },
+ mousewheel: function( event, delta ) {
+ if ( !delta ) {
+ return;
+ }
+ if ( !this.spinning && !this._start( event ) ) {
+ return false;
+ }
+
+ this._spin( (delta > 0 ? 1 : -1) * this.options.step, event );
+ clearTimeout( this.mousewheelTimer );
+ this.mousewheelTimer = this._delay(function() {
+ if ( this.spinning ) {
+ this._stop( event );
+ }
+ }, 100 );
+ event.preventDefault();
+ },
+ "mousedown .ui-spinner-button": function( event ) {
+ var previous;
+
+ // We never want the buttons to have focus; whenever the user is
+ // interacting with the spinner, the focus should be on the input.
+ // If the input is focused then this.previous is properly set from
+ // when the input first received focus. If the input is not focused
+ // then we need to set this.previous based on the value before spinning.
+ previous = this.element[0] === this.document[0].activeElement ?
+ this.previous : this.element.val();
+ function checkFocus() {
+ var isActive = this.element[0] === this.document[0].activeElement;
+ if ( !isActive ) {
+ this.element.focus();
+ this.previous = previous;
+ // support: IE
+ // IE sets focus asynchronously, so we need to check if focus
+ // moved off of the input because the user clicked on the button.
+ this._delay(function() {
+ this.previous = previous;
+ });
+ }
+ }
+
+ // ensure focus is on (or stays on) the text field
+ event.preventDefault();
+ checkFocus.call( this );
+
+ // support: IE
+ // IE doesn't prevent moving focus even with event.preventDefault()
+ // so we set a flag to know when we should ignore the blur event
+ // and check (again) if focus moved off of the input.
+ this.cancelBlur = true;
+ this._delay(function() {
+ delete this.cancelBlur;
+ checkFocus.call( this );
+ });
+
+ if ( this._start( event ) === false ) {
+ return;
+ }
+
+ this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+ "mouseup .ui-spinner-button": "_stop",
+ "mouseenter .ui-spinner-button": function( event ) {
+ // button will add ui-state-active if mouse was down while mouseleave and kept down
+ if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) {
+ return;
+ }
+
+ if ( this._start( event ) === false ) {
+ return false;
+ }
+ this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+ },
+ // TODO: do we really want to consider this a stop?
+ // shouldn't we just stop the repeater and wait until mouseup before
+ // we trigger the stop event?
+ "mouseleave .ui-spinner-button": "_stop"
+ },
+
+ _draw: function() {
+ var uiSpinner = this.uiSpinner = this.element
+ .addClass( "ui-spinner-input" )
+ .attr( "autocomplete", "off" )
+ .wrap( this._uiSpinnerHtml() )
+ .parent()
+ // add buttons
+ .append( this._buttonHtml() );
+
+ this.element.attr( "role", "spinbutton" );
+
+ // button bindings
+ this.buttons = uiSpinner.find( ".ui-spinner-button" )
+ .attr( "tabIndex", -1 )
+ .button()
+ .removeClass( "ui-corner-all" );
+
+ // IE 6 doesn't understand height: 50% for the buttons
+ // unless the wrapper has an explicit height
+ if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) &&
+ uiSpinner.height() > 0 ) {
+ uiSpinner.height( uiSpinner.height() );
+ }
+
+ // disable spinner if element was already disabled
+ if ( this.options.disabled ) {
+ this.disable();
+ }
+ },
+
+ _keydown: function( event ) {
+ var options = this.options,
+ keyCode = $.ui.keyCode;
+
+ switch ( event.keyCode ) {
+ case keyCode.UP:
+ this._repeat( null, 1, event );
+ return true;
+ case keyCode.DOWN:
+ this._repeat( null, -1, event );
+ return true;
+ case keyCode.PAGE_UP:
+ this._repeat( null, options.page, event );
+ return true;
+ case keyCode.PAGE_DOWN:
+ this._repeat( null, -options.page, event );
+ return true;
+ }
+
+ return false;
+ },
+
+ _uiSpinnerHtml: function() {
+ return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>";
+ },
+
+ _buttonHtml: function() {
+ return "" +
+ "<a class='ui-spinner-button ui-spinner-up ui-corner-tr'>" +
+ "<span class='ui-icon " + this.options.icons.up + "'>&#9650;</span>" +
+ "</a>" +
+ "<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" +
+ "<span class='ui-icon " + this.options.icons.down + "'>&#9660;</span>" +
+ "</a>";
+ },
+
+ _start: function( event ) {
+ if ( !this.spinning && this._trigger( "start", event ) === false ) {
+ return false;
+ }
+
+ if ( !this.counter ) {
+ this.counter = 1;
+ }
+ this.spinning = true;
+ return true;
+ },
+
+ _repeat: function( i, steps, event ) {
+ i = i || 500;
+
+ clearTimeout( this.timer );
+ this.timer = this._delay(function() {
+ this._repeat( 40, steps, event );
+ }, i );
+
+ this._spin( steps * this.options.step, event );
+ },
+
+ _spin: function( step, event ) {
+ var value = this.value() || 0;
+
+ if ( !this.counter ) {
+ this.counter = 1;
+ }
+
+ value = this._adjustValue( value + step * this._increment( this.counter ) );
+
+ if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) {
+ this._value( value );
+ this.counter++;
+ }
+ },
+
+ _increment: function( i ) {
+ var incremental = this.options.incremental;
+
+ if ( incremental ) {
+ return $.isFunction( incremental ) ?
+ incremental( i ) :
+ Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 );
+ }
+
+ return 1;
+ },
+
+ _precision: function() {
+ var precision = this._precisionOf( this.options.step );
+ if ( this.options.min !== null ) {
+ precision = Math.max( precision, this._precisionOf( this.options.min ) );
+ }
+ return precision;
+ },
+
+ _precisionOf: function( num ) {
+ var str = num.toString(),
+ decimal = str.indexOf( "." );
+ return decimal === -1 ? 0 : str.length - decimal - 1;
+ },
+
+ _adjustValue: function( value ) {
+ var base, aboveMin,
+ options = this.options;
+
+ // make sure we're at a valid step
+ // - find out where we are relative to the base (min or 0)
+ base = options.min !== null ? options.min : 0;
+ aboveMin = value - base;
+ // - round to the nearest step
+ aboveMin = Math.round(aboveMin / options.step) * options.step;
+ // - rounding is based on 0, so adjust back to our base
+ value = base + aboveMin;
+
+ // fix precision from bad JS floating point math
+ value = parseFloat( value.toFixed( this._precision() ) );
+
+ // clamp the value
+ if ( options.max !== null && value > options.max) {
+ return options.max;
+ }
+ if ( options.min !== null && value < options.min ) {
+ return options.min;
+ }
+
+ return value;
+ },
+
+ _stop: function( event ) {
+ if ( !this.spinning ) {
+ return;
+ }
+
+ clearTimeout( this.timer );
+ clearTimeout( this.mousewheelTimer );
+ this.counter = 0;
+ this.spinning = false;
+ this._trigger( "stop", event );
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "culture" || key === "numberFormat" ) {
+ var prevValue = this._parse( this.element.val() );
+ this.options[ key ] = value;
+ this.element.val( this._format( prevValue ) );
+ return;
+ }
+
+ if ( key === "max" || key === "min" || key === "step" ) {
+ if ( typeof value === "string" ) {
+ value = this._parse( value );
+ }
+ }
+
+ this._super( key, value );
+
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.prop( "disabled", true );
+ this.buttons.button( "disable" );
+ } else {
+ this.element.prop( "disabled", false );
+ this.buttons.button( "enable" );
+ }
+ }
+ },
+
+ _setOptions: modifier(function( options ) {
+ this._super( options );
+ this._value( this.element.val() );
+ }),
+
+ _parse: function( val ) {
+ if ( typeof val === "string" && val !== "" ) {
+ val = window.Globalize && this.options.numberFormat ?
+ Globalize.parseFloat( val, 10, this.options.culture ) : +val;
+ }
+ return val === "" || isNaN( val ) ? null : val;
+ },
+
+ _format: function( value ) {
+ if ( value === "" ) {
+ return "";
+ }
+ return window.Globalize && this.options.numberFormat ?
+ Globalize.format( value, this.options.numberFormat, this.options.culture ) :
+ value;
+ },
+
+ _refresh: function() {
+ this.element.attr({
+ "aria-valuemin": this.options.min,
+ "aria-valuemax": this.options.max,
+ // TODO: what should we do with values that can't be parsed?
+ "aria-valuenow": this._parse( this.element.val() )
+ });
+ },
+
+ // update the value without triggering change
+ _value: function( value, allowAny ) {
+ var parsed;
+ if ( value !== "" ) {
+ parsed = this._parse( value );
+ if ( parsed !== null ) {
+ if ( !allowAny ) {
+ parsed = this._adjustValue( parsed );
+ }
+ value = this._format( parsed );
+ }
+ }
+ this.element.val( value );
+ this._refresh();
+ },
+
+ _destroy: function() {
+ this.element
+ .removeClass( "ui-spinner-input" )
+ .prop( "disabled", false )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+ this.uiSpinner.replaceWith( this.element );
+ },
+
+ stepUp: modifier(function( steps ) {
+ this._stepUp( steps );
+ }),
+ _stepUp: function( steps ) {
+ this._spin( (steps || 1) * this.options.step );
+ },
+
+ stepDown: modifier(function( steps ) {
+ this._stepDown( steps );
+ }),
+ _stepDown: function( steps ) {
+ this._spin( (steps || 1) * -this.options.step );
+ },
+
+ pageUp: modifier(function( pages ) {
+ this._stepUp( (pages || 1) * this.options.page );
+ }),
+
+ pageDown: modifier(function( pages ) {
+ this._stepDown( (pages || 1) * this.options.page );
+ }),
+
+ value: function( newVal ) {
+ if ( !arguments.length ) {
+ return this._parse( this.element.val() );
+ }
+ modifier( this._value ).call( this, newVal );
+ },
+
+ widget: function() {
+ return this.uiSpinner;
+ }
});
-}(jQuery));
-/*
- * jQuery UI Tabs 1.8.16
- *
- * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT or GPL Version 2 licenses.
- * http://jquery.org/license
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- * jquery.ui.core.js
- * jquery.ui.widget.js
- */
+}( jQuery ) );
+
(function( $, undefined ) {
var tabId = 0,
- listId = 0;
+ rhash = /#.*$/;
function getNextTabId() {
return ++tabId;
}
-function getNextListId() {
- return ++listId;
+function isLocal( anchor ) {
+ return anchor.hash.length > 1 &&
+ anchor.href.replace( rhash, "" ) ===
+ location.href.replace( rhash, "" )
+ // support: Safari 5.1
+ // Safari 5.1 doesn't encode spaces in window.location
+ // but it does encode spaces from anchors (#8777)
+ .replace( /\s/g, "%20" );
}
$.widget( "ui.tabs", {
+ version: "1.9.2",
+ delay: 300,
options: {
- add: null,
- ajaxOptions: null,
- cache: false,
- cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ active: null,
collapsible: false,
- disable: null,
- disabled: [],
- enable: null,
event: "click",
- fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
- idPrefix: "ui-tabs-",
- load: null,
- panelTemplate: "<div></div>",
- remove: null,
- select: null,
+ heightStyle: "content",
+ hide: null,
show: null,
- spinner: "<em>Loading&#8230;</em>",
- tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+
+ // callbacks
+ activate: null,
+ beforeActivate: null,
+ beforeLoad: null,
+ load: null
},
_create: function() {
- this._tabify( true );
- },
+ var that = this,
+ options = this.options,
+ active = options.active,
+ locationHash = location.hash.substring( 1 );
- _setOption: function( key, value ) {
- if ( key == "selected" ) {
- if (this.options.collapsible && value == this.options.selected ) {
- return;
+ this.running = false;
+
+ this.element
+ .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" )
+ .toggleClass( "ui-tabs-collapsible", options.collapsible )
+ // Prevent users from focusing disabled tabs via click
+ .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) {
+ if ( $( this ).is( ".ui-state-disabled" ) ) {
+ event.preventDefault();
+ }
+ })
+ // support: IE <9
+ // Preventing the default action in mousedown doesn't prevent IE
+ // from focusing the element, so if the anchor gets focused, blur.
+ // We don't have to worry about focusing the previously focused
+ // element since clicking on a non-focusable element should focus
+ // the body anyway.
+ .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() {
+ if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) {
+ this.blur();
+ }
+ });
+
+ this._processTabs();
+
+ if ( active === null ) {
+ // check the fragment identifier in the URL
+ if ( locationHash ) {
+ this.tabs.each(function( i, tab ) {
+ if ( $( tab ).attr( "aria-controls" ) === locationHash ) {
+ active = i;
+ return false;
+ }
+ });
}
- this.select( value );
+
+ // check for a tab marked active via a class
+ if ( active === null ) {
+ active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) );
+ }
+
+ // no active tab, set to false
+ if ( active === null || active === -1 ) {
+ active = this.tabs.length ? 0 : false;
+ }
+ }
+
+ // handle numbers: negative, out of range
+ if ( active !== false ) {
+ active = this.tabs.index( this.tabs.eq( active ) );
+ if ( active === -1 ) {
+ active = options.collapsible ? false : 0;
+ }
+ }
+ options.active = active;
+
+ // don't allow collapsible: false and active: false
+ if ( !options.collapsible && options.active === false && this.anchors.length ) {
+ options.active = 0;
+ }
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ if ( $.isArray( options.disabled ) ) {
+ options.disabled = $.unique( options.disabled.concat(
+ $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) {
+ return that.tabs.index( li );
+ })
+ ) ).sort();
+ }
+
+ // check for length avoids error when initializing empty list
+ if ( this.options.active !== false && this.anchors.length ) {
+ this.active = this._findActive( this.options.active );
} else {
- this.options[ key ] = value;
- this._tabify();
+ this.active = $();
+ }
+
+ this._refresh();
+
+ if ( this.active.length ) {
+ this.load( options.active );
}
},
- _tabId: function( a ) {
- return a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF-]/g, "" ) ||
- this.options.idPrefix + getNextTabId();
+ _getCreateEventData: function() {
+ return {
+ tab: this.active,
+ panel: !this.active.length ? $() : this._getPanelForTab( this.active )
+ };
},
- _sanitizeSelector: function( hash ) {
- // we need this because an id may contain a ":"
- return hash.replace( /:/g, "\\:" );
+ _tabKeydown: function( event ) {
+ var focusedTab = $( this.document[0].activeElement ).closest( "li" ),
+ selectedIndex = this.tabs.index( focusedTab ),
+ goingForward = true;
+
+ if ( this._handlePageNav( event ) ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ selectedIndex++;
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.LEFT:
+ goingForward = false;
+ selectedIndex--;
+ break;
+ case $.ui.keyCode.END:
+ selectedIndex = this.anchors.length - 1;
+ break;
+ case $.ui.keyCode.HOME:
+ selectedIndex = 0;
+ break;
+ case $.ui.keyCode.SPACE:
+ // Activate only, no collapsing
+ event.preventDefault();
+ clearTimeout( this.activating );
+ this._activate( selectedIndex );
+ return;
+ case $.ui.keyCode.ENTER:
+ // Toggle (cancel delayed activation, allow collapsing)
+ event.preventDefault();
+ clearTimeout( this.activating );
+ // Determine if we should collapse or activate
+ this._activate( selectedIndex === this.options.active ? false : selectedIndex );
+ return;
+ default:
+ return;
+ }
+
+ // Focus the appropriate tab, based on which key was pressed
+ event.preventDefault();
+ clearTimeout( this.activating );
+ selectedIndex = this._focusNextTab( selectedIndex, goingForward );
+
+ // Navigating with control key will prevent automatic activation
+ if ( !event.ctrlKey ) {
+ // Update aria-selected immediately so that AT think the tab is already selected.
+ // Otherwise AT may confuse the user by stating that they need to activate the tab,
+ // but the tab will already be activated by the time the announcement finishes.
+ focusedTab.attr( "aria-selected", "false" );
+ this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" );
+
+ this.activating = this._delay(function() {
+ this.option( "active", selectedIndex );
+ }, this.delay );
+ }
},
- _cookie: function() {
- var cookie = this.cookie ||
- ( this.cookie = this.options.cookie.name || "ui-tabs-" + getNextListId() );
- return $.cookie.apply( null, [ cookie ].concat( $.makeArray( arguments ) ) );
+ _panelKeydown: function( event ) {
+ if ( this._handlePageNav( event ) ) {
+ return;
+ }
+
+ // Ctrl+up moves focus to the current tab
+ if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) {
+ event.preventDefault();
+ this.active.focus();
+ }
},
- _ui: function( tab, panel ) {
- return {
- tab: tab,
- panel: panel,
- index: this.anchors.index( tab )
- };
+ // Alt+page up/down moves focus to the previous/next tab (and activates)
+ _handlePageNav: function( event ) {
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) {
+ this._activate( this._focusNextTab( this.options.active - 1, false ) );
+ return true;
+ }
+ if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) {
+ this._activate( this._focusNextTab( this.options.active + 1, true ) );
+ return true;
+ }
},
- _cleanup: function() {
- // restore all former loading tabs labels
- this.lis.filter( ".ui-state-processing" )
- .removeClass( "ui-state-processing" )
- .find( "span:data(label.tabs)" )
- .each(function() {
- var el = $( this );
- el.html( el.data( "label.tabs" ) ).removeData( "label.tabs" );
- });
+ _findNextTab: function( index, goingForward ) {
+ var lastTabIndex = this.tabs.length - 1;
+
+ function constrain() {
+ if ( index > lastTabIndex ) {
+ index = 0;
+ }
+ if ( index < 0 ) {
+ index = lastTabIndex;
+ }
+ return index;
+ }
+
+ while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) {
+ index = goingForward ? index + 1 : index - 1;
+ }
+
+ return index;
},
- _tabify: function( init ) {
- var self = this,
- o = this.options,
- fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ _focusNextTab: function( index, goingForward ) {
+ index = this._findNextTab( index, goingForward );
+ this.tabs.eq( index ).focus();
+ return index;
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "active" ) {
+ // _activate() will handle invalid values and update this.options
+ this._activate( value );
+ return;
+ }
- this.list = this.element.find( "ol,ul" ).eq( 0 );
- this.lis = $( " > li:has(a[href])", this.list );
- this.anchors = this.lis.map(function() {
- return $( "a", this )[ 0 ];
+ if ( key === "disabled" ) {
+ // don't use the widget factory's disabled handling
+ this._setupDisabled( value );
+ return;
+ }
+
+ this._super( key, value);
+
+ if ( key === "collapsible" ) {
+ this.element.toggleClass( "ui-tabs-collapsible", value );
+ // Setting collapsible: false while collapsed; open first panel
+ if ( !value && this.options.active === false ) {
+ this._activate( 0 );
+ }
+ }
+
+ if ( key === "event" ) {
+ this._setupEvents( value );
+ }
+
+ if ( key === "heightStyle" ) {
+ this._setupHeightStyle( value );
+ }
+ },
+
+ _tabId: function( tab ) {
+ return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId();
+ },
+
+ _sanitizeSelector: function( hash ) {
+ return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : "";
+ },
+
+ refresh: function() {
+ var options = this.options,
+ lis = this.tablist.children( ":has(a[href])" );
+
+ // get disabled tabs from class attribute from HTML
+ // this will get converted to a boolean if needed in _refresh()
+ options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) {
+ return lis.index( tab );
});
- this.panels = $( [] );
-
- this.anchors.each(function( i, a ) {
- var href = $( a ).attr( "href" );
- // For dynamically created HTML that contains a hash as href IE < 8 expands
- // such href to the full page url with hash and then misinterprets tab as ajax.
- // Same consideration applies for an added tab with a fragment identifier
- // since a[href=#fragment-identifier] does unexpectedly not match.
- // Thus normalize href attribute...
- var hrefBase = href.split( "#" )[ 0 ],
- baseEl;
- if ( hrefBase && ( hrefBase === location.toString().split( "#" )[ 0 ] ||
- ( baseEl = $( "base" )[ 0 ]) && hrefBase === baseEl.href ) ) {
- href = a.hash;
- a.href = href;
+
+ this._processTabs();
+
+ // was collapsed or no tabs
+ if ( options.active === false || !this.anchors.length ) {
+ options.active = false;
+ this.active = $();
+ // was active, but active tab is gone
+ } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) {
+ // all remaining tabs are disabled
+ if ( this.tabs.length === options.disabled.length ) {
+ options.active = false;
+ this.active = $();
+ // activate previous tab
+ } else {
+ this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) );
}
+ // was active, active tab still exists
+ } else {
+ // make sure active index is correct
+ options.active = this.tabs.index( this.active );
+ }
+
+ this._refresh();
+ },
+
+ _refresh: function() {
+ this._setupDisabled( this.options.disabled );
+ this._setupEvents( this.options.event );
+ this._setupHeightStyle( this.options.heightStyle );
+
+ this.tabs.not( this.active ).attr({
+ "aria-selected": "false",
+ tabIndex: -1
+ });
+ this.panels.not( this._getPanelForTab( this.active ) )
+ .hide()
+ .attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+
+ // Make sure one tab is in the tab order
+ if ( !this.active.length ) {
+ this.tabs.eq( 0 ).attr( "tabIndex", 0 );
+ } else {
+ this.active
+ .addClass( "ui-tabs-active ui-state-active" )
+ .attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ this._getPanelForTab( this.active )
+ .show()
+ .attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ });
+ }
+ },
+
+ _processTabs: function() {
+ var that = this;
+
+ this.tablist = this._getList()
+ .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" )
+ .attr( "role", "tablist" );
+
+ this.tabs = this.tablist.find( "> li:has(a[href])" )
+ .addClass( "ui-state-default ui-corner-top" )
+ .attr({
+ role: "tab",
+ tabIndex: -1
+ });
+
+ this.anchors = this.tabs.map(function() {
+ return $( "a", this )[ 0 ];
+ })
+ .addClass( "ui-tabs-anchor" )
+ .attr({
+ role: "presentation",
+ tabIndex: -1
+ });
+
+ this.panels = $();
+
+ this.anchors.each(function( i, anchor ) {
+ var selector, panel, panelId,
+ anchorId = $( anchor ).uniqueId().attr( "id" ),
+ tab = $( anchor ).closest( "li" ),
+ originalAriaControls = tab.attr( "aria-controls" );
// inline tab
- if ( fragmentId.test( href ) ) {
- self.panels = self.panels.add( self.element.find( self._sanitizeSelector( href ) ) );
+ if ( isLocal( anchor ) ) {
+ selector = anchor.hash;
+ panel = that.element.find( that._sanitizeSelector( selector ) );
// remote tab
- // prevent loading the page itself if href is just "#"
- } else if ( href && href !== "#" ) {
- // required for restore on destroy
- $.data( a, "href.tabs", href );
-
- // TODO until #3808 is fixed strip fragment identifier from url
- // (IE fails to load from such url)
- $.data( a, "load.tabs", href.replace( /#.*$/, "" ) );
-
- var id = self._tabId( a );
- a.href = "#" + id;
- var $panel = self.element.find( "#" + id );
- if ( !$panel.length ) {
- $panel = $( o.panelTemplate )
- .attr( "id", id )
- .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
- .insertAfter( self.panels[ i - 1 ] || self.list );
- $panel.data( "destroy.tabs", true );
- }
- self.panels = self.panels.add( $panel );
- // invalid tab href
} else {
- o.disabled.push( i );
+ panelId = that._tabId( tab );
+ selector = "#" + panelId;
+ panel = that.element.find( selector );
+ if ( !panel.length ) {
+ panel = that._createPanel( panelId );
+ panel.insertAfter( that.panels[ i - 1 ] || that.tablist );
+ }
+ panel.attr( "aria-live", "polite" );
}
+
+ if ( panel.length) {
+ that.panels = that.panels.add( panel );
+ }
+ if ( originalAriaControls ) {
+ tab.data( "ui-tabs-aria-controls", originalAriaControls );
+ }
+ tab.attr({
+ "aria-controls": selector.substring( 1 ),
+ "aria-labelledby": anchorId
+ });
+ panel.attr( "aria-labelledby", anchorId );
});
- // initialization from scratch
- if ( init ) {
- // attach necessary classes for styling
- this.element.addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" );
- this.list.addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
- this.lis.addClass( "ui-state-default ui-corner-top" );
- this.panels.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" );
-
- // Selected tab
- // use "selected" option or try to retrieve:
- // 1. from fragment identifier in url
- // 2. from cookie
- // 3. from selected class attribute on <li>
- if ( o.selected === undefined ) {
- if ( location.hash ) {
- this.anchors.each(function( i, a ) {
- if ( a.hash == location.hash ) {
- o.selected = i;
- return false;
- }
- });
- }
- if ( typeof o.selected !== "number" && o.cookie ) {
- o.selected = parseInt( self._cookie(), 10 );
- }
- if ( typeof o.selected !== "number" && this.lis.filter( ".ui-tabs-selected" ).length ) {
- o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
- }
- o.selected = o.selected || ( this.lis.length ? 0 : -1 );
- } else if ( o.selected === null ) { // usage of null is deprecated, TODO remove in next release
- o.selected = -1;
+ this.panels
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .attr( "role", "tabpanel" );
+ },
+
+ // allow overriding how to find the list for rare usage scenarios (#7715)
+ _getList: function() {
+ return this.element.find( "ol,ul" ).eq( 0 );
+ },
+
+ _createPanel: function( id ) {
+ return $( "<div>" )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .data( "ui-tabs-destroy", true );
+ },
+
+ _setupDisabled: function( disabled ) {
+ if ( $.isArray( disabled ) ) {
+ if ( !disabled.length ) {
+ disabled = false;
+ } else if ( disabled.length === this.anchors.length ) {
+ disabled = true;
}
+ }
- // sanity check - default to first tab...
- o.selected = ( ( o.selected >= 0 && this.anchors[ o.selected ] ) || o.selected < 0 )
- ? o.selected
- : 0;
+ // disable tabs
+ for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) {
+ if ( disabled === true || $.inArray( i, disabled ) !== -1 ) {
+ $( li )
+ .addClass( "ui-state-disabled" )
+ .attr( "aria-disabled", "true" );
+ } else {
+ $( li )
+ .removeClass( "ui-state-disabled" )
+ .removeAttr( "aria-disabled" );
+ }
+ }
- // Take disabling tabs via class attribute from HTML
- // into account and update option properly.
- // A selected tab cannot become disabled.
- o.disabled = $.unique( o.disabled.concat(
- $.map( this.lis.filter( ".ui-state-disabled" ), function( n, i ) {
- return self.lis.index( n );
- })
- ) ).sort();
+ this.options.disabled = disabled;
+ },
- if ( $.inArray( o.selected, o.disabled ) != -1 ) {
- o.disabled.splice( $.inArray( o.selected, o.disabled ), 1 );
+ _setupEvents: function( event ) {
+ var events = {
+ click: function( event ) {
+ event.preventDefault();
}
+ };
+ if ( event ) {
+ $.each( event.split(" "), function( index, eventName ) {
+ events[ eventName ] = "_eventHandler";
+ });
+ }
- // highlight selected tab
- this.panels.addClass( "ui-tabs-hide" );
- this.lis.removeClass( "ui-tabs-selected ui-state-active" );
- // check for length avoids error when initializing empty list
- if ( o.selected >= 0 && this.anchors.length ) {
- self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) ).removeClass( "ui-tabs-hide" );
- this.lis.eq( o.selected ).addClass( "ui-tabs-selected ui-state-active" );
+ this._off( this.anchors.add( this.tabs ).add( this.panels ) );
+ this._on( this.anchors, events );
+ this._on( this.tabs, { keydown: "_tabKeydown" } );
+ this._on( this.panels, { keydown: "_panelKeydown" } );
- // seems to be expected behavior that the show callback is fired
- self.element.queue( "tabs", function() {
- self._trigger( "show", null,
- self._ui( self.anchors[ o.selected ], self.element.find( self._sanitizeSelector( self.anchors[ o.selected ].hash ) )[ 0 ] ) );
- });
+ this._focusable( this.tabs );
+ this._hoverable( this.tabs );
+ },
- this.load( o.selected );
+ _setupHeightStyle: function( heightStyle ) {
+ var maxHeight, overflow,
+ parent = this.element.parent();
+
+ if ( heightStyle === "fill" ) {
+ // IE 6 treats height like minHeight, so we need to turn off overflow
+ // in order to get a reliable height
+ // we use the minHeight support test because we assume that only
+ // browsers that don't support minHeight will treat height as minHeight
+ if ( !$.support.minHeight ) {
+ overflow = parent.css( "overflow" );
+ parent.css( "overflow", "hidden");
}
+ maxHeight = parent.height();
+ this.element.siblings( ":visible" ).each(function() {
+ var elem = $( this ),
+ position = elem.css( "position" );
- // clean up to avoid memory leaks in certain versions of IE 6
- // TODO: namespace this event
- $( window ).bind( "unload", function() {
- self.lis.add( self.anchors ).unbind( ".tabs" );
- self.lis = self.anchors = self.panels = null;
+ if ( position === "absolute" || position === "fixed" ) {
+ return;
+ }
+ maxHeight -= elem.outerHeight( true );
});
- // update selected after add/remove
- } else {
- o.selected = this.lis.index( this.lis.filter( ".ui-tabs-selected" ) );
+ if ( overflow ) {
+ parent.css( "overflow", overflow );
+ }
+
+ this.element.children().not( this.panels ).each(function() {
+ maxHeight -= $( this ).outerHeight( true );
+ });
+
+ this.panels.each(function() {
+ $( this ).height( Math.max( 0, maxHeight -
+ $( this ).innerHeight() + $( this ).height() ) );
+ })
+ .css( "overflow", "auto" );
+ } else if ( heightStyle === "auto" ) {
+ maxHeight = 0;
+ this.panels.each(function() {
+ maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+ }).height( maxHeight );
}
+ },
- // update collapsible
- // TODO: use .toggleClass()
- this.element[ o.collapsible ? "addClass" : "removeClass" ]( "ui-tabs-collapsible" );
+ _eventHandler: function( event ) {
+ var options = this.options,
+ active = this.active,
+ anchor = $( event.currentTarget ),
+ tab = anchor.closest( "li" ),
+ clickedIsActive = tab[ 0 ] === active[ 0 ],
+ collapsing = clickedIsActive && options.collapsible,
+ toShow = collapsing ? $() : this._getPanelForTab( tab ),
+ toHide = !active.length ? $() : this._getPanelForTab( active ),
+ eventData = {
+ oldTab: active,
+ oldPanel: toHide,
+ newTab: collapsing ? $() : tab,
+ newPanel: toShow
+ };
+
+ event.preventDefault();
- // set or update cookie after init and add/remove respectively
- if ( o.cookie ) {
- this._cookie( o.selected, o.cookie );
+ if ( tab.hasClass( "ui-state-disabled" ) ||
+ // tab is already loading
+ tab.hasClass( "ui-tabs-loading" ) ||
+ // can't switch durning an animation
+ this.running ||
+ // click on active header, but not collapsible
+ ( clickedIsActive && !options.collapsible ) ||
+ // allow canceling activation
+ ( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+ return;
}
- // disable tabs
- for ( var i = 0, li; ( li = this.lis[ i ] ); i++ ) {
- $( li )[ $.inArray( i, o.disabled ) != -1 &&
- // TODO: use .toggleClass()
- !$( li ).hasClass( "ui-tabs-selected" ) ? "addClass" : "removeClass" ]( "ui-state-disabled" );
+ options.active = collapsing ? false : this.tabs.index( tab );
+
+ this.active = clickedIsActive ? $() : tab;
+ if ( this.xhr ) {
+ this.xhr.abort();
}
- // reset cache if switching from cached to not cached
- if ( o.cache === false ) {
- this.anchors.removeData( "cache.tabs" );
+ if ( !toHide.length && !toShow.length ) {
+ $.error( "jQuery UI Tabs: Mismatching fragment identifier." );
}
- // remove all handlers before, tabify may run on existing tabs after add or option change
- this.lis.add( this.anchors ).unbind( ".tabs" );
+ if ( toShow.length ) {
+ this.load( this.tabs.index( tab ), event );
+ }
+ this._toggle( event, eventData );
+ },
- if ( o.event !== "mouseover" ) {
- var addState = function( state, el ) {
- if ( el.is( ":not(.ui-state-disabled)" ) ) {
- el.addClass( "ui-state-" + state );
- }
- };
- var removeState = function( state, el ) {
- el.removeClass( "ui-state-" + state );
- };
- this.lis.bind( "mouseover.tabs" , function() {
- addState( "hover", $( this ) );
- });
- this.lis.bind( "mouseout.tabs", function() {
- removeState( "hover", $( this ) );
- });
- this.anchors.bind( "focus.tabs", function() {
- addState( "focus", $( this ).closest( "li" ) );
- });
- this.anchors.bind( "blur.tabs", function() {
- removeState( "focus", $( this ).closest( "li" ) );
+ // handles show/hide for selecting tabs
+ _toggle: function( event, eventData ) {
+ var that = this,
+ toShow = eventData.newPanel,
+ toHide = eventData.oldPanel;
+
+ this.running = true;
+
+ function complete() {
+ that.running = false;
+ that._trigger( "activate", event, eventData );
+ }
+
+ function show() {
+ eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" );
+
+ if ( toShow.length && that.options.show ) {
+ that._show( toShow, that.options.show, complete );
+ } else {
+ toShow.show();
+ complete();
+ }
+ }
+
+ // start out by hiding, then showing, then completing
+ if ( toHide.length && this.options.hide ) {
+ this._hide( toHide, this.options.hide, function() {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ show();
});
+ } else {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ toHide.hide();
+ show();
+ }
+
+ toHide.attr({
+ "aria-expanded": "false",
+ "aria-hidden": "true"
+ });
+ eventData.oldTab.attr( "aria-selected", "false" );
+ // If we're switching tabs, remove the old tab from the tab order.
+ // If we're opening from collapsed state, remove the previous tab from the tab order.
+ // If we're collapsing, then keep the collapsing tab in the tab order.
+ if ( toShow.length && toHide.length ) {
+ eventData.oldTab.attr( "tabIndex", -1 );
+ } else if ( toShow.length ) {
+ this.tabs.filter(function() {
+ return $( this ).attr( "tabIndex" ) === 0;
+ })
+ .attr( "tabIndex", -1 );
+ }
+
+ toShow.attr({
+ "aria-expanded": "true",
+ "aria-hidden": "false"
+ });
+ eventData.newTab.attr({
+ "aria-selected": "true",
+ tabIndex: 0
+ });
+ },
+
+ _activate: function( index ) {
+ var anchor,
+ active = this._findActive( index );
+
+ // trying to activate the already active panel
+ if ( active[ 0 ] === this.active[ 0 ] ) {
+ return;
+ }
+
+ // trying to collapse, simulate a click on the current active header
+ if ( !active.length ) {
+ active = this.active;
}
- // set up animations
- var hideFx, showFx;
- if ( o.fx ) {
- if ( $.isArray( o.fx ) ) {
- hideFx = o.fx[ 0 ];
- showFx = o.fx[ 1 ];
+ anchor = active.find( ".ui-tabs-anchor" )[ 0 ];
+ this._eventHandler({
+ target: anchor,
+ currentTarget: anchor,
+ preventDefault: $.noop
+ });
+ },
+
+ _findActive: function( index ) {
+ return index === false ? $() : this.tabs.eq( index );
+ },
+
+ _getIndex: function( index ) {
+ // meta-function to give users option to provide a href string instead of a numerical index.
+ if ( typeof index === "string" ) {
+ index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) );
+ }
+
+ return index;
+ },
+
+ _destroy: function() {
+ if ( this.xhr ) {
+ this.xhr.abort();
+ }
+
+ this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" );
+
+ this.tablist
+ .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" )
+ .removeAttr( "role" );
+
+ this.anchors
+ .removeClass( "ui-tabs-anchor" )
+ .removeAttr( "role" )
+ .removeAttr( "tabIndex" )
+ .removeData( "href.tabs" )
+ .removeData( "load.tabs" )
+ .removeUniqueId();
+
+ this.tabs.add( this.panels ).each(function() {
+ if ( $.data( this, "ui-tabs-destroy" ) ) {
+ $( this ).remove();
} else {
- hideFx = showFx = o.fx;
+ $( this )
+ .removeClass( "ui-state-default ui-state-active ui-state-disabled " +
+ "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" )
+ .removeAttr( "tabIndex" )
+ .removeAttr( "aria-live" )
+ .removeAttr( "aria-busy" )
+ .removeAttr( "aria-selected" )
+ .removeAttr( "aria-labelledby" )
+ .removeAttr( "aria-hidden" )
+ .removeAttr( "aria-expanded" )
+ .removeAttr( "role" );
}
+ });
+
+ this.tabs.each(function() {
+ var li = $( this ),
+ prev = li.data( "ui-tabs-aria-controls" );
+ if ( prev ) {
+ li.attr( "aria-controls", prev );
+ } else {
+ li.removeAttr( "aria-controls" );
+ }
+ });
+
+ this.panels.show();
+
+ if ( this.options.heightStyle !== "content" ) {
+ this.panels.css( "height", "" );
+ }
+ },
+
+ enable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === false ) {
+ return;
}
- // Reset certain styles left over from animation
- // and prevent IE's ClearType bug...
- function resetStyle( $el, fx ) {
- $el.css( "display", "" );
- if ( !$.support.opacity && fx.opacity ) {
- $el[ 0 ].style.removeAttribute( "filter" );
+ if ( index === undefined ) {
+ disabled = false;
+ } else {
+ index = this._getIndex( index );
+ if ( $.isArray( disabled ) ) {
+ disabled = $.map( disabled, function( num ) {
+ return num !== index ? num : null;
+ });
+ } else {
+ disabled = $.map( this.tabs, function( li, num ) {
+ return num !== index ? num : null;
+ });
}
}
+ this._setupDisabled( disabled );
+ },
- // Show a tab...
- var showTab = showFx
- ? function( clicked, $show ) {
- $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
- $show.hide().removeClass( "ui-tabs-hide" ) // avoid flicker that way
- .animate( showFx, showFx.duration || "normal", function() {
- resetStyle( $show, showFx );
- self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
- });
+ disable: function( index ) {
+ var disabled = this.options.disabled;
+ if ( disabled === true ) {
+ return;
+ }
+
+ if ( index === undefined ) {
+ disabled = true;
+ } else {
+ index = this._getIndex( index );
+ if ( $.inArray( index, disabled ) !== -1 ) {
+ return;
}
- : function( clicked, $show ) {
- $( clicked ).closest( "li" ).addClass( "ui-tabs-selected ui-state-active" );
- $show.removeClass( "ui-tabs-hide" );
- self._trigger( "show", null, self._ui( clicked, $show[ 0 ] ) );
+ if ( $.isArray( disabled ) ) {
+ disabled = $.merge( [ index ], disabled ).sort();
+ } else {
+ disabled = [ index ];
+ }
+ }
+ this._setupDisabled( disabled );
+ },
+
+ load: function( index, event ) {
+ index = this._getIndex( index );
+ var that = this,
+ tab = this.tabs.eq( index ),
+ anchor = tab.find( ".ui-tabs-anchor" ),
+ panel = this._getPanelForTab( tab ),
+ eventData = {
+ tab: tab,
+ panel: panel
};
- // Hide a tab, $show is optional...
- var hideTab = hideFx
- ? function( clicked, $hide ) {
- $hide.animate( hideFx, hideFx.duration || "normal", function() {
- self.lis.removeClass( "ui-tabs-selected ui-state-active" );
- $hide.addClass( "ui-tabs-hide" );
- resetStyle( $hide, hideFx );
- self.element.dequeue( "tabs" );
+ // not remote
+ if ( isLocal( anchor[ 0 ] ) ) {
+ return;
+ }
+
+ this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) );
+
+ // support: jQuery <1.8
+ // jQuery <1.8 returns false if the request is canceled in beforeSend,
+ // but as of 1.8, $.ajax() always returns a jqXHR object.
+ if ( this.xhr && this.xhr.statusText !== "canceled" ) {
+ tab.addClass( "ui-tabs-loading" );
+ panel.attr( "aria-busy", "true" );
+
+ this.xhr
+ .success(function( response ) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function() {
+ panel.html( response );
+ that._trigger( "load", event, eventData );
+ }, 1 );
+ })
+ .complete(function( jqXHR, status ) {
+ // support: jQuery <1.8
+ // http://bugs.jquery.com/ticket/11778
+ setTimeout(function() {
+ if ( status === "abort" ) {
+ that.panels.stop( false, true );
+ }
+
+ tab.removeClass( "ui-tabs-loading" );
+ panel.removeAttr( "aria-busy" );
+
+ if ( jqXHR === that.xhr ) {
+ delete that.xhr;
+ }
+ }, 1 );
});
- }
- : function( clicked, $hide, $show ) {
- self.lis.removeClass( "ui-tabs-selected ui-state-active" );
- $hide.addClass( "ui-tabs-hide" );
- self.element.dequeue( "tabs" );
- };
+ }
+ },
- // attach tab event handler, unbind to avoid duplicates from former tabifying...
- this.anchors.bind( o.event + ".tabs", function() {
- var el = this,
- $li = $(el).closest( "li" ),
- $hide = self.panels.filter( ":not(.ui-tabs-hide)" ),
- $show = self.element.find( self._sanitizeSelector( el.hash ) );
-
- // If tab is already selected and not collapsible or tab disabled or
- // or is already loading or click callback returns false stop here.
- // Check if click handler returns false last so that it is not executed
- // for a disabled or loading tab!
- if ( ( $li.hasClass( "ui-tabs-selected" ) && !o.collapsible) ||
- $li.hasClass( "ui-state-disabled" ) ||
- $li.hasClass( "ui-state-processing" ) ||
- self.panels.filter( ":animated" ).length ||
- self._trigger( "select", null, self._ui( this, $show[ 0 ] ) ) === false ) {
- this.blur();
- return false;
+ // TODO: Remove this function in 1.10 when ajaxOptions is removed
+ _ajaxSettings: function( anchor, event, eventData ) {
+ var that = this;
+ return {
+ url: anchor.attr( "href" ),
+ beforeSend: function( jqXHR, settings ) {
+ return that._trigger( "beforeLoad", event,
+ $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) );
}
+ };
+ },
+
+ _getPanelForTab: function( tab ) {
+ var id = $( tab ).attr( "aria-controls" );
+ return this.element.find( this._sanitizeSelector( "#" + id ) );
+ }
+});
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+
+ // helper method for a lot of the back compat extensions
+ $.ui.tabs.prototype._ui = function( tab, panel ) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index( tab )
+ };
+ };
+
+ // url method
+ $.widget( "ui.tabs", $.ui.tabs, {
+ url: function( index, url ) {
+ this.anchors.eq( index ).attr( "href", url );
+ }
+ });
+
+ // TODO: Remove _ajaxSettings() method when removing this extension
+ // ajaxOptions and cache options
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ ajaxOptions: null,
+ cache: false
+ },
+
+ _create: function() {
+ this._super();
- o.selected = self.anchors.index( this );
+ var that = this;
- self.abort();
+ this._on({ tabsbeforeload: function( event, ui ) {
+ // tab is already cached
+ if ( $.data( ui.tab[ 0 ], "cache.tabs" ) ) {
+ event.preventDefault();
+ return;
+ }
- // if tab may be closed
- if ( o.collapsible ) {
- if ( $li.hasClass( "ui-tabs-selected" ) ) {
- o.selected = -1;
+ ui.jqXHR.success(function() {
+ if ( that.options.cache ) {
+ $.data( ui.tab[ 0 ], "cache.tabs", true );
+ }
+ });
+ }});
+ },
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
+ _ajaxSettings: function( anchor, event, ui ) {
+ var ajaxOptions = this.options.ajaxOptions;
+ return $.extend( {}, ajaxOptions, {
+ error: function( xhr, status ) {
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ ajaxOptions.error(
+ xhr, status, ui.tab.closest( "li" ).index(), ui.tab[ 0 ] );
}
+ catch ( error ) {}
+ }
+ }, this._superApply( arguments ) );
+ },
- self.element.queue( "tabs", function() {
- hideTab( el, $hide );
- }).dequeue( "tabs" );
+ _setOption: function( key, value ) {
+ // reset cache if switching from cached to not cached
+ if ( key === "cache" && value === false ) {
+ this.anchors.removeData( "cache.tabs" );
+ }
+ this._super( key, value );
+ },
- this.blur();
- return false;
- } else if ( !$hide.length ) {
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
+ _destroy: function() {
+ this.anchors.removeData( "cache.tabs" );
+ this._super();
+ },
+
+ url: function( index ){
+ this.anchors.eq( index ).removeData( "cache.tabs" );
+ this._superApply( arguments );
+ }
+ });
+
+ // abort method
+ $.widget( "ui.tabs", $.ui.tabs, {
+ abort: function() {
+ if ( this.xhr ) {
+ this.xhr.abort();
+ }
+ }
+ });
+
+ // spinner
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ spinner: "<em>Loading&#8230;</em>"
+ },
+ _create: function() {
+ this._super();
+ this._on({
+ tabsbeforeload: function( event, ui ) {
+ // Don't react to nested tabs or tabs that don't use a spinner
+ if ( event.target !== this.element[ 0 ] ||
+ !this.options.spinner ) {
+ return;
}
- self.element.queue( "tabs", function() {
- showTab( el, $show );
+ var span = ui.tab.find( "span" ),
+ html = span.html();
+ span.html( this.options.spinner );
+ ui.jqXHR.complete(function() {
+ span.html( html );
});
+ }
+ });
+ }
+ });
- // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
- self.load( self.anchors.index( this ) );
+ // enable/disable events
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ enable: null,
+ disable: null
+ },
- this.blur();
- return false;
- }
+ enable: function( index ) {
+ var options = this.options,
+ trigger;
+
+ if ( index && options.disabled === true ||
+ ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) !== -1 ) ) {
+ trigger = true;
+ }
+
+ this._superApply( arguments );
+
+ if ( trigger ) {
+ this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
}
+ },
+
+ disable: function( index ) {
+ var options = this.options,
+ trigger;
- if ( o.cookie ) {
- self._cookie( o.selected, o.cookie );
+ if ( index && options.disabled === false ||
+ ( $.isArray( options.disabled ) && $.inArray( index, options.disabled ) === -1 ) ) {
+ trigger = true;
}
- // show new tab
- if ( $show.length ) {
- if ( $hide.length ) {
- self.element.queue( "tabs", function() {
- hideTab( el, $hide );
- });
+ this._superApply( arguments );
+
+ if ( trigger ) {
+ this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ }
+ }
+ });
+
+ // add/remove methods and events
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ add: null,
+ remove: null,
+ tabTemplate: "<li><a href='#{href}'><span>#{label}</span></a></li>"
+ },
+
+ add: function( url, label, index ) {
+ if ( index === undefined ) {
+ index = this.anchors.length;
+ }
+
+ var doInsertAfter, panel,
+ options = this.options,
+ li = $( options.tabTemplate
+ .replace( /#\{href\}/g, url )
+ .replace( /#\{label\}/g, label ) ),
+ id = !url.indexOf( "#" ) ?
+ url.replace( "#", "" ) :
+ this._tabId( li );
+
+ li.addClass( "ui-state-default ui-corner-top" ).data( "ui-tabs-destroy", true );
+ li.attr( "aria-controls", id );
+
+ doInsertAfter = index >= this.tabs.length;
+
+ // try to find an existing element before creating a new one
+ panel = this.element.find( "#" + id );
+ if ( !panel.length ) {
+ panel = this._createPanel( id );
+ if ( doInsertAfter ) {
+ if ( index > 0 ) {
+ panel.insertAfter( this.panels.eq( -1 ) );
+ } else {
+ panel.appendTo( this.element );
+ }
+ } else {
+ panel.insertBefore( this.panels[ index ] );
}
- self.element.queue( "tabs", function() {
- showTab( el, $show );
- });
+ }
+ panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ).hide();
- self.load( self.anchors.index( this ) );
+ if ( doInsertAfter ) {
+ li.appendTo( this.tablist );
} else {
- throw "jQuery UI Tabs: Mismatching fragment identifier.";
+ li.insertBefore( this.tabs[ index ] );
}
- // Prevent IE from keeping other link focussed when using the back button
- // and remove dotted border from clicked link. This is controlled via CSS
- // in modern browsers; blur() removes focus from address bar in Firefox
- // which can become a usability and annoying problem with tabs('rotate').
- if ( $.browser.msie ) {
- this.blur();
+ options.disabled = $.map( options.disabled, function( n ) {
+ return n >= index ? ++n : n;
+ });
+
+ this.refresh();
+ if ( this.tabs.length === 1 && options.active === false ) {
+ this.option( "active", 0 );
}
- });
- // disable click in any case
- this.anchors.bind( "click.tabs", function(){
- return false;
- });
- },
+ this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ return this;
+ },
- _getIndex: function( index ) {
- // meta-function to give users option to provide a href string instead of a numerical index.
- // also sanitizes numerical indexes to valid values.
- if ( typeof index == "string" ) {
- index = this.anchors.index( this.anchors.filter( "[href$=" + index + "]" ) );
+ remove: function( index ) {
+ index = this._getIndex( index );
+ var options = this.options,
+ tab = this.tabs.eq( index ).remove(),
+ panel = this._getPanelForTab( tab ).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ // We check for more than 2 tabs, because if there are only 2,
+ // then when we remove this tab, there will only be one tab left
+ // so we don't need to detect which tab to activate.
+ if ( tab.hasClass( "ui-tabs-active" ) && this.anchors.length > 2 ) {
+ this._activate( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
+ }
+
+ options.disabled = $.map(
+ $.grep( options.disabled, function( n ) {
+ return n !== index;
+ }),
+ function( n ) {
+ return n >= index ? --n : n;
+ });
+
+ this.refresh();
+
+ this._trigger( "remove", null, this._ui( tab.find( "a" )[ 0 ], panel[ 0 ] ) );
+ return this;
}
+ });
- return index;
- },
+ // length method
+ $.widget( "ui.tabs", $.ui.tabs, {
+ length: function() {
+ return this.anchors.length;
+ }
+ });
- destroy: function() {
- var o = this.options;
+ // panel ids (idPrefix option + title attribute)
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ idPrefix: "ui-tabs-"
+ },
- this.abort();
+ _tabId: function( tab ) {
+ var a = tab.is( "li" ) ? tab.find( "a[href]" ) : tab;
+ a = a[0];
+ return $( a ).closest( "li" ).attr( "aria-controls" ) ||
+ a.title && a.title.replace( /\s/g, "_" ).replace( /[^\w\u00c0-\uFFFF\-]/g, "" ) ||
+ this.options.idPrefix + getNextTabId();
+ }
+ });
- this.element
- .unbind( ".tabs" )
- .removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" )
- .removeData( "tabs" );
+ // _createPanel method
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ panelTemplate: "<div></div>"
+ },
- this.list.removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" );
+ _createPanel: function( id ) {
+ return $( this.options.panelTemplate )
+ .attr( "id", id )
+ .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" )
+ .data( "ui-tabs-destroy", true );
+ }
+ });
- this.anchors.each(function() {
- var href = $.data( this, "href.tabs" );
- if ( href ) {
- this.href = href;
+ // selected option
+ $.widget( "ui.tabs", $.ui.tabs, {
+ _create: function() {
+ var options = this.options;
+ if ( options.active === null && options.selected !== undefined ) {
+ options.active = options.selected === -1 ? false : options.selected;
}
- var $this = $( this ).unbind( ".tabs" );
- $.each( [ "href", "load", "cache" ], function( i, prefix ) {
- $this.removeData( prefix + ".tabs" );
- });
- });
+ this._super();
+ options.selected = options.active;
+ if ( options.selected === false ) {
+ options.selected = -1;
+ }
+ },
- this.lis.unbind( ".tabs" ).add( this.panels ).each(function() {
- if ( $.data( this, "destroy.tabs" ) ) {
- $( this ).remove();
- } else {
- $( this ).removeClass([
- "ui-state-default",
- "ui-corner-top",
- "ui-tabs-selected",
- "ui-state-active",
- "ui-state-hover",
- "ui-state-focus",
- "ui-state-disabled",
- "ui-tabs-panel",
- "ui-widget-content",
- "ui-corner-bottom",
- "ui-tabs-hide"
- ].join( " " ) );
+ _setOption: function( key, value ) {
+ if ( key !== "selected" ) {
+ return this._super( key, value );
}
- });
- if ( o.cookie ) {
- this._cookie( null, o.cookie );
+ var options = this.options;
+ this._super( "active", value === -1 ? false : value );
+ options.selected = options.active;
+ if ( options.selected === false ) {
+ options.selected = -1;
+ }
+ },
+
+ _eventHandler: function() {
+ this._superApply( arguments );
+ this.options.selected = this.options.active;
+ if ( this.options.selected === false ) {
+ this.options.selected = -1;
+ }
}
+ });
- return this;
- },
+ // show and select event
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ show: null,
+ select: null
+ },
+ _create: function() {
+ this._super();
+ if ( this.options.active !== false ) {
+ this._trigger( "show", null, this._ui(
+ this.active.find( ".ui-tabs-anchor" )[ 0 ],
+ this._getPanelForTab( this.active )[ 0 ] ) );
+ }
+ },
+ _trigger: function( type, event, data ) {
+ var tab, panel,
+ ret = this._superApply( arguments );
- add: function( url, label, index ) {
- if ( index === undefined ) {
- index = this.anchors.length;
+ if ( !ret ) {
+ return false;
+ }
+
+ if ( type === "beforeActivate" ) {
+ tab = data.newTab.length ? data.newTab : data.oldTab;
+ panel = data.newPanel.length ? data.newPanel : data.oldPanel;
+ ret = this._super( "select", event, {
+ tab: tab.find( ".ui-tabs-anchor" )[ 0],
+ panel: panel[ 0 ],
+ index: tab.closest( "li" ).index()
+ });
+ } else if ( type === "activate" && data.newTab.length ) {
+ ret = this._super( "show", event, {
+ tab: data.newTab.find( ".ui-tabs-anchor" )[ 0 ],
+ panel: data.newPanel[ 0 ],
+ index: data.newTab.closest( "li" ).index()
+ });
+ }
+ return ret;
}
+ });
- var self = this,
- o = this.options,
- $li = $( o.tabTemplate.replace( /#\{href\}/g, url ).replace( /#\{label\}/g, label ) ),
- id = !url.indexOf( "#" ) ? url.replace( "#", "" ) : this._tabId( $( "a", $li )[ 0 ] );
+ // select method
+ $.widget( "ui.tabs", $.ui.tabs, {
+ select: function( index ) {
+ index = this._getIndex( index );
+ if ( index === -1 ) {
+ if ( this.options.collapsible && this.options.selected !== -1 ) {
+ index = this.options.selected;
+ } else {
+ return;
+ }
+ }
+ this.anchors.eq( index ).trigger( this.options.event + this.eventNamespace );
+ }
+ });
- $li.addClass( "ui-state-default ui-corner-top" ).data( "destroy.tabs", true );
+ // cookie option
+ (function() {
- // try to find an existing element before creating a new one
- var $panel = self.element.find( "#" + id );
- if ( !$panel.length ) {
- $panel = $( o.panelTemplate )
- .attr( "id", id )
- .data( "destroy.tabs", true );
+ var listId = 0;
+
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ cookie: null // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ },
+ _create: function() {
+ var options = this.options,
+ active;
+ if ( options.active == null && options.cookie ) {
+ active = parseInt( this._cookie(), 10 );
+ if ( active === -1 ) {
+ active = false;
+ }
+ options.active = active;
+ }
+ this._super();
+ },
+ _cookie: function( active ) {
+ var cookie = [ this.cookie ||
+ ( this.cookie = this.options.cookie.name || "ui-tabs-" + (++listId) ) ];
+ if ( arguments.length ) {
+ cookie.push( active === false ? -1 : active );
+ cookie.push( this.options.cookie );
+ }
+ return $.cookie.apply( null, cookie );
+ },
+ _refresh: function() {
+ this._super();
+ if ( this.options.cookie ) {
+ this._cookie( this.options.active, this.options.cookie );
+ }
+ },
+ _eventHandler: function() {
+ this._superApply( arguments );
+ if ( this.options.cookie ) {
+ this._cookie( this.options.active, this.options.cookie );
+ }
+ },
+ _destroy: function() {
+ this._super();
+ if ( this.options.cookie ) {
+ this._cookie( null, this.options.cookie );
+ }
}
- $panel.addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide" );
+ });
- if ( index >= this.lis.length ) {
- $li.appendTo( this.list );
- $panel.appendTo( this.list[ 0 ].parentNode );
- } else {
- $li.insertBefore( this.lis[ index ] );
- $panel.insertBefore( this.panels[ index ] );
+ })();
+
+ // load event
+ $.widget( "ui.tabs", $.ui.tabs, {
+ _trigger: function( type, event, data ) {
+ var _data = $.extend( {}, data );
+ if ( type === "load" ) {
+ _data.panel = _data.panel[ 0 ];
+ _data.tab = _data.tab.find( ".ui-tabs-anchor" )[ 0 ];
+ }
+ return this._super( type, event, _data );
}
+ });
- o.disabled = $.map( o.disabled, function( n, i ) {
- return n >= index ? ++n : n;
- });
+ // fx option
+ // The new animation options (show, hide) conflict with the old show callback.
+ // The old fx option wins over show/hide anyway (always favor back-compat).
+ // If a user wants to use the new animation API, they must give up the old API.
+ $.widget( "ui.tabs", $.ui.tabs, {
+ options: {
+ fx: null // e.g. { height: "toggle", opacity: "toggle", duration: 200 }
+ },
- this._tabify();
+ _getFx: function() {
+ var hide, show,
+ fx = this.options.fx;
- if ( this.anchors.length == 1 ) {
- o.selected = 0;
- $li.addClass( "ui-tabs-selected ui-state-active" );
- $panel.removeClass( "ui-tabs-hide" );
- this.element.queue( "tabs", function() {
- self._trigger( "show", null, self._ui( self.anchors[ 0 ], self.panels[ 0 ] ) );
- });
+ if ( fx ) {
+ if ( $.isArray( fx ) ) {
+ hide = fx[ 0 ];
+ show = fx[ 1 ];
+ } else {
+ hide = show = fx;
+ }
+ }
+
+ return fx ? { show: show, hide: hide } : null;
+ },
+
+ _toggle: function( event, eventData ) {
+ var that = this,
+ toShow = eventData.newPanel,
+ toHide = eventData.oldPanel,
+ fx = this._getFx();
+
+ if ( !fx ) {
+ return this._super( event, eventData );
+ }
+
+ that.running = true;
- this.load( 0 );
+ function complete() {
+ that.running = false;
+ that._trigger( "activate", event, eventData );
+ }
+
+ function show() {
+ eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" );
+
+ if ( toShow.length && fx.show ) {
+ toShow
+ .animate( fx.show, fx.show.duration, function() {
+ complete();
+ });
+ } else {
+ toShow.show();
+ complete();
+ }
+ }
+
+ // start out by hiding, then showing, then completing
+ if ( toHide.length && fx.hide ) {
+ toHide.animate( fx.hide, fx.hide.duration, function() {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ show();
+ });
+ } else {
+ eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" );
+ toHide.hide();
+ show();
+ }
}
+ });
+}
- this._trigger( "add", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
- return this;
+})( jQuery );
+
+(function( $ ) {
+
+var increments = 0;
+
+function addDescribedBy( elem, id ) {
+ var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ );
+ describedby.push( id );
+ elem
+ .data( "ui-tooltip-id", id )
+ .attr( "aria-describedby", $.trim( describedby.join( " " ) ) );
+}
+
+function removeDescribedBy( elem ) {
+ var id = elem.data( "ui-tooltip-id" ),
+ describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ),
+ index = $.inArray( id, describedby );
+ if ( index !== -1 ) {
+ describedby.splice( index, 1 );
+ }
+
+ elem.removeData( "ui-tooltip-id" );
+ describedby = $.trim( describedby.join( " " ) );
+ if ( describedby ) {
+ elem.attr( "aria-describedby", describedby );
+ } else {
+ elem.removeAttr( "aria-describedby" );
+ }
+}
+
+$.widget( "ui.tooltip", {
+ version: "1.9.2",
+ options: {
+ content: function() {
+ return $( this ).attr( "title" );
+ },
+ hide: true,
+ // Disabled elements have inconsistent behavior across browsers (#8661)
+ items: "[title]:not([disabled])",
+ position: {
+ my: "left top+15",
+ at: "left bottom",
+ collision: "flipfit flip"
+ },
+ show: true,
+ tooltipClass: null,
+ track: false,
+
+ // callbacks
+ close: null,
+ open: null
},
- remove: function( index ) {
- index = this._getIndex( index );
- var o = this.options,
- $li = this.lis.eq( index ).remove(),
- $panel = this.panels.eq( index ).remove();
-
- // If selected tab was removed focus tab to the right or
- // in case the last tab was removed the tab to the left.
- if ( $li.hasClass( "ui-tabs-selected" ) && this.anchors.length > 1) {
- this.select( index + ( index + 1 < this.anchors.length ? 1 : -1 ) );
- }
-
- o.disabled = $.map(
- $.grep( o.disabled, function(n, i) {
- return n != index;
- }),
- function( n, i ) {
- return n >= index ? --n : n;
- });
+ _create: function() {
+ this._on({
+ mouseover: "open",
+ focusin: "open"
+ });
- this._tabify();
+ // IDs of generated tooltips, needed for destroy
+ this.tooltips = {};
+ // IDs of parent tooltips where we removed the title attribute
+ this.parents = {};
- this._trigger( "remove", null, this._ui( $li.find( "a" )[ 0 ], $panel[ 0 ] ) );
- return this;
+ if ( this.options.disabled ) {
+ this._disable();
+ }
},
- enable: function( index ) {
- index = this._getIndex( index );
- var o = this.options;
- if ( $.inArray( index, o.disabled ) == -1 ) {
+ _setOption: function( key, value ) {
+ var that = this;
+
+ if ( key === "disabled" ) {
+ this[ value ? "_disable" : "_enable" ]();
+ this.options[ key ] = value;
+ // disable element style changes
return;
}
- this.lis.eq( index ).removeClass( "ui-state-disabled" );
- o.disabled = $.grep( o.disabled, function( n, i ) {
- return n != index;
+ this._super( key, value );
+
+ if ( key === "content" ) {
+ $.each( this.tooltips, function( id, element ) {
+ that._updateContent( element );
+ });
+ }
+ },
+
+ _disable: function() {
+ var that = this;
+
+ // close open tooltips
+ $.each( this.tooltips, function( id, element ) {
+ var event = $.Event( "blur" );
+ event.target = event.currentTarget = element[0];
+ that.close( event, true );
});
- this._trigger( "enable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
- return this;
+ // remove title attributes to prevent native tooltips
+ this.element.find( this.options.items ).andSelf().each(function() {
+ var element = $( this );
+ if ( element.is( "[title]" ) ) {
+ element
+ .data( "ui-tooltip-title", element.attr( "title" ) )
+ .attr( "title", "" );
+ }
+ });
},
- disable: function( index ) {
- index = this._getIndex( index );
- var self = this, o = this.options;
- // cannot disable already selected tab
- if ( index != o.selected ) {
- this.lis.eq( index ).addClass( "ui-state-disabled" );
+ _enable: function() {
+ // restore title attributes
+ this.element.find( this.options.items ).andSelf().each(function() {
+ var element = $( this );
+ if ( element.data( "ui-tooltip-title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ }
+ });
+ },
- o.disabled.push( index );
- o.disabled.sort();
+ open: function( event ) {
+ var that = this,
+ target = $( event ? event.target : this.element )
+ // we need closest here due to mouseover bubbling,
+ // but always pointing at the same event target
+ .closest( this.options.items );
- this._trigger( "disable", null, this._ui( this.anchors[ index ], this.panels[ index ] ) );
+ // No element to show a tooltip for or the tooltip is already open
+ if ( !target.length || target.data( "ui-tooltip-id" ) ) {
+ return;
}
- return this;
+ if ( target.attr( "title" ) ) {
+ target.data( "ui-tooltip-title", target.attr( "title" ) );
+ }
+
+ target.data( "ui-tooltip-open", true );
+
+ // kill parent tooltips, custom or native, for hover
+ if ( event && event.type === "mouseover" ) {
+ target.parents().each(function() {
+ var parent = $( this ),
+ blurEvent;
+ if ( parent.data( "ui-tooltip-open" ) ) {
+ blurEvent = $.Event( "blur" );
+ blurEvent.target = blurEvent.currentTarget = this;
+ that.close( blurEvent, true );
+ }
+ if ( parent.attr( "title" ) ) {
+ parent.uniqueId();
+ that.parents[ this.id ] = {
+ element: this,
+ title: parent.attr( "title" )
+ };
+ parent.attr( "title", "" );
+ }
+ });
+ }
+
+ this._updateContent( target, event );
},
- select: function( index ) {
- index = this._getIndex( index );
- if ( index == -1 ) {
- if ( this.options.collapsible && this.options.selected != -1 ) {
- index = this.options.selected;
- } else {
- return this;
+ _updateContent: function( target, event ) {
+ var content,
+ contentOption = this.options.content,
+ that = this,
+ eventType = event ? event.type : null;
+
+ if ( typeof contentOption === "string" ) {
+ return this._open( event, target, contentOption );
+ }
+
+ content = contentOption.call( target[0], function( response ) {
+ // ignore async response if tooltip was closed already
+ if ( !target.data( "ui-tooltip-open" ) ) {
+ return;
}
+ // IE may instantly serve a cached response for ajax requests
+ // delay this call to _open so the other call to _open runs first
+ that._delay(function() {
+ // jQuery creates a special event for focusin when it doesn't
+ // exist natively. To improve performance, the native event
+ // object is reused and the type is changed. Therefore, we can't
+ // rely on the type being correct after the event finished
+ // bubbling, so we set it back to the previous value. (#8740)
+ if ( event ) {
+ event.type = eventType;
+ }
+ this._open( event, target, response );
+ });
+ });
+ if ( content ) {
+ this._open( event, target, content );
}
- this.anchors.eq( index ).trigger( this.options.event + ".tabs" );
- return this;
},
- load: function( index ) {
- index = this._getIndex( index );
- var self = this,
- o = this.options,
- a = this.anchors.eq( index )[ 0 ],
- url = $.data( a, "load.tabs" );
-
- this.abort();
+ _open: function( event, target, content ) {
+ var tooltip, events, delayedShow,
+ positionOption = $.extend( {}, this.options.position );
- // not remote or from cache
- if ( !url || this.element.queue( "tabs" ).length !== 0 && $.data( a, "cache.tabs" ) ) {
- this.element.dequeue( "tabs" );
+ if ( !content ) {
return;
}
- // load remote from here on
- this.lis.eq( index ).addClass( "ui-state-processing" );
-
- if ( o.spinner ) {
- var span = $( "span", a );
- span.data( "label.tabs", span.html() ).html( o.spinner );
+ // Content can be updated multiple times. If the tooltip already
+ // exists, then just update the content and bail.
+ tooltip = this._find( target );
+ if ( tooltip.length ) {
+ tooltip.find( ".ui-tooltip-content" ).html( content );
+ return;
}
- this.xhr = $.ajax( $.extend( {}, o.ajaxOptions, {
- url: url,
- success: function( r, s ) {
- self.element.find( self._sanitizeSelector( a.hash ) ).html( r );
+ // if we have a title, clear it to prevent the native tooltip
+ // we have to check first to avoid defining a title if none exists
+ // (we don't want to cause an element to start matching [title])
+ //
+ // We use removeAttr only for key events, to allow IE to export the correct
+ // accessible attributes. For mouse events, set to empty string to avoid
+ // native tooltip showing up (happens only when removing inside mouseover).
+ if ( target.is( "[title]" ) ) {
+ if ( event && event.type === "mouseover" ) {
+ target.attr( "title", "" );
+ } else {
+ target.removeAttr( "title" );
+ }
+ }
- // take care of tab labels
- self._cleanup();
+ tooltip = this._tooltip( target );
+ addDescribedBy( target, tooltip.attr( "id" ) );
+ tooltip.find( ".ui-tooltip-content" ).html( content );
- if ( o.cache ) {
- $.data( a, "cache.tabs", true );
+ function position( event ) {
+ positionOption.of = event;
+ if ( tooltip.is( ":hidden" ) ) {
+ return;
+ }
+ tooltip.position( positionOption );
+ }
+ if ( this.options.track && event && /^mouse/.test( event.type ) ) {
+ this._on( this.document, {
+ mousemove: position
+ });
+ // trigger once to override element-relative positioning
+ position( event );
+ } else {
+ tooltip.position( $.extend({
+ of: target
+ }, this.options.position ) );
+ }
+
+ tooltip.hide();
+
+ this._show( tooltip, this.options.show );
+ // Handle tracking tooltips that are shown with a delay (#8644). As soon
+ // as the tooltip is visible, position the tooltip using the most recent
+ // event.
+ if ( this.options.show && this.options.show.delay ) {
+ delayedShow = setInterval(function() {
+ if ( tooltip.is( ":visible" ) ) {
+ position( positionOption.of );
+ clearInterval( delayedShow );
}
+ }, $.fx.interval );
+ }
- self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
- try {
- o.ajaxOptions.success( r, s );
- }
- catch ( e ) {}
- },
- error: function( xhr, s, e ) {
- // take care of tab labels
- self._cleanup();
+ this._trigger( "open", event, { tooltip: tooltip } );
- self._trigger( "load", null, self._ui( self.anchors[ index ], self.panels[ index ] ) );
- try {
- // Passing index avoid a race condition when this method is
- // called after the user has selected another tab.
- // Pass the anchor that initiated this request allows
- // loadError to manipulate the tab content panel via $(a.hash)
- o.ajaxOptions.error( xhr, s, index, a );
+ events = {
+ keyup: function( event ) {
+ if ( event.keyCode === $.ui.keyCode.ESCAPE ) {
+ var fakeEvent = $.Event(event);
+ fakeEvent.currentTarget = target[0];
+ this.close( fakeEvent, true );
}
- catch ( e ) {}
+ },
+ remove: function() {
+ this._removeTooltip( tooltip );
}
- } ) );
+ };
+ if ( !event || event.type === "mouseover" ) {
+ events.mouseleave = "close";
+ }
+ if ( !event || event.type === "focusin" ) {
+ events.focusout = "close";
+ }
+ this._on( true, target, events );
+ },
- // last, so that load event is fired before show...
- self.element.dequeue( "tabs" );
+ close: function( event ) {
+ var that = this,
+ target = $( event ? event.currentTarget : this.element ),
+ tooltip = this._find( target );
- return this;
- },
+ // disabling closes the tooltip, so we need to track when we're closing
+ // to avoid an infinite loop in case the tooltip becomes disabled on close
+ if ( this.closing ) {
+ return;
+ }
- abort: function() {
- // stop possibly running animations
- this.element.queue( [] );
- this.panels.stop( false, true );
+ // only set title if we had one before (see comment in _open())
+ if ( target.data( "ui-tooltip-title" ) ) {
+ target.attr( "title", target.data( "ui-tooltip-title" ) );
+ }
- // "tabs" queue must not contain more than two elements,
- // which are the callbacks for the latest clicked tab...
- this.element.queue( "tabs", this.element.queue( "tabs" ).splice( -2, 2 ) );
+ removeDescribedBy( target );
- // terminate pending requests from other tabs
- if ( this.xhr ) {
- this.xhr.abort();
- delete this.xhr;
+ tooltip.stop( true );
+ this._hide( tooltip, this.options.hide, function() {
+ that._removeTooltip( $( this ) );
+ });
+
+ target.removeData( "ui-tooltip-open" );
+ this._off( target, "mouseleave focusout keyup" );
+ // Remove 'remove' binding only on delegated targets
+ if ( target[0] !== this.element[0] ) {
+ this._off( target, "remove" );
}
+ this._off( this.document, "mousemove" );
- // take care of tab labels
- this._cleanup();
- return this;
+ if ( event && event.type === "mouseleave" ) {
+ $.each( this.parents, function( id, parent ) {
+ $( parent.element ).attr( "title", parent.title );
+ delete that.parents[ id ];
+ });
+ }
+
+ this.closing = true;
+ this._trigger( "close", event, { tooltip: tooltip } );
+ this.closing = false;
},
- url: function( index, url ) {
- this.anchors.eq( index ).removeData( "cache.tabs" ).data( "load.tabs", url );
- return this;
+ _tooltip: function( element ) {
+ var id = "ui-tooltip-" + increments++,
+ tooltip = $( "<div>" )
+ .attr({
+ id: id,
+ role: "tooltip"
+ })
+ .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " +
+ ( this.options.tooltipClass || "" ) );
+ $( "<div>" )
+ .addClass( "ui-tooltip-content" )
+ .appendTo( tooltip );
+ tooltip.appendTo( this.document[0].body );
+ if ( $.fn.bgiframe ) {
+ tooltip.bgiframe();
+ }
+ this.tooltips[ id ] = element;
+ return tooltip;
},
- length: function() {
- return this.anchors.length;
- }
-});
+ _find: function( target ) {
+ var id = target.data( "ui-tooltip-id" );
+ return id ? $( "#" + id ) : $();
+ },
-$.extend( $.ui.tabs, {
- version: "1.8.16"
-});
+ _removeTooltip: function( tooltip ) {
+ tooltip.remove();
+ delete this.tooltips[ tooltip.attr( "id" ) ];
+ },
-/*
- * Tabs Extensions
- */
+ _destroy: function() {
+ var that = this;
-/*
- * Rotate
- */
-$.extend( $.ui.tabs.prototype, {
- rotation: null,
- rotate: function( ms, continuing ) {
- var self = this,
- o = this.options;
+ // close open tooltips
+ $.each( this.tooltips, function( id, element ) {
+ // Delegate to close method to handle common cleanup
+ var event = $.Event( "blur" );
+ event.target = event.currentTarget = element[0];
+ that.close( event, true );
- var rotate = self._rotate || ( self._rotate = function( e ) {
- clearTimeout( self.rotation );
- self.rotation = setTimeout(function() {
- var t = o.selected;
- self.select( ++t < self.anchors.length ? t : 0 );
- }, ms );
-
- if ( e ) {
- e.stopPropagation();
- }
- });
+ // Remove immediately; destroying an open tooltip doesn't use the
+ // hide animation
+ $( "#" + id ).remove();
- var stop = self._unrotate || ( self._unrotate = !continuing
- ? function(e) {
- if (e.clientX) { // in case of a true click
- self.rotate(null);
- }
+ // Restore the title
+ if ( element.data( "ui-tooltip-title" ) ) {
+ element.attr( "title", element.data( "ui-tooltip-title" ) );
+ element.removeData( "ui-tooltip-title" );
}
- : function( e ) {
- t = o.selected;
- rotate();
- });
-
- // start rotation
- if ( ms ) {
- this.element.bind( "tabsshow", rotate );
- this.anchors.bind( o.event + ".tabs", stop );
- rotate();
- // stop rotation
- } else {
- clearTimeout( self.rotation );
- this.element.unbind( "tabsshow", rotate );
- this.anchors.unbind( o.event + ".tabs", stop );
- delete this._rotate;
- delete this._unrotate;
- }
-
- return this;
+ });
}
});
-})( jQuery );
+}( jQuery ) );